Use the valence bond theory approach to explain why the Co(NH3)6** ion is a diamagnetic, low-spin complex, whereas the CoFe ion is a paramagnetic, high-spin complex. (Hint: Explain the type of hybridized orbitals of each complex. i.e., outer or inner-orbital complex? and the number of unpaired electrons for each complex).

Use the valence bond theory approach to explain why the Co(NH3)6** ion is a diamagnetic, low-spin complex, whereas the CoFe ion is a paramagnetic, high-spin complex. (Hint: Explain the type of hybridized orbitals of each complex. i.e., outer or inner-orbital complex? and the number of unpaired electrons for each complex).

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 61AP

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
A classmate says, “A weak-field ligand usually means the complex is high spin.” Is your classmate correct? Explain.
oving to another question will save this response. complex [Co(NH3)6l absorbs light at a wavelength of 465 nm. What is the ligand field aplitting energy for the cormplez in Jlaole? 275 x 10 to negative x AMoving to another question will save this response.
Solve correctly please.
Take the following complexes into account: A) [Co(en);]I3 B) Li4[COF3(OH);] a) Which type of hybridization might occur? Explain using Valence Bond Theory. b) Calculate the magnetic moments in Bohr Magnetons (B.M.). c) Do you expect any isomerism? Explain. d) Show crystal field splitting and estimate ligand field stabilization energy.
???
General Chemistry 4th Edition McQuarrie Rock• Gallogly University Science Books presented by Macmillan Learning Classify the complex ions as high spin or low spin. High spin Low spin Answer Bank |CO(NH,),P* three unpaired electrons [Fe(CN),- one unpaired electron |Mn(H,O),P* five unpaired electrons [Fe(CN), no unpaired electrons |CoF,P four unpaired electrons
6. Which of the following statements is true about bidental ligand: O a) An electron pair acceptor. O b) A charged species consisting of a metal ion surrounded by ligands. O c) A ligand that can form two bonds (donate two electron pairs) to a metal ion O d) An electron pair donor e) A neutral molecule or charged ion that acts like a Lewis base by donating a lone pair of electron. f) A neutral compound (often containing a transition metal) consisting of a complex ion and a ligand O g) A metal ion surrounded by six ligands in an octahedral
1. Co(NH3)63+ is a low-spin complex while CoF63- is a high-spin complex. Give a rational for this difference by applying valence bond theory (i.e. illustration the hybridization and filling up of the metal orbitals). Which is the inner orbital complex and the outer orbital complex?