plz explain in detail 4Two porous containers are filled with He and Ne. Under the same conditions, of He escapes in 1 hour.5of the Ne to escape? Ans: 1.40 hrs.How long will it take for

Answered: Image /qna-images/answer/3ba4eab1-2128-4405-a071-4748ddb42dd5.jpg

Answered: Two porous containers are filled with…

Two porous containers are filled with He and Ne. Under the same conditions, the c 1 Ana 110h00 4 of He escapes in 1 hour.

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter6: The States Of Matter

Section: Chapter Questions

Problem 6.62E

See similar textbooks

Similar questions

perform stoichiometric ca1cu1uions for reactions involving gases as reactants or products.
2.50Lcontainer at 1.00atm and 48Cis filled with 5.41gof a monatomic gas. Determine the identity of the gas. Assuming the 2.50Lcontainer is a large elastic balloon, predict what will happen when 10.0gof oxygen gas is added to the balloon (which already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of balloon = ?L Now assuming the 2.50Lcontainer is rigid (like a steel container), predict what will happen when 10.0gof oxygen gas is added to the container (which again already contains 5.41gof the monatomic gas). ovide values for each of the following variables. In addition, explain what is happening for each variable, incorporating the kinetic molecular theory into your explanation. m>Temperature of gas mixture = ?K m>Total moles of gas mixture = ?mol m>Total pressure of gas mixture = ?atm m>Volume of rigid container = ? L
When two cotton plugs. one moistened with ammonia and the other with hydrochloric acid, are simultaneously inserted into opposite ends of a glass tube that is 87.0 cm long, a white 1111g of NH4Cl forms where gaseous NH3 and gaseous HC1 first come into contact. NH3(g)+HCl(g)NH4Cl(s) At approximately what distance from the ammonia moistened plug does this occur? (Hint: Calculate the rates of diffusion for both NH3 and HCI, and find out how much faster NH3 diffuses than HCI.)
Ethanol, C2H5OH, is produced industrially from ethylene, C2H4, by the following sequence of reactions: 3C2H4+2H2SO4C2H5HSO4+( C 2 H 5)2SO4C2H5HSO4+( C 2 H 5)2SO4+3H2O3C2H5OH+2H2SO4 What volume of ethylene at STP is required to produce 1.000 metric ton (1000 kg) of ethanol if the overall yield of ethanol is 90.1%?
A mixture of chromium and zinc weighing 0.362 g was reacted with an excess of hydrochloric acid. After all the metals in the mixture reacted, 225 mL dry of hydrogen gas was collected at 27C and 750. torr. Determine the mass percent of Zn in the metal sample. [Zinc reacts with hydrochloric acid to produce zinc chloride and hydrogen gas; chromium reacts with hydrochloric acid to produce chromium(III) chloride and hydrogen gas.]
What volume of oxygen a 423.0 K and a pressure of 127.4 kPa is produced by the decomposition of 129.7 g of BaO2 to BaO and O2?
93 The complete combustion of octane can be used as a model for the burning of gasoline: 2C8H18+25O216CO2+18H2O Assuming that this equation provides a reasonable model of the actual combustion process, what volume of air at 1.0 atm and 25°C must be taken into an engine to burn 1 gallon of gasoline? (The partial pressure of oxygen in air is 0.21 atm and the density of liquid octane is 0.70 g/mL.)
105 The decomposition of mercury(II) thiocyanate produces an odd brown snake-like mass that is so unusual the process was once used in fireworks displays. There are actually several reactions that take place when the solid Hg(SCN)2 is ignited: 2Hg(SCN)2(s)2HgS(s)+CS2(s)+C3N4(s)CS2(s)+3O2(g)CO2(g)+2SO2(g)2C3N4(s)3(CN)2(g)+N2(g)HgS(s)+O2(g)Hg(l)+SO2(g) A 42.4-g sample of Hg(SCN)2 is placed into a 2.4-L vessel at 21°C. The vessel also contains air at a pressure of 758 torr. The container is sealed and the mixture is ignited, causing the reaction sequence above to occur. Once the reaction is complete, the container is cooled back to the original temperature of 21°C. (a) Without doing numerical calculations, predict whether the final pressure in the vessel will be greater than, less than, or equal to the initial pressure. Explain your answer. (b) Calculate the final pressure and compare your result with your prediction. (Assume that the mole fraction of O2 in air is 0.21.)
A mixture of 0.200 g of 1.00 g of and 0.820 g of Ar is stored in a closed container at STP. Find the volume of the container, assuming that the gases exhibit ideal behavior.
In an experiment in a general chemistry laboratory, a student collected a sample of a gas over water. The volume of the gas was 265 mL at a pressure of 753 torr and a temperature of 27 C. The mass of the gas was 0.472 g. What was the molar mass of the gas?
One method of analyzing amino acids is the van Slyke method. The characteristic amino groups (NH2) in protein material are allowed to react with nitrous acid. HNO2, to form N2 gas. From the volume of the gas, the amount of amino acid can be determined. A 0.0604-g sample of a biological sample containing glycine, CH2(NH2)COOH, was analyzed by the van Slyke method and yielded 3.70 mL of N2 collected over water at a pressure of 735 torr and 29 C. What was the percentage of glycine in the sample? CH2(NH2)CO2H+HNO2CH2(OH)CO2H+H2O+N2
While resting, the average 70-kg human male consumes 14 L of pure O2 per hour at 25 C and 100 kPa. How many moles of 02 are consumed by a 70 kg man while resting for 1.0 h?