Q: 44) What is the coefficient of phosphorus after balancing the following equation?__ P(s) + __ O2 (g)…
A: The objective of the question is to find the coefficients of various elements in balanced chemical…
Q: Please help me solve 1 and 2
A: Step 1:The first reaction is the alkylation of acetylene, and the second reaction is the double bond…
Q: None
A: Acarbose is a drug that slows down the body's breakdown of carbs in order to treat type 2 diabetes.…
Q: Sonogashira reaction: Palladium catalyzed coupling of iodosubstituted aromatic compounds [Pavia,…
A: The objective of the question is to understand the Sonogashira reaction, its relation to the…
Q: Calculate the pH of each solution [H3O+] = 7.2 x 10-13 M
A: The objective of the question is to calculate the pH of a solution given the hydronium ion…
Q: 37. Propose a synthesis for the target compound, beginning from the starting compound shown. You may…
A: Step 1: Step 2: Step 3: Step 4:
Q: b) Show how to synthesize this molecule from benzene or toluene and molecules with 5 contiguous…
A:
Q: None
A: Step 1: Given reaction (nitration) is an electrophilic substitution reaction.In this reaction…
Q: CONCEPTUAL CHECKPOINT 21.8 Predict the major product for each of the following reaction sequences…
A: Step 1: Step 2: Step 3: Step 4:
Q: Draw the starting material for the reaction shown below. Drawing (HalMes)(PCya) (PhCH)RuCla (Grubbs…
A: Step 1:Step 2:Step 3:
Q: What would be the product of the following reaction sequence? CI i) ю ii) (CH3)2NH iii) LiBH3CN I ОН…
A: Step 1: Step 2: Step 3: Step 4:
Q: Mechanism NaOH OH H H₂O 3 H
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: 2. Assign R and S configurations for each chiral center in the following compound. Draw enantiomers,…
A: Step 1:There are two chiral centers in the given molecule. Carbon number 2 and 3 are chiral carbons.…
Q: No answer from Chat GPT will downvote from 7 accounts I am serious person Give proper explanation…
A: Here's an analysis of each factor: (i) An Increase in the Temperature of the Suspension:Effect on…
Q: ⚫ To 3 mL of 0.10 M HC_H₂O2 add a drop of methyl orange, then add 1 M NaC HO₂ a few 3 2 3 drops at a…
A: The objective of the question is to understand the chemical reaction that occurs when HCOOH (formic…
Q: Draw visual representations of the steps below... 38. Follow the following reaction steps. Step 1:…
A: Step 1: 1. The functional group is group of atoms which shows characteristics of a organic…
Q: Hello, please can you tell me what is the product of the reaction seen in the attached image?…
A: Step 1: Step 2: Step 3: Step 4:
Q: calculate the volume of 6m naoh required to react completely with 10.0 mmol of methyl salicylate.…
A: The objective of this question is to calculate the volume of 6M NaOH required to react completely…
Q: MISSED THIS? Watch KCV.7.5. IWE 7 Read Section 7.5. You can click on the Review link to access the…
A: It is a limiting reactant problem. The limiting reactant is the reactant consumed completely and…
Q: 18) A student was given a mixture of the following compounds. CO₂H After dissolving the mixture in…
A:
Q: Propose a mechanism for the following transformations: CN H3O+ Heat NH2
A:
Q: None
A: Step 1: Step 2: Step 3: Step 4:
Q: Need help at parts that are incorrect please
A: Step 1: Step 2:From the standard data table:EMn/Mn2+0=−1.18VEPb/Pb2+0=−0.125VSince, Ecell is…
Q: Draw the structure of the product of the Heck-Mizoroki reaction shown below. Br =0 Pd(OAc)2, PPh3,…
A: Step 1: Step 2: Step 3: Step 4:
Q: A 553 mL NaCl solution is diluted to a volume of 1.38 L and a concentration of 4.00 M. What was the…
A: The objective of this question is to find the initial concentration of a NaCl solution before it was…
Q: write the missing product or synthetic sequences
A: Step 1:a) • Enamine attack on alpha beta unsaturated ketone to give respective acyclic product.…
Q: Just give the IUPAC name with proper explanation no need to upload any image
A: Step 1:IUPAC nomenclature of cyclic alcohols:-Alcohols are the organic compounds which contains -OH…
Q: No answer from Chat GPT will downvote from 7 accounts I am a serious person. Only attempt if you…
A: 1. Lipopolysaccharide, or **LPS** - Lipopolysaccharide, or LPS for short, is not an enzyme. Rather,…
Q: Balance the following redox reaction in an acidic solution. Note that both H2O and H+ are included…
A: Let's balance the reaction in acidic solution. Step 1: DIVIDE THE REACTION INTO HALF REACTIONS…
Q: What is the value of AG at which a reaction becomes spontaneous? Express your answer numerically.…
A: Step 1:
Q: Draw the steps to produce the product. reagents can have up to 4 carbons
A: The reaction steps are as follows:Step (i) Reductive amination of a ketone with ammonia in the…
Q: X(s)|X4+ (6.83 M) || Mn 04 1 minus (0.16 M) |Mn2+ (8.44 M)|H* (0.12 M) The reduction potential for…
A: Given cell equation:X (s)| X4+(6.83M)||MnO4-(0.16M)|Mn2+(8.44M)|H+(0.12M)while representing an…
Q: This is actually question from past paper and I really need to answer for theses question
A: Detailed explanation:Na/Ca Exchanger Mechanism:The Na/Ca exchanger mechanism is crucial for cardiac…
Q: calculate the mass of 10.0mmol of methyl salicylate
A: The objective of this question is to calculate the mass of a given amount of a substance, in this…
Q: 16. For PbCl2 (Ksp = 2.4 x 10), will a precipitate of PbCl2 form when 100 mL of 3.0 x 10-2 M…
A: A lower Ksp value (2.4 x 10-4) indicates PbCl2 is a less soluble compound.When Q (reaction quotient)…
Q: Select the 2 products of the following reaction: H3C CI 2 CH3CH2CH2NH2 CH3CH2CH2NH3C₁ H₂C CH3 ☐ HO…
A: 1 mol of CH3CH2CH2NH2 'Cl' is a leaving group so, one H of amide group and Cl form HCl and…
Q: Predict and draw the structure organic product from the reaction below: 3 pts 1. NaNH2 2. CH3CH2Br
A: The objective of the question is to predict and draw the structure of the organic product from the…
Q: Past paper question
A: Key references:Alghoul, E., Basbous, J., & Constantinou, A. (2023). Compartmentalization of the…
Q: if you used 1g of the starting material compound 2, how many mmoles is this?
A: Step 1: Step 2: Step 3: Step 4:
Q: Complete the following reactions by providing the major organic products.
A: EXPLANATION : In the first step acid base reaction occurs and the formed carbanion is most stable…
Q: Constants | Periodic Table A gas of unknown molecular mass was allowed to effuse through a small…
A:
Q: Phosphoryl chloride, POCl3(g), is used in the manufacturing of flame retardants. It is manufactured…
A: The objective of the question is to find the new equilibrium concentration of POCl3(g) after adding…
Q: Propose a mechanism for the following reaction. Include curved arrows to show MeO2C CO₂Me 1) 1…
A:
Q: NO2 CO-Me №3 03, NaHCO3, CH2C12/MeOH, then Ac20, Et3N NO₂
A: Step 1: Step 2: Step 3: Step 4:
Q: ▷II F4 E alt $ 4 D 50 7) 6) 7:08 PM 5/7/2024 sar Aqueous Lithium carbonate is mixed with aqueous…
A: The objective of the first part of the question is to find the volume of 2.50 M Lithium carbonate…
Q: 5. What alkyl halide and nucleophile would be used to prepare the product by an SN2 mechanism? (5…
A:
Q: None
A: Approach to solving the question: Detailed explanation: Aspartate Transcarbamoylase (ATCase) ATCase,…
Q: show how to synthesize the molecule on the right using the molecule on the left plus any reagents
A:
Q: Provide the IUPAC name for the structural condensed formula shown here. CH3-CH2-CH2 CH2-CH2-CH3 H3C…
A: The molecule depicted, 1,3-diethyl-2,5-diisopropylcyclohexane, is an example of a substituted…
Q: Draw the product of the reaction shown below. Ignore small byproducts that would evaporate. ола CH3…
A: Step 1: Step 2: Step 3: Step 4:
Through an acetoacetic or malonic synthesis, obtain cyclopentanecarboxylic acid. Put the drawings of the formulas of the compounds.
![](/static/compass_v2/shared-icons/check-mark.png)
Step by step
Solved in 2 steps with 1 images
![Blurred answer](/static/compass_v2/solution-images/blurred-answer.jpg)
- Complete the following reactions: a. b. c.CH3SSCH2CH3+2(H)Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…
- Explain why ferulic acid, a natural product found in rice, oats, and other plants, is both an antioxidant and a sunscreen.Methylparaben is a common preservative used in cosmetics. What carboxylic acid and alcohol are needed to synthesize methylparaben by Fischer esterifi cation?Formic acid is present in ant venom and causes the pain of their sting. Draw its structure.
- Draw structures for the carbonyl electrophile and enolate nucleophile.Oxalic acid is found in the leaves of rhubarb, primarilyin the form of the calcium salt. Since high levels of oxalicacid are toxic, only rhubarb stalks are used to make strawberry rhubarb pie. What is the IUPAC name of oxalic acid?Write the structure of the calcium salt of oxalic acid.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Aspirin is an anti-inflammatory agent because it inhibits the conversion of arachidonic acid to prostaglandins by the transfer of its acetyl group (CH3CO –) to an OH group at the active site of an enzyme (Section 19.6). This reaction, called transesterification, results in the conversion of one ester to another by a nucleophilic acyl substitution reaction. Draw a stepwise mechanism for the given transesterification.
![Chemistry for Today: General, Organic, and Bioche…](https://www.bartleby.com/isbn_cover_images/9781305960060/9781305960060_smallCoverImage.gif)
![Organic Chemistry: A Guided Inquiry](https://www.bartleby.com/isbn_cover_images/9780618974122/9780618974122_smallCoverImage.gif)
![Chemistry for Today: General, Organic, and Bioche…](https://www.bartleby.com/isbn_cover_images/9781305960060/9781305960060_smallCoverImage.gif)
![Organic Chemistry: A Guided Inquiry](https://www.bartleby.com/isbn_cover_images/9780618974122/9780618974122_smallCoverImage.gif)