The reduction of a metal oxide MO in the presence of carbon monoxide is represented by the following reaction MO(s) + CO(g) + M(s) + CO₂(g) for which Kp is found to have the following values: T 867 °C 1,108 °C Kp 5.38x10-1 3.98x10-¹ Calculate AG for this reaction at 1,035 °C. Assume that AH and AS are independent of temperature. Answer in kJ mol¹ to 2 decimal place (e.g. 17.62)

If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)

Tetrachloromethane (carbon tetrachloride), CCl4, has a normal boiling point of 76.7C and an enthalpy of vaporization, Hvap, of 29.82 kJ/mol. Estimate the entropy of vaporization, Svap. Estimate the free energy of vaporization, Gvap, at 25C.

Silver carbonate, Ag2CO3, is a light yellow compound that decomposes when heated to give silver oxide and carbon dioxide: Ag2CO3(s)Ag2O(s)+CO2(g) A researcher measured the partial pressure of carbon dioxide over a sample of silver carbonate at 220C and found that it was 1.37 atm. Calculate the partial pressure of carbon dioxide at 25C. The standard enthalpies of formation of silver carbonate and silver oxide at 25C are 505.9 kJ/mol and 31.05 kJ/mol, respectively. Make any reasonable assumptions in your calculations. State the assumptions that you make, and note why you think they are reasonable.

Iodine, I2, dissolves readily in carbon tetrachloride. For this process, H = 0 kJ/mol. I2(s) I2 (in CCl4 solution) What is the sign of rG? Is the dissolving process entropy-driven or enthalpy-driven? Explain briefly.

Consider the reaction 2SO2(g)+O2(g)2SO3(g) (a) Calculate G at 25C. (b) If the partial pressures of SO2 and SO3 are kept at 0.400 atm, what partial pressure should O2 have so that the reaction just becomes nonspontaneous (i.e., G=+1.0 k J)?

Cobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.

Consider the reaction H2(g)+Br2(g)2HBr(g) where H = 103.8 kJ/mol. In a particular experiment, equal moles of H2(g) at 1.00 atm and Br2(g) at 1.00 atm were mixed in a 1.00-L flask at 25C and allowed to reach equilibrium. Then the molecules of H2 at equilibrium were counted using a very sensitive technique, and 1.10 1013 molecules were found. For this reaction, calculate the values of K, G, and S.

For the decomposition of formic acid, HCOOH(l)H2O(l)+CO(g) H = +29 kJ/mol at 25C. a Does the tendency of this reaction to proceed to a state of minimum energy favor the formation of water and carbon monoxide or formic acid? Explain. b Does the tendency of this reaction to proceed to a state of maximum entropy favor the formation of products or reactants? Explain

Explain how the entropy of the universe increases when an aluminum metal can is made from aluminum ore. Thefirst step is to extract the ore, which is primarily a formof A12O3, from the ground. After it is purified by freeingit from oxides of silicon and iron, aluminum oxide ischanged to the metal by an input of electrical energy. 2Al2O3(s)electricalenergy4Al(s)+3O2(g)