The major organic product ofthe following reaction isHC=CH2H2/ Ni-Cat.HC=C-CH2HC=CH2H21.H3C-C -CH2H2C-CH3H2H3C-C-CH2HC=CH2H3C-C-CH2HC=CH2H2C=C-CH2H.H2C-CH3HC=C-CH2

Answered: Image /qna-images/answer/5817fc1b-e48f-4247-8c2c-a3020cb15534.jpg

Answered: The major organic product of the…

The major organic product of the following reaction is HC=CH2 Hа/ Ni-Cat. HC=C-CH2 HC=CH2 H2 1. H3C-C-CH2 H2C-CH3 H2 H3C-C-CH2 HC=CH2 H3C-C-CH2 HC=CH2 H2C=C-CH2 H2C-CH3 HC=C-CH2

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter4: Organic Compounds: Cycloalkanes And Their Stereochemistry

Section4.2: Cis–trans Isomerism In Cycloalkanes

Problem 5P: Draw the structures of the following molecules: (a) trans-l-Bromo-3-methylcyclohexane (b) cis-1,...

See similar textbooks

Related questions

Q: What is the name of the organic reactant and the resulting product of the reaction below? H H H H H…

A: The addition of chlorine to an alkene in a nonpolar solvent produces vicinal dichloro alkane.

Q: Determine the product(s) formed in the following reactions. A. B. QH C=CH-CH₂ OCH3 -C=C-CH3 CH₂OH…

A: Hydration of substituted unsymmterical alkyne gives two isomeric ketonesDihydropyran under acidic…

Q: Ketone R' + 0: ון R-C-H + Aldehyde CH₂ CH₂-- CH₂ CH₂ CH2CH2-CH₂ CH 3 - + CH3 CH2 - Ộ CHỊ CH3 2- OH +…

A: The question is based on the concept of solubility product principle.It states that when a weak…

Q: Give the major organic product of the following reaction. 요 CH3CH₂ CH3CH₂ CH₂ CH₂ CH3CH₂ CH3 O= OH…

A: When Carboxylic acid reacts with SOCl2 then it forms acid chloride which on reaction with alcohol…

Q: Name the following organic compound. CH3 S CH CH3 CH 0 CH, CH, 3-methylsulfide-2-ethoxy butane…

A: Detail description about IUPAC name determination is given below

Q: 8. Determine the product of the reaction. CH3-CH-CH-OH + HCI ČH3 a) CH,-CH-CH3 b) CH;-CH-CH3 CI CH3…

A: The substitution reaction in which a nucleophile present in the reaction medium is replaces the…

Q: What is the organic product formed in the following reaction? CHs-CH=CH-C-cH; + (CH;CH);ÑH II…

A: Correct answer is (C) I. Nitrogen containing lone pair of electrons attack on the carbon having…

Q: B- Instructions: What reagent and/or catalysts are necessary to bring about each conversion? Br 1.…

Q: Give the major organic product(s) of the following reaction. OH 1) CH3CH2M9B (1 mole) ? H. 2) H30*…

Q: Give the major product(s) of the following reaction. ? CI AICI3, heat

A: Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: What is the major organic product of the following reaction? H₂O, H₂SO HgSO, 0: 82= OH M IV

A: Alkyne are unsaturated hydrocarbon which have triple bond so they are reactive in nature. Here we…

Q: 4. A student was asked to prepare an alkene X in high yield using any alcohol as starting material…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: What is(are) the major Organic product(s) in the following reaction? CH; CH; (a) CH; H₂C-C-0-CH;…

Q: Hydroboration of Alkenes vs. Alkynes. Addition of an alkylboranes to a carbon- carbon double bond…

A: The hydroboration reaction is a commonly used method to prepare alcohols from alkenes and alkynes.…

Q: What are the major products obtained from the following reactions? Indicate the geometry…

A: Both reaction is electrophilic addition reaction in which multiplee bond will break and electrophile…

Q: An important step in one synthesis of carboxylic acids is the deprotonation of diethyl malonate and…

A: Given statement: NaOH can deprotonate diethyl malonate effectively, but NaOC(CH3)3 is…

Q: Consider the substitution reaction of (R)-3-chloro-3-methylhexane with methanol and heat. H₂C- A H₂C…

Q: CH H3C CH, + Br2 The product of the above reaction is: no reaction occurs. CH CH Er2 Br HC-C- =C-CH…

Q: Which alkene is the main product of the following reaction? CH3 односно он O B. H.C H.C осмотра H₂C…

Q: What is the major product for the following reaction? ÇH3 CH;C-CH=CH2 + HCI – major product ČH3 ,…

Q: Identify the major product of this reaction of an alkene. = ||| ОН ОН 1. Hg(OAc)2, H20 2. NaBH4,…

A: Given reaction is : Options are :

Q: What is the major organic product of the following reaction? (CH,CH,CH,CH2)2CuLi Br and Br Br II IV

Q: What is the organic product formed in the following reaction? C6H5-CH=CH-C-C6H5 ÷ (CH3CH2)2NH O…

A: If you have any questions let me know in comment box thankyou for your question.

Q: 30. What type of organic reaction is this? HH H H H Br H 2-bromopropane Major product H c=c-C-H +…

A: The correct is as follows:

Q: 2. What are the major products obtained from the following reactions? Indicate the geometry…

A: In the reactions considered, an addition reaction is expected to occur on the given alkynes.

Q: 2. Name each alkyne. CH3CH₂CH₂C=CH a. b. CH3CH₂CH₂C=CCH3 3. Predict the product of the following…

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

The major organic product of
the following reaction is
HC=CH2
H2/ Ni-Cat.
HC=C-CH2
HC=CH2
H2
1.
H3C-C -CH2
H2C-CH3
H2
H3C-C-CH2
HC=CH2
H3C-C-CH2
HC=CH2
H2C=C-CH2
H.
H2C-CH3
HC=C-CH2

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the organic product? столосно NaOC₂H₂ H+ + CH-CH-C-OCHS CH+CH.C HOC₂H5 CH3 III. I. C₂H₂O CH O II. CH3-C CH3 CH-CH-C--OC₂H CH3 OH C₂H₂OCH CH O CH3-C-C-OC₂HS CH3 IV. C₂H₂O 0 CH3-C-C-OC₂HS CH3
OE 2 O NH Draw the structure of all organic products formed in the following reaction. <-5 1. KOH 2. (CH₂)₂CHCH₂Cl 3. OH, H₂O
7. Draw the condensed structural formula of the product for each reaction. Name the reactant and the product. 아 HS OH 140°C or th lall 180 Ho CH CH3 CHy-CH -CH-CH + PE CH3
give the structure of the major organic product, reactant, or catalyst in each incomplete equation
What is the major organic product of the following reaction? H₂O, H₂SO HgSO, *<= OH III IV
Question 18.c of 20 Aldehydes and ketones are common carbonyl functional groups. Identify the structures and provide names of these molecules. Provide a systematic name for this structure. سکتے 5- H 1- 4- cyclo tert- 6- di n- tri 3- 2- sec- hex eth but Submit +
Could you please write the products formed in the following reaction?
Write the products formed as a result of the given reactions.
What is the systematic name of the product P of this chemical reaction? 0 OH HỌ—CH2 CH OH O | CH || -C-OH + KOH X P + H₂O Ś
What is the product(s) for 2-b
Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: о CH2-0-C-(CH2)7-CH=CH-CH2-CH=CH-(CH2)4-CH3 CH о O-C-(CH2)7-CH=CH-CH2-CH=CH-CH2-CH=CH-CH2-CH3 CH2-O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource.
Which one of the following alkyl groups is the ethyl group? CH3 CH3- CH3CH,- CH3CH,CH,- CH3-C- CH3 CH3CHCH3 А B C E O A O E D.