me of ConesPractice Session - PeriodibsTable x84.studyisland.com/cfw/test/practice-session/a2166?CFID=0487f3b7-46be-4e10-aa17-5c7ee16a463d&CFTOKEN=0&cratelD=a2166&packl. < ☆LoginO Mail -Keidy A Mun..PowerSchool Learn..Salir de ASNEF No..Home-Study IslandDesmos | Scientific.F Meet-mythhou-dihable1.The halogens are the elements of group 17 on the periodic table. Halogens combine easily-with elements from group 1. When ahalogen reacts with a metal, what type of compound is formed?A.noble gasOB.potassiumOc.alloyODsaltResetSubmitSession Score: 0% (0/0)

we are to discuss which type of compound is formed when halogen reacts with group 1 metals.

The halogens are the elements of group 17 on the periodic table. Halogens combine easily with elements from group 1. When a halogen reacts with a metal, what type of compound is formed? OA. noble gas B. potassium OC. alloy OD salt

The halogens are the elements of group 17 on the periodic table. Halogens combine easily with elements from group 1. When a halogen reacts with a metal, what type of compound is formed? OA. noble gas B. potassium OC. alloy OD salt

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: b. silver nitrate and ammonium selenate + c. copper(II) sulfate and barium nitrate + d. calcium…

A: Answer is given below

Q: What does the mean in the chemical equation: water %3D hydrogen + oxygen a. to produce O b. reacts…

A: “Since you have asked multiple question, we will solve the first question for you. If you want any…

Q: Which of these ions will always be a spectator ion? 1.Nitrate ions 2.Fluoride ions 3.Hydroxide…

Q: 1 Pbzt 2. Pb2+ + HCI +NaCl 3. Pb?+theat 4. Pb+ NazSo 5. Pb2+ 十ーのUIfuric a さ . P62T+ NaOH + NaOlH -…

Q: Write the equation then balance for the following: a. Copper(II) sulfide is oxidized by oxygen gas…

A: in Balanced chemical equation total numbers of atoms are same on reactent and products side.

Q: euterium (chemical symbol - D) is a heavy isotope of hydrogen, H. Despite having an extra neutron in…

A: There are many mechanisms in organic chemistry such as nucleophilic substitution, nucleophilic…

Q: What is the coefficient for hydrogen in the balanced equation for the reaction of solid…

A: Please find below the reaction taking place MoO3 + H2 -----> Mo + H2O Balancing Since in LHS we…

Q: Sodium bicarbonate (NaHCO3) reacts with aqueous hydrogen monochloride to produce sodium chloride,…

A: Balanced chemical reaction- The depiction of a chemical reaction in which the number of atoms of…

Q: Which element is the excess reagent when 3.00 moles of Mg is ignited in 2.20 moles of pure oxygen in…

Q: a. Br LL F HNO3/H2SO4 b. C. Br NO2 Cl2, FeCl3 SO3, H2SO4

A: Note: Since you have posted a question with multiple sub parts, we will provide the solution only to…

Q: 3. Which of the following is the correct equations for the reaction of sulfur tetrafluoride? a. S…

Q: None

Q: 28. Which of the following ions will combine with a chloride ion to produce ammonium chloride? a.…

A: A compound is formed by the electrostatic interaction between the cation and the anion. The cation…

Q: 14. When nonane (C9H20) is burned in oxygen gas, what is the sum of the coefficients in the properly…

A: Since when we burn any hydrocarbon, we get carbon dioxide and water as products. hence the reaction…

Q: 9. What is the starting material in the following reaction? A. I B. II || C. III D. IV LDA CH₂l Br…

Q: One gram of each of the following compounds is mixed with 100mL of water. Which will form solutions…

A: Solutions of : Cu(OH)2PCl5Ca(CH3CO2)2C3H8NaNO3

Q: What mass of carbon dioxide is produced when 5.0 g of methane (CH4) combusts with 17.1 g of oxygen…

A: Given:- Mass of methane=5.0 g Mass of oxygen = 17.1 g To find:-Mass of carbon dioxide

Q: What is the formula for the salt formed when H3PO4(aq) reacts with Ba(OH)2(aq)? A. BaPO4 B. Ba3PO4…

A: Ax+ By- forms AyBx

Q: 5. What is the predicted product in the following reaction? 1. Li(CH3)2Cu 2. H₂O A. I OH OH OH H3C.…

A: Please note that the starting material is cyclohexenone but not cyclohexanone.

Q: Consider the reaction below. 2Al2O3 ---> 4Al + 3O2 How many moles of oxygen are produced if 11.0…

Q: 106 Chapter Three Stoichiometru 2 What are the moles of LIOH? To find the moles of LIOH, we need…

A: a.The number of moles of ferric carbonate is calculated as,

Q: excess Br, CI4 А. D. Br Br Br Br Br Br Br В. Е. Br Br Br Br Br Br С. Br Br F.

A: Alkene has nucleophilic character .In presence of Br2/CCl4 it give addition reaction and form…

Q: with

A: When gold react with nitrite ion than gold nitrite will form

Q: HO. 1) HBr 2)Mg 3) СО

A: ->HBr can give substitution reaction proceeds through formation of carbocation. ->Mg form…

Concept explainers

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates).

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.

Question

me of Cones
Practice Session - PeriodibsTable x
84.studyisland.com/cfw/test/practice-session/a2166?CFID=0487f3b7-46be-4e10-aa17-5c7ee16a463d&CFTOKEN=0&cratelD=a2166&packl. < ☆
Login
O Mail -Keidy A Mun..
PowerSchool Learn..
Salir de ASNEF No..
Home-Study Island
Desmos | Scientific.
F Meet-mythhou-dih
able
1.
The halogens are the elements of group 17 on the periodic table. Halogens combine easily-with elements from group 1. When a
halogen reacts with a metal, what type of compound is formed?
A.
noble gas
OB.
potassium
Oc.
alloy
OD
salt
Reset
Submit
Session Score: 0% (0/0)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Da IXL - Write varia X Da IXL - Simplify ve x 0. IXL - Write varia X K RC Gram to grai X EL IXL - ArcI i web.kamihq.com/web/viewer.html?state%=%7B"ids"%3A%5B"1wajhTUytl3ZW_uzZQ2XqYnjACP40NAQX"%5D marks E Maya Paniagua - Cl. nt Edu O A My Drive ► RC Gram to gram stoich.pdf Chemistry Gram to Gram Stoichiometry Show all work for credit!! Balance the following equations and then perform the requested calculations 1. N2 + H2 → NH3 How many grams of ammonia are produced when 26.25 grams of hydrogen gas react with nitrogen gas?
Give the Chemical word 1. Formation of lead trees 2. Reaction of AgNO3 and K2CrO4 Silver(I) 3. Reaction of egg shell and HCl
For the following reaction, select all the statements that are correct. Br2 Br Br Br Br Br Br Br Br Br.. Br,, Br Br Br Br Br Br Br Br Br Br 2 3 A. 1 is the product of this reaction. B. 2 is the product of this reaction. C. 3 is the product of this reaction. D. 4 is the product of this reaction. E. There will be no reaction between these two chemicals.
ore O A.1. NaNH2, -78C 2. CH3CH₂CH2Br O B. 1. LDA, -78C 2. CH3CH₂Br O C. 1. LDA, -78C 2. CH3CH₂CH₂Br O D. 1. NaOH, H₂O, heat 2. CH3CH₂CH₂Br
Iron metal dissolves in aqueous solution of sulfuric acid as shown. Which of the following is true about this reaction? Fe(s) + H2SO4(aq) ➜ H2(g) + FeSO4(aq) Select one: A.Iron gains two electrons. B.It is a double displacement reaction. C.Sulfuric acid is the oxidizing agent. D.It is a neutralization reaction.
40. What is the maximum amount of Al,Cl, that can be formed from the reaction of 4.0 mol of Al with 5.0 mol of Cl, according to this equation? 2 Al(s) + 3 Cl>(g) > Al,Cl6(s) А. 9.0 mol В. 3.7 mol С. 2.0 mol D. 1.7 mol E. 5.2 mol
Write a balanced chemical equation for the following reactions and classify reactions. i. Liquid octane (C8H18) reacts with oxygen gas (O2) to form carbon dioxide and steam (gaseous water). ii. Solid sodium metal and water react to make sodium hydroxide and hydrogen gas.
Nitrate2
Write the chemical formula, then balance the chemical equation. Step by step A. Sodium reacts with chlorine to produce sodium chloride. B. Calcium hydroxide reacts with hydrochloric acid to form calcium chloride and water.
Write the net ionic equation for the following reaction, a. Lead Nitrate and Sodium Oxalate b. Lead Nitrate and Sulphuric acid c. Nitric acid, Lead Nitrate and Sodium Oxalate d. Nitric acid, Lead Nitrate and Sulphuric acid
17.In a neutralization reaction Group of answer choices an acid and a salt react to form water and a base. an acid and a base react to form a salt and water a base and a salt react to form water and an acid. two acids react to form water water and a salt react to form an acid and a base 18. Which of the following is the correctly balanced equation for the complete neutralization of H3PO4 with Ca(OH)2? Group of answer choices 2 H3PO4 + 3 Ca(OH)2 -----> Ca3(PO4)2 + 6 H2O 4 H3PO4 + 6 Ca(OH)2 -----> 2 Ca3(PO4)2 + 12 H3O H3PO4 + Ca(OH)2 -----> Ca3(PO4)2 + H2O H3PO4 + Ca(OH)2 ----> CaHPO4 + 2 H2O 3 H3PO4 + Ca(OH)2 -----> Ca3(PO4)2 + 5 H2O
19. The neutralization reaction between Al(OH)3 and HNO3 produces the salt with the formula Group of answer choices Al(NO3)3 AlH2 H2O AlNO3 NO3OH 20. How many moles of H2O are produced when 1 mole of Mg(OH)2 reacts with 1 mole of H2SO4? Group of answer choices 2 1 3 5 4