**Redox Reaction Balancing under Basic Conditions****Instructions:** Enter electrons as e⁻.**Problem Statement:** The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced **REDUCTION** half reaction.Chemical Equation:\[ \text{N}_2\text{H}_4 + \text{Zn(OH)}_2 \rightarrow \text{Zn} + \text{N}_2 \]Diagram:- **Reactants Box:** Indicates where reactants are listed.- **Arrow:** Indicates the reaction process.- **Products Box:** Indicates where products are listed.This exercise involves balancing the reduction half-reaction of the given redox process.

Reduction refers to the addition of electrons.

Answered: The following skeletal…

The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. N2H4 + Zn(OH)2-¬Zn + N2 Reactants Products

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: What is the balanced oxidation half-reaction and reduction half-reaction in the following reaction…

A: A half reaction can be oxidation or reduction reaction and both the reaction takes place…

Q: Balance the following net ionic equation and write the sum of the coefficients of the reactants and…

A: Skeleton unbalanced reaction: For balancing this redox reaction, we 1st need to determine the…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Write the balanced REDUCTION half reaction. MnO4- + Mg → Mg2+ + Mn2+ The oxidation-reduction…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

Q: alance the following reaction in basic solution. Ag(s) + Zn²+(aq) → Ag,O(aq) + Zn(s) ill in the…

A: Recall the reaction Ag(s) + zn2+(aq) --> Ag2O(aq) + Zn(s)

Q: Enter electrons as e. The following skeletal oxidation-reduction reaction occurs under acidic…

A: We have to predict the oxidation half reaction .

Q: redox

Q: Complete and balance the following redox reaction in basic solution. Be sure to include the proper…

A: The given redox reaction is as follows: A redox reaction is balanced by balancing the mass and…

Q: Classify the half-reactions as reduction half-reactions or oxidation half-reactions. H, (g) – 2…

Q: Study this chemical reaction: 2 Cr+0₂ Then, write balanced half-reactions describing the oxidation…

A: Oxidation : oxidation is the reaction in which electron are lost. Reduction : reduction is the…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The redox reaction is given as follows: Fe+Zn2+------------>Zn+Fe2+

Q: Balance the following reaction in basic solution. Ag(s) + Zn²+ (aq) → Ag₂O(aq) + Zn(s) Fill in the…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: In the given cell reaction, the oxidation state of sulfur in sulfate ion is +6 and the oxidation…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

Q: Complete and balance the following half-reactions. In each case, indicate whether the half-reaction…

A: In basic solutions, the base dissociates to form OH- ions, so OH- ions are needed for balancing the…

Q: Balance the following reaction in acidic solution. 3+ Cr20, (aq) + HNO2(aq) → Cr" (ag) + NO, (aq)…

A: We have to balance the given reaction in acidic medium.

Q: Given the reaction: 2Fe(s) + 3C12(g) --> 2FEC13(s) Write the half reaction showing reduction.

A: Reduction is the process of gain of electron. And oxidation is the process of loss of electron. To…

Q: Ca + HBr Oxidation Reduction

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Redox reaction : Chemical reactions involving both oxidation and reduction processes.Oxidation:…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Answer

Q: 63. In this reaction, which substance behaves as the oxidizing agent? Pb + PbO₂ + 2H₂SO4 → 2PbSO4 +…

A: Oxidising agent: Substance which oxidises other substances but itself get reduced. Oxidising agent:…

Q: Enter electrons as e. The following skeletal oxidation-reduction reaction occurs under basic…

A: Balanced oxidation half reaction: S2- → S + 2e- Reactant…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: The electrons' gain-loss reactions are identified by their special names that are togetherly…

Q: A sample of a new cleaning product, "Joe's Famous Bleach Cleaner," with a mass of 61.0 g, was…

A: Bleach contains the active ingredient NaClO. Analysis of bleach involves two sequential…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: Balance the following reactions in an acidic solution. Identify the oxidizing and the reducing agent…

A: The full solutions are shown below: Reaction 3Oxidizing Agent: NO3-Reducing Agent: As2O3 Reaction…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The reaction given is

Q: Enter electrons as The following skeletal oxidation-reduction reaction occurs under basic…

A: In a redox reaction, both oxidation and reduction processes take place simultaneously. There are two…

Q: A solution of Mno is electrolytically reduced to Mn3+. A current of 7.79 A is passed through the…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: First balance the atoms other than O and H. Then balance the oxidation number. Balance charge by OH-…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Reduction is the process of gain of electrons while oxidation is the process of loss of electrons.…

Q: Balance the following reaction in acidic solution. Cr₂O² (aq) + HNO₂ (aq) → → Cr³+ (aq) + NO3(aq)…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The given redox reaction is as follows, The above reaction contains both oxidation and reduction…

Q: balanced REDUCTION half reaction. SO3²- + P→→PH3 + 2- →PH3 2- + SO4²-

Q: Indicate whether the balanced equation involves oxidation–reduction. If they do, identify the…

A: The reaction given is 3 SO2 (g) + 2 HNO3 (aq) + 2 H2O (l) -> 3 H2SO4 (aq) + 2 NO (g)

Q: For a particular redox reaction, NO₂ is oxidized to NO3 and Cu²+ is reduced to Cut. Complete and…

Q: The following skeletal CIO₂ + Fe³+ oxidation-reduction reaction occurs under acidic conditions. →…

A: A redox reaction is balanced by balancing the mass and charge. Hence the number of atoms of all the…

Q: Is Zn+2AgNO3>>>Zn(NO3)2+2Ag an oxidation-reduction reaction? If so, what is oxidized and what is…

Q: Which of the following is an oxidation-reduction reaction? PbCO3(s) + 2HNO3(aq) → Pb(NO3)2(aq) +…

A: The question is based on the concept of redox reactions. Redox Reactions are the one in which…

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: The following skeletal oxidation-reduction reaction occurs under acidic conditions. The balanced…

Q: Enter electrons as e-. The following skeletal oxidation-reduction reaction occurs under basic…

Question

**Redox Reaction Balancing under Basic Conditions**

**Instructions:** Enter electrons as e⁻.

**Problem Statement:** The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced **REDUCTION** half reaction.

Chemical Equation:
\[ \text{N}_2\text{H}_4 + \text{Zn(OH)}_2 \rightarrow \text{Zn} + \text{N}_2 \]

Diagram:
- **Reactants Box:** Indicates where reactants are listed.
- **Arrow:** Indicates the reaction process.
- **Products Box:** Indicates where products are listed.

This exercise involves balancing the reduction half-reaction of the given redox process.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

consider the reaction of rubidium metal with water to form aqueous rubidium hydroxide and hydrogen gas 2rb(s)+2h2o(l)->2rboh(aq) assign the oxidation state for each reaction
Consider the reaction below. Is this an oxidation-reduction? What information are you using to determine if this is an oxidation-reduction reaction.2 H2 (g) + O2 (g) à 2 H2O (l)
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced OXIDATION half reaction. BrO3 + CICIO3¯ + Br Reactants Enter electrons as e Products
The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced REDUCTION half reaction. N2H4 + NiO2- →N2 + Ni(OH)2 Reactants Products
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced OXIDATION half reaction. So,- + NO- →SO2 + HNO3 Reactants Products
In the following reaction, what species is undergoing reduction (being reduced)?: Ca + Br2 --> CaBr2 Са Br2 O This not an oxidation-reduction reaction
The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the balanced OXIDATION half reaction. S2O32- + Bi(OH)3Bi + SO32- Reactants Products
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced REDUCTION half reaction. Fe + SO4²- SO₂ + Fe²+ Enter electrons as e. Reactants Products
The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the balanced OXIDATION half reaction. Al3+ + NiAl + Ni2+ Reactants -> Products
consider the reaction of Rubidium metal with water to form aqueous rubidium hydroxide and hydrogen gas 2Rb(s)+2H2O(l)->2RbOH(aq) assign the oxidation state for each reaction