The equilibrium constant, K, for the following reaction is 1.20 x 10-² at 500 K. PCI 5(9) PCI3(9) + Cl₂(9) An equilibrium mixture of the three gases in a 1.00 L flask at 500 K contains 0.161 M PCI5, 0.0440 M PCI3 and 0.0440 M Cl₂. What will be the concentrations of the three gases once equilibrium has been reestablished, if 0.0302 mol of Cl₂(g) is added to the flask? (Give your answers to three significant figures.) [PC] = 40 M [PC1₂] = 40 M ✔

The equilibrium constant, K, for the following reaction is 1.20 x 10-² at 500 K. PCI 5(9) PCI3(9) + Cl₂(9) An equilibrium mixture of the three gases in a 1.00 L flask at 500 K contains 0.161 M PCI5, 0.0440 M PCI3 and 0.0440 M Cl₂. What will be the concentrations of the three gases once equilibrium has been reestablished, if 0.0302 mol of Cl₂(g) is added to the flask? (Give your answers to three significant figures.) [PC] = 40 M [PC1₂] = 40 M ✔

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 61QRT

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Consider 0.200 mol phosphorus pentachloride sealed in a 2.0-L container at 620 K. The equilibrium constant, Kc, is 0.60 for PCl5(g) PCl3(g) + Cl2(g) Calculate the concentrations of all species after equilibrium has been reached.
Write a chemical equation for an equilibrium system that would lead to the following expressions (ad) for K. (a) K=(PH2S)2 (PO2)3(PSO2)2 (PH2O)2 (b) K=(PF2)1/2 (PI2)1/2PIF (c) K=[ Cl ]2(Pcl2)[ Br ]2 (d) K=(PNO)2 (PH2O)4 [ Cu2+ ]3[ NO3 ]2 [ H+ ]8
For the reaction N2(g)+3H2(g)2NH3(g) show that Kc = Kp(RT)2 Do not use the formula Kp = Kc(RT)5n given in the text. Start from the fact that Pi = [i]RT, where Pi is the partial pressure of substance i and [i] is its molar concentration. Substitute into Kc.
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
For the reactionH2(g)+I2(g)2HI(g), consider two possibilities: (a) you mix 0.5 mole of each reactant. allow the system to come to equilibrium, and then add another mole of H2 and allow the system to reach equilibrium again. or (b) you mix 1.5 moles of H2 and 0.5 mole of I2 and allow the system to reach equilibrium. Will the final equilibrium mixture be different for the two procedures? Explain.
Write an equation for an equilibrium system that would lead to the following expressions (ac) for K. (a) K=(Pco)2 (PH2)5(PC2H6)(PH2O)2 (b) K=(PNH3)4 (PO2)5(PNO)4 (PH2O)6 (c) K=[ ClO3 ]2 [ Mn2+ ]2(Pcl2)[ MNO4 ]2 [ H+ ]4 ; liquid water is a product
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A mixture contains the gases at the following concentrations: [NOCl] = 5.0 103 mol/L, [NO] = 2.5 103 mol/L, and [Cl2] = 2.0 103 mol/L. Is the reaction at equilibrium at 300 C? If not, in which direction does the reaction proceed to come to equilibrium?
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?