Table 11. Volume ofvinegar (mL)2. Volume ofwater (mL)3. Mass of beakerwith liquid (g)4. Mass of AlkaSeltzer tablet (g)5. Total StartingMass (g)= 3. + 4.6. Mass of beakerwith liquid afterbubbles cease (g)7. Calculated massof CO2 lost(produced) (g)<= 5.-6.This is g CO28. Calculated massof NaHCO3reacted (g)Use Stoichiometry:g CO2 →g NaHCO3Run 10.00Run 20.75ML 10ml30ml136.427 146.24330mlRun 3Run 415ml0.772 0.926Run 520ml0.929Run 625ml25ml 20ml146.459 146.52g| 144.387 146.947іни.Run 715ml 10ml 5mlRun 830ml 35m10.008.243g 3.2439 3.235 6.259 3.239 3.24 g 3.23g139.87 149.486 149.48 149.75 149.617 150.207 149.884139.179 148.7149 148.7549 148.821g|148.700g|148.270g| 148.931g|149.431g0.917 1.937 -0.047 0.9146.454 147.31103.23g 3.22g150.53

Answered: Image /qna-images/answer/8ab7b47a-246f-4346-b017-32cf7eb73578.jpg

Table 1 1. Volume of vinegar (mL) 2. Volume of water (mL) 3. Mass of beaker with liquid (g) 4. Mass of Alka Seltzer tablet (g) 5. Total Starting Mass (g) = 3. + 4. 6. Mass of beaker with liquid after bubbles cease (g) 7. Calculated mass of CO2 lost (produced) (g) <= 5.-6. This is g CO2 8. Calculated mass of NaHCO3 Run 1 reacted (g) Use Stoichiometry: g CO2 →g NaHCO3 0.00 Run 2 0.7 5ML Run 3 Run 4 1931 Run 5 0.772 0.926 TOMI 25ml 20ml 146.459/146.52g| Run 6 Run 7 20ml 25ml 30ml 35M1 15ml 10ml 5ml 144.387 Run 8 35ml 30ml 136.627 146.243 144.947g 146.454 147.311g 8.243g 3.2439 3.236.239 3.239 3.24 g 3.23g 3.22g 150.53 139.87 149.486 149.48 149.75 149.617 150.207 149.884 139.179 148.7149 148.754g| 148.821g| 148.700g|148.270g| 148.931g|149.431g 0.929 0.917 1.937 0.00 -0.047 0.9

Table 1 1. Volume of vinegar (mL) 2. Volume of water (mL) 3. Mass of beaker with liquid (g) 4. Mass of Alka Seltzer tablet (g) 5. Total Starting Mass (g) = 3. + 4. 6. Mass of beaker with liquid after bubbles cease (g) 7. Calculated mass of CO2 lost (produced) (g) <= 5.-6. This is g CO2 8. Calculated mass of NaHCO3 Run 1 reacted (g) Use Stoichiometry: g CO2 →g NaHCO3 0.00 Run 2 0.7 5ML Run 3 Run 4 1931 Run 5 0.772 0.926 TOMI 25ml 20ml 146.459/146.52g| Run 6 Run 7 20ml 25ml 30ml 35M1 15ml 10ml 5ml 144.387 Run 8 35ml 30ml 136.627 146.243 144.947g 146.454 147.311g 8.243g 3.2439 3.236.239 3.239 3.24 g 3.23g 3.22g 150.53 139.87 149.486 149.48 149.75 149.617 150.207 149.884 139.179 148.7149 148.754g| 148.821g| 148.700g|148.270g| 148.931g|149.431g 0.929 0.917 1.937 0.00 -0.047 0.9

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: 10. The combustion of butane can be represented by the following unbalanced equation: C4H10 +…

A: First, we will write the balanced chemical reaction. And then we calculate the number of moles H2O…

Q: What amount (in mol) and what mass (in g) of water can be produced when 82.1 ug of ethane reacts…

A: The reaction considered is, C2H6 (g) + O2(g)→H2O(l)+CO2(g) The balanced equation of this reaction…

Q: 44. Balance each of the following chemical equations. a. Ba(NO3)2 (ag) + Na2 CrO4 (ag)BaCrO4 (s)…

Q: Silver tarnishes in the presence of hydrogen sulfide according to the given balanced equation. What…

Q: What mass of Al is required to completely react with 50 g MnO2?

Q: 15. Open Response CUSO4 + KI → _Cul + I2 + K2SO4 A. Balance the equation. B. In 2-3 sentences,…

Q: An experiment was carried out to make potassium dichromate(VI) from chromium(III) potassium sulfate…

A: To determine the moles of chromium(III) potassium sulfate (chrome alum) used in the experiment, you…

Q: 18.500 1. Mass of crucible+ cover 18.702 2. Mass of crucible + cover+ Mg 3. Mass of Mg 4. Mass of…

A: Interpretation - By given information- To determine the mass of Mg. Determine the mass of oxide…

Q: Types of Chemical Reactions: Double Replacement __BaCl, _K₂SO4 a) Bak₂ + CISO4 b) BaSO4 + KCL c)…

Q: Table of Reactants and Products Molecular weight (g/mol) Amount used or Density (g/mL) Moles used or…

A: Given, Molecular weight of salicylic acid = 138.121 g/mol Amount used or recovered = 0.880 gm Moles…

Q: 1. Hg(DAcy 2 NBH, CH

A: Given Product = To be determined

Q: None

Q: Consider the following reaction: 2 C2H4 (g) + 6 O2 (g) → 4 CO2 (g) + 4 H2O (g)…

A: Moles of CO2 produced can be calculated by knowing the limiting reagent.

Q: 4. The detonation of nitroglycerin proceeds as follows: 4 C3H5N3O9(l) → 12 CO2(g) + 6 N2(g) + O2(g)…

A: Given, The detonation of nitroglycerin: 4C3H5N3O9(l) → 12CO2(g) + 6N2(g) + O2(g) + 10H2O(g) Note:…

Q: Write the balanced chemical reaction that occurred, including states such as solid (s) or aqueous…

A: The balanced chemical equation is the process in hich we make the number of atoms in both reactant…

Q: Ancient Romans built often out of bricks and mortar. A key ingredient in their mortar was quicklime…

Q: 6. Balance the following chemical equations and determine the type of reaction: Na (s) + NaOH (aq) +…

A: Different type of chemical reaction: a) Precipitation reaction: In precipitation reaction an…

Q: 5. The combustion of glucose is represented by the following balanced equation: C6H12O6 +6 026 H₂O +…

A: Reaction-C6H12O6 +6O2 6H2O +6CO2Mass of C6H12O6 =1gMass of O2 = 1gMolar mass of C6H12O6 =…

Q: # 31 Consider the chemical reaction shown below. >Feg O 2 Fe + 30, For this reaction write the…

A: No.of moles is assumed to be equal to coefficient in the balanced equation. The balanced equation is…

Q: Stoichiometry - gram to gram. A student carried out the reaction shown by reacting 10.0g P4 with…

Q: A classic chemistry class demonstration is the burning of magnesium ribbon with a Bunsen burner. In…

A: The limiting reagents the starting reactant molecules that are used completely with the course of…

Q: Write a balanced chemical equation based on the following description: aqueous iridium(III) bromide…

A: A balanced chemical equation is a representation of a chemical reaction that shows the reactants and…

Q: Which of the following represents a combustion reaction? A. 2Na(s) + 2H2O(l) → 2NaOH(aq) + H2(g)…

Q: What are the coefficients that would balance this reaction? B2H6 (g) + H2O (l) → H3BO3(aq) + H2 (g)…

A: We have to find the coefficients that would balance this reactionB2H6(g) + H2O(l) -----> H3…

Q: Use the References to access important values if needed for this question. According to the…

A: A balanced chemical equation contain equal number of atoms of each elements on both sides of the…

Q: In the reaction 2NH3 + CO2 -- > CO(NH2)2 + H2O, 8 moles of > NH3 react with 8 moles of CO2, the…

A: Given reaction is 2NH3+CO2→CONH22+H2O To find the moles of CONH22 when 8 moles of NH3 react with 8…

Concept explainers

Thermochemistry

Thermochemistry can be considered as a branch of thermodynamics that deals with the connections between warmth, work, and various types of energy, formed because of different synthetic and actual cycles. Thermochemistry describes the energy changes that occur as a result of reactions or chemical changes in a substance.

Exergonic Reaction

The term exergonic is derived from the Greek word in which ‘ergon’ means work and exergonic means ‘work outside’. Exergonic reactions releases work energy. Exergonic reactions are different from exothermic reactions, the one that releases only heat energy during the course of the reaction. So, exothermic reaction is one type of exergonic reaction. Exergonic reaction releases work energy in different forms like heat, light or sound. For example, a glow stick releases light making that an exergonic reaction and not an exothermic reaction since no heat is released. Even endothermic reactions at very high temperature are exergonic.

Question

Table 1
1. Volume of
vinegar (mL)
2. Volume of
water (mL)
3. Mass of beaker
with liquid (g)
4. Mass of Alka
Seltzer tablet (g)
5. Total Starting
Mass (g)
= 3. + 4.
6. Mass of beaker
with liquid after
bubbles cease (g)
7. Calculated mass
of CO2 lost
(produced) (g)
<= 5.-6.
This is g CO2
8. Calculated mass
of NaHCO3
reacted (g)
Use Stoichiometry:
g CO2 →g NaHCO3
Run 1
0.00
Run 2
0.7
5ML 10ml
30ml
136.427 146.243
30ml
Run 3
Run 4
15ml
0.772 0.926
Run 5
20ml
0.929
Run 6
25ml
25ml 20ml
146.459 146.52g| 144.387 146.947
іни.
Run 7
15ml 10ml 5ml
Run 8
30ml 35m1
0.00
8.243g 3.2439 3.235 6.259 3.239 3.24 g 3.23g
139.87 149.486 149.48 149.75 149.617 150.207 149.884
139.179 148.7149 148.7549 148.821g|148.700g|148.270g| 148.931g|149.431g
0.917 1.937 -0.047 0.9
146.454 147.3110
3.23g 3.22g
150.53

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

8. A. Balance the following equations: i. a. S (s) + O2……………….> SO2(g) b. H2O2 (aq) + H2S (aq)……………..> H2O(l) + S (s) c. NaBr(aq) + Cl(aq) + NaCl(aq) Br (aq) d. A(s) + O2(g) ………………..> Al2O3 e. CH4 (g) + O2 (g) …………..> CO2(g) + H20 (l) ii. Identify the Oxidizing and reducing agents in the following equation: a. 2Cu (s) + O2(g) …………> 2CuO b. Cl(aq) + 2KI(aq)
65. Balance each of the following equations that describe decomposition reactions. a. CaSO4(s) CaO(s) + SO3 (g) b. Li, CO3 (s) → Li, O(s) + CO2 (9) c. LIHCO3 (s) → Li, CO3 (8) + H2 O(9) + CO2(g) d. C6 H6 (1) → C(s) + H2 (g) e. PB13 (1) → P4(s) + Br2 (1)
43 please
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
#11
2911/15/-1 {J... macOS Monterey... Combining 0.287 mol Fe₂O3 with excess carbon produced 13.5 g Fe. Fe₂O3 + 3C 2 Fe + 3 CO What is the actual yield of iron in moles? actual yield: What is the theoretical yield of iron in moles? theoretical yield: Dashboard scyool What is the percent yield? percent yield: Resources mol mol %
How many moles of NH, can be produced from 2.71 moles of nitrogen in the following reaction: N, (9) + 3 H, (g) → 2 NH, (9) MacBook Pro Psc 888 @ # $ % & 1 2 3 4 6 7 Q W E R Y U A S D F * 00
1. What coefficients (in order from left to right) are needed to balance the following chemical equation? ___Fe2O3(s) + ___C(s) → ___Fe(s) + ___CO(g) a. 1, 2, 3, 3 b.1, 2, 1, 3 c 1, 3, 2, 3 d.2, 1, 2, 3
6. Balance each of the following chemical equations. 02(g) KClO3(s) → KCl(s) + NaOH(aq) + Na(s) + Mg(NO3)2(aq) KNO3(aq) a. b. C. H₂O(1) → K3PO4 (aq) → Mg3(PO4)2(s) + H₂(g)