sketch a simple orbital overlap diagram to show how a bridging ligand can facilitate the coupling of electron spins on adjacent metal centers to give rise to an overall antiferromagnetic ordering in a metal oxide

sketch a simple orbital overlap diagram to show how a bridging ligand can facilitate the coupling of electron spins on adjacent metal centers to give rise to an overall antiferromagnetic ordering in a metal oxide

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 53AP

See similar textbooks

Related questions

Q: give an example of tetradentate ligand.

A: Tetradentate ligand:The ligands which binds with four donor atoms to the central metal atom to form…

Q: Draw the molecular orbital diagram of the -complex ion [Fe(H2O)6]2+, also arrange the electronic…

A: [Fe(H2O)6]2+ consists of 6 H2O ligands and an oxidation state of +2 which means Fe consists of 6…

Q: The π* orbital of NO is partially filled with an unpaired electron, which makes it less efficient in…

A: We have to tell between NO and CO which one is stronger π-acceptor ligand.

Q: 1. Determine the primary valency and secondary valency for [Co(NH3)6LC13 Primary valence = 2;…

Q: Why do soft metals which tend to form stable aqueous complexes with soft ligands tend to be more…

A: The toxicity of a metal depends on its ability to interact with biological molecules in the body,…

Q: sketch a simple orbital overlap diagram to show how a bridging ligand can facilitate the coupling of…

A: Antiferromagnetism is a type of magnetism in which adjacent ions or electrons are aligned in…

Q: is nitric oxide (NO) an ambidentate ligand?

A: ✓ A ligand is an ion or molecule that binds to a central metal atom to form a coordination…

Q: Explain the differences between high-spin and low-spin metal complexes.

A: Complexes with weak field ligands have the same number of unpaired electrons as the free metal ion…

Q: Show how the coordination of two MeHNCH2CH2NH2 ligands to a metal atom in a square planar complex…

A: Optical isomers: Two compound having same molecular formula but different in spatial arrangement…

Q: Differentiate between monodentate ligands, bidentate ligands,and polydentate ligands?

A: Difference between monodentate ligands, bidentate ligands,and polydentate ligands has to be given,

Q: Many trace metal ions exist in the blood complexed with amino acids or small peptides. The anion of…

A: (a)

Q: dentify complexes that can have low and high spin configurations and rationalize why they adopt a…

A: CN^-, CO are strong field ligand. These stays top of the spectrochemical series. Strong field ligand…

Q: In what directions do you expect the bond length andvibrational frequency of a free CO molecule to…

A: Interpretation - In what directions the bond length and vibrational frequency of a free CO molecule…

Q: Can the ammonia ligand engage in linkage isomerism?

A: Linkage isomerism is shown by ligands that are similar in their compositions but differ in the atoms…

Q: a. Briefly describe the chelate effect b. Give the structure of a ligand that will exhibit the…

A: The metal complex carrying the ligand that is chelating (two or more donating sites) is named as…

Q: According to the theory of molecular orbitals, how are ligands classified and what effect do they…

A: On the basis of molecular orbital Theory , ligands are classified into : 1.) Only sigma donor 2.)…

Q: Fluoride ion ranks low in the spectrochemical series and produces a weak crystal field in complex…

A: Given, Coordination complex = CoF64- F- = Weak field ligand Number of unpaired electrons in…

Q: Co is strong field ligand Plot the temperature dependence of the magnetic susceptibility versus…

A: The objective of this question is to explain the Curie-Weiss law helps explain the temperature…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

sketch a simple orbital overlap diagram to show how a bridging ligand can facilitate the
coupling of electron spins on adjacent metal centers to give rise to an overall
antiferromagnetic ordering in a metal oxide

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Antiferromagnetism:

VIEW

Step 2: Orbital overlap diagram:

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 5 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
What electronic feature must a donor atom of a ligand have?
Show how the coordination of two MeHNCH2CH2NH2 ligands to a metal atom in a square planar complex results in not only cis and trans but also optical isomers. Identify the mirror planes in the isomers that are not chiral.
give an example of tetradentate ligand.
How does Ligand Field Theory explain the interaction between the ligand with the central metal leading to increase or decrease of Δo ? Use the concepts of π-donor and π-acceptor ligands.
Work out the stoichiometries and structures of the neutral complexes, chromium carbonyl, rhenium carbonyl, and nickel carbonyl using the 18-electron rule. Then use valence bond theory to determine the hybridizations of the orbitals in each complex?
Draw the molecular orbital diagram of the -complex ion [Fe(H2O)6]2+, also arrange the electronic configuration of the molecular orbitals, and calculate the bond order
3a) The nitrosyl ion, NO*, is a very rare case of a cationic ligand that can function as a Lewis base. Draw the Lewis structure of this ligand under consideration of the VSEPR rules and indicate any formal charges on the constituent atoms. 3b) How many electrons does the NO* ligand contribute on the ionic model and the neutral model, respectively? Assume that the Metal-N-O bonding angle is 180° upon coordination.
An octahedral complex, MA4B2 (A and B are monodentate ligands), has two stereoisomers (trans and cis). Considering the point groups for each of these isomers, which of the following statements is correct? O The cis isomer is polar and the trans isomer is non-polar O The trans isomer is polar and the cis isomer is non-polar Both isomers are polar O Both isomers are non-polar