Question 9 Use the given information to find the exact value of the expression. sin α = 1, & lies in quadrant II, and cos ẞ = 3, ẞ lies in quadrant | Find cos (α - ẞ). A) 8-3-√√21 25 B)-6+421 B) -6+4√/21 25 C) 6-4√/21 25 D) 8+321 25

Q: Express 10 sin 45 as a number which is (a) Three significant Figures. (b) Three digits after the…

A: Topic- simplification

Q: Simplify each expression to a single trig function or number

A: Given function is, sinxcosx1-cos2x

Q: 3 Given that sin (a) 7 values of sin (a + b) and cos (a - b). sin (a+b) = cos (a - b) = (b) = -1/…

A: Given that  and  both in the interval .The aim is to find the values of  and .

Q: Simplify the following without the use of a calculator:

A: Since you have posted a question with multiple sub-parts, we will solve the first three sub-parts…

Q: Find a formula for 3cos(theta) that only involves sin(theta) or cos (theta)

A:

Q: Rewrite the expression as a sum or difference a) sin52.5° sin97.5° b)prove the identity…

A: Hey, since there are multiple questions posted, we will answer the first question. If you want any…

Q: Use an appropriate compound angle formula to determine the exact value of tan + 2₁ 3 -√√3-1 1+√3…

A:

Q: 14) Find the exact values for the following. Be sure to simplify and rationalize when needed. a)…

A:

Q: Let sine 32 and <<x. Part A: Determine the exact value of cos 20. Part B: Determine the exact value…

A: NOTE: Refresh your page if you can't see any equations. . here we have and the given interval is…

Q: Write sum or difference of trigonometric function. 2 cos 8x cos 2x A.) cosbx-cos10X (cos10x+ cosbx)…

A:

Q: a) 6(sin15degrees)(cos15degrees) b) sin(7pi/12)sin(13pi/12)-cos(7pi/12)cos(13pi/12) evaluate each…

A: Part a,          6sin15°cos15°We know that,         The double angle trigonometric formula is given…

Q: 10) cos sec-¹ 2√√3 3

A: According to bartleby guidelines we supposed to do the first one of multiple questionskindly repost…

Q: Suppose that csc a = -(√5)/2  and 180° < a < 270°. Find the exact values of sin a/2 and tan a/2…

A:

Q: Find sin 0. tan 0 = cos O> 0 sin 0 =| (Simplify your answer, including any radicals. Use integers or…

A:

Q: a) Is cos(2-30°) equal to cos² 30° - sin² 30° ? Yes or No. || b) Find the value of cos(230°).

A: a) cos ( 2.30°) = cos230 - sin230

Q: 3) Use the sum, difference, double or half-angle formulas to find the exact value of cos(sin-1+…

A:

Q: The value of the expression cos z - tan z – 9+ sin z+ secz is

A: given expression is…

Q: 9. Determine the correct simplification of the expression (1 + cose)(1- cose).

A: SOLUTION-

Q: How do I find sin Q, cos Q, and tan Q with these values: p = 3/2 q = (3√3)/2 r = 3

A:

Q: Why do we use the Laws of Sine and Cosine O In order to solve a reciprocal O To verify trig…

A:

Q: Question 5 What is the exact value of A B C 위~ SI 2 2 ㅠ 200(1) - 40%(1 COS D √6 2

A:

Q: 1 1 9) cos² 0 cot2 0

A: As per our guidelines we are suppose to solve only first question. Kindly repost the other questions…

Q: Using the exact values of the sine and cosine of both 2π/3 and π/4 and an angle sum identity, show…

A:

Q: Find the exact value step by step of each expression.

A: The final answer is given by:(i) csc−12​=4π​ (ii)tanθ=5​2​=525​​ (iii)cos(2sin−1135​)=169119​…

Q: If 180 is less than or equal to theta and greater than or equal to 270 degrees and cos (theta)=-2/9…

A: Here given as

Q: cos² A (sec² A – 1)

A:

Q: Perform the indicated operation and write the result in standard form. (2(cos 45° + i sin 45°))

A:

Q: The question says: "Find sin(x/2), cos(x/2) and tan(x/2) from the given information: cscX=3,…

A: Refer to the question we have to find the sin(x/2), cos(x/2) and tan(x/2) from the given…