Polycarbophil is a dietary fiber supplement. It is the calcium salt of a copolymer of acrylic acid and divinyl glycol, a cross-linking agent. In the stomach, the calcium ions exchange for protons and, in the higher pH of the intestine, the polymer absorbs 70 times its mass in ОН OH Divinyl glycol water. (a) Propose a structure for polycarbophil. (b) Why is cross-linking of the polymer necessary for this application? (c) Why is polycarbophil effective at providing bulk in the intestine? That is, what occurs on a molecular level to polycarbophil?

Polycarbophil is a dietary fiber supplement. It is the calcium salt of a copolymer of acrylic acid and divinyl glycol, a cross-linking agent. In the stomach, the calcium ions exchange for protons and, in the higher pH of the intestine, the polymer absorbs 70 times its mass in ОН OH Divinyl glycol water. (a) Propose a structure for polycarbophil. (b) Why is cross-linking of the polymer necessary for this application? (c) Why is polycarbophil effective at providing bulk in the intestine? That is, what occurs on a molecular level to polycarbophil?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

(a) Compare the characteristic features of polymerization by step-growth and chain- growth mechanisms. (b) Many alkene monomers (olefins) are readily polymerized by a free-radical mechanism. However, isobutylene is usually polymerized by a cationic mechanism. Explain.
24) Which of the following reagents would you use as the basis for a simple chemical test that would distinguish between ethylbenzene and styrene? (a) Nal/acetone (b) Br2/CCl4 (c) NaOH/H2O (d) NaBH4/CH3OH (e) HBr/H2O ethyl benzene styrene
(2) Show the mechanism of the cationic polymerization of the following monomer: CH₂ HC $
Write the mechanism of acid-catalyzed polymerization of ethylene to polythene.
(iii) The molecular weight of polydimethylsiloxane can be controlled by addition of a silicon-based reagent. Suggest the identity of this reagent and explain its effect on the polymerisation reaction. (iv) The properties of polydimethylsiloxane can be changed by the altering the degree of branching of the polymer chains. A silicon-based reagent can be added to promote chain branching during polymerisation. Suggest the identity of this reagent and explain how it promotes chain branching.
2. Draw a section of the chain (four or five repeating units) of each of the following head-to-tail polymers: (a) syndiotactic poly(vinyl alcohol) isotactic poly(a-methylstyrene) (b) atactic 1,2-polybutadiene syndiotactic poly(1,2-difluoroethylene) (c) (d)
(a) (i) Write an equation showing the formation of a triacylglycerol (Molecule A) thatcontains equimolar amounts of myristoleic, capric and linolenic acids. Myristoleic acid: CH3(CH2)5CH=CH(CH2)7CO2HCapric acid: CH3(CH2)8CO2HLinolenic acid: CH3CH2(CH=CHCH2)3(CH2)6CO2H (ii) Draw the structure of the partially hydrogenated product of Molecule A.
2)