On the diagram, fill in the electrons for [Cr(NH3)6]2+, draw an arrow 2.2 ( indicating the transition that gives rise to the 510nm absorption feature. Label this transition Ao. 2.5 What is the degeneracy of the t2g level? 2.4 Calculate the spin quantum number (S) for this complex.

On the diagram, fill in the electrons for [Cr(NH3)6]2+, draw an arrow 2.2 ( indicating the transition that gives rise to the 510nm absorption feature. Label this transition Ao. 2.5 What is the degeneracy of the t2g level? 2.4 Calculate the spin quantum number (S) for this complex.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 95CP: Consider the following complex ion, where A and B represent ligands. The complex is known to be...

See similar textbooks

Related questions

Q: The complex [Co(NH3)6]Cl3 is yellow orange while [Co(OH2)3F3] is blue. Suggest an explanation for…

A: The colour shown by the complexes are the complementary colours of the wavelength of light absorbed.…

Q: The absorption spectrum of the complex ion [Co(NH3)6]3+ has strongly absorbs blue light at a…

Q: [Cr(H₂O)₆]²⁺ is violet. Another CrL₆ complex is green.Can ligand L be CN⁻? Can it be Cl⁻?…

A: Given: [Cr(H₂O)₆]²⁺

Q: For the two complex ions [Mn(CN)6]4− and [Mn(H2O)6]2+ (a) Are all metal ligand bonds equal to…

A: We are given two complex, [Mn(CN)6]4−having CN as the pi acceptor an a strong field ligand.…

Q: [Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.

A: The octahedral splitting energy of transition elements is the difference in the energy of the…

Q: The complexes [V(H2O)6]3+ and [VF6]3- are both known. What gives rise to the colors of these…

A: The striking colors exhibited by the complexes are caused due to excitation of an electron from…

Q: The complex [Mn(H2O)6]2+ has five unpaired electrons, whereas [Mn(CN)6]4- has only one. Using the…

A: According crystal field theory, when transition metals are bonded to any ligand, their d orbitals…

Q: For each of the following pairs of complexes, identify the one that has the larger Crystal field…

Q: Explain the difference between the following crystal field energy values:

A: Given Crystal field energy

Q: Identify the first row transition metal that satisfies the requirements given: [Mn(H2O)6]2+ having…

Q: Determine the number of unpaired electrons, magnetic moment, and ligand field stabilization energy…

A: In case of transition metal cations , the electrons which are present beyond the noble gas are…

Q: The complex [Ni(CN)4]

A: According to VBT ( valance bond theory) sp3d2 and d2sp3 hybridisations complexes are in…

Q: Draw a diagram of the energy levels of the molecular orbitals of the complex [Ni (NH3) 6] 2+,…

A: Crystal field splitting energy in case of octahedral complexes: Before approaching ligands to the…

Q: Aqueous solutions of [Mn(H2O)6]2+ are faint pink, so much so that they appear to be colorless, which…

A: Introduction: The color of 3d transition metal ion in the solution is mainly because of two…

Q: Q3. Calculate the crystal field stabilization energy (in terms of Da) for the complexes:…

A: Applying formula of CFSE =[ x×-0.4+y×0.6]∆° + ZP Where X is no of electrons in t2g Y is no of…

Q: Draw the crystal field diagrams for [Fe(NO2)6]4− and [FeF6]3−. State whether each complex is high…

A: In coordination complexes, metal is present at the center of the complex and ligands surround it.…

Q: 1. The complexes ions of [Cu(H20)6]²+ and [Cu(NH3)4]2+ appear a pale shade of blue and a darker…

A: At the point when ligands append to a transition metal to shape a coordination complex, electrons in…

Q: The number of unpaired electrons expected for the complex ion: [Co(OH)6]3- is: Classify as…

A: 1) Given compound: CoOH63- In this cobalt is +3 oxidation state. The electronic configuration of…

Q: Draw the crystal-field splitting energy (CFSE) of the following complexes: a. [Cr(NH3)6]3* b.…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: A3- Draw all the possible geometrical isomers for the complex [Cr(en)2(CN)2]. And show how could you…

A: Here we are required to find the geometrical isomer for the given complex.

Q: Is this complex [Co(NH3)5Cl]CI2 paramagnetic or diamagnetic, explain?

A: Diamagnetic or paramagnetic nature of compound. If metal contains unpaired electrons then compound…

Q: Complex ion # Unpaired electrons Relative A, [Mn(H,O),1²* [Mn(en)3]2*

A: CFT explains the bonding interaction of central transition metal and ligand. This theory assumes…

Q: For each of the following pairs of complexes, identify the one that has the larger Crystal Field…

A: In both complex iron is in +3 oxidation state with electronic configuration [Ar] 3d5. H2O is a weak…

Q: 2 c) Make models of the two possible isomers of the [Co(NH3)4C12]+ ion. This is an octahedral…

A: The objective of the question is to identify and name the two possible isomers of the [Co(NH3)4Cl2]+…

Q: Provide the name of the coordination complex Na[CoCl4(NH3)2] b) Calculate the orbital multiplicity…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: [CO(NH3)6] Iohs. i. Illustrate the energy level splitting diagram for both complexes. Consi ii.…

A: This question belongs to coordination Chemistry.

Q: Do you expect the complex [Co(CN)6]3- to be inner-orbital or outer orbital complex?

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question…

Q: The complex [Ni(CN)4]2- is diamagnetic, but [NiCl4]2- is paramagnetic with two unpaired electrons.…

A: Whenever two electrons are paired together in an orbital, or their total spin is 0, they are…

Q: For the following transition metal complexes match the complex with its corresponding number of d…

A: The electronic configuration with the corresponding number of d electrons and low spin / high spin…

Q: 3. Use ligand field theory to explain why [Ni(CN)4]2- is diamagnetic while [Ni(C1)4]²- is…

A: Ligand field theory is a branch of molecular theory that seeks to explain the electronic structure…

Q: Consider the following complex ions: [NiBr6]4-,[Ni(H2O)6]3+ and [Ni(CO)6]3+. Using the Crystal Field…

A: Step 1: Electron configuration of Ni+n central metal. The ground state electron configuration of…

Q: The ion [Fe(CN)6]3- has one unpaired electron, whereas[Fe(NCS)6]3- has five unpaired electrons. From…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: At 55.0 °C, a 16.0 L vessel is filled with 8.25 moles of Gas A and 3.80 moles of Gas B. What is the…

A: Temperature (T)= 55°C= (55 +273)K = 328 K Volume (V) = 16.0 L Number of moles of gas A (nA) = 8.25…

Q: The high-spin d4 complex [Cr(H2O)6]2+ is labile , but the low-spin d4 complex ion [Cr(CN)6]4- is…

A: The high-spin d4 complex [Cr(H2O)6]2+ is labile , but the low-spin d4 complex ion [Cr(CN)6]4- is…

Q: Draw a diagram of the energy levels of the molecular orbitals of the complex [Ni(NH3)6]2+ , showing…

A: Solution The crystal theory fails to elucidate several physical properties of the transition metal…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

The MO scheme shown below is for the complex [Cr(NH3)6]*. This high spin
compound shows an absorption feature at 510 nm in its UV-visible spectrum.
6L
M
ML6
4p
4s
3d
t2g
Lo
Op
2.1
What is the geometry of this complex?

On the diagram, fill in the electrons for [Cr(NH3)6]2+, draw an arrow
2.2 (
indicating the transition that gives rise to the 510nm absorption feature. Label this
transition Ao.
2.5
What is the degeneracy of the t2g level?
2.4
Calculate the spin quantum number (S) for this complex.
2.5
Calculate the bond order of [Cr(NH3)6]2+.
When the complex is in the excited state formed by carrying out the Ao
2.6 (
transition, will the metal to ligand bonds be strengthened, weakened or have no
change? Explain in the space provided.
2.7
Suppose this complex was oxidized by one electron. Would this weaken
or strengthen or have no effect on the metal to ligand bond strength?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Would you expect the complex [Co(en)3]Cl3 to have any unpaired electrons? Any isomers?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Classify each ligand as monodentate, bidentate, and so on. (a) (CH3)3P (b) H2N(CH2)2NH(CH2)2NH2 (c) H2O
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
For each d electron configuration, state the number of unpaired electrons expected in octahedral complexes. Give an example complex for each case. (Two answers are possible for some of these cases.) (a) d2 (b) d4 (c) d6 (d) d8
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.
What is the coordination number of the central metal atom in the following complexes? (a) [Fe(H2O)63+] (b) [Pt(NH3)Br3] (c) [V(en)Cl42] (d) [Au(CN)2+]