O Macmillan Learning Consider the reaction between an alcohol and tosyl chloride, followed by a nucleophile. Write the condensed formula of the expected main organic product. CH₂CH₂CH₂OH 1. TsCl,pyridine 2. NC CH₂CH₂CN Incorrect 0

O Macmillan Learning Consider the reaction between an alcohol and tosyl chloride, followed by a nucleophile. Write the condensed formula of the expected main organic product. CH₂CH₂CH₂OH 1. TsCl,pyridine 2. NC CH₂CH₂CN Incorrect 0

Macroscale and Microscale Organic Experiments

7th Edition

ISBN:9781305577190

Author:Kenneth L. Williamson, Katherine M. Masters

Publisher:Kenneth L. Williamson, Katherine M. Masters

Chapter19: Alkenes From Alcohols: Cyclohexene From Cyclohexanol

Section: Chapter Questions

Problem 3Q

See similar textbooks

Related questions

Q: 1. Ammonium phosphate is (NH3)4PO4. 2. Aluminum hydroxide is A1OH3. 3. Mg(HCO3)2 is manganese (II)…

A: We have to predict reason for incorrect formula.

Q: -CH₂ Profen NH

A: This is a molecule attached to a protein by its N site of NH2 group. That molecule's IUPAC name is…

Q: The name of the compound shown here is

A: In this question we have to tell the name of the compound. In the naming of amine 'e' of the alkane…

Q: CH,CH,CHCH,CH, CH,CHCH,CH,CH, and CH, CH, and and

A: Write the IUPAC name of the following ---

Q: What's the name of this compond

A: A question based on the nomenclature, which is to be accomplished.

Q: C. Alcohols, Ethers, Phenols and Thiols 1. 2. 3. H.C. CH₂ H. C. CH CH CH3 ОН H.C ОН HỌCÁCH CH CH₂…

A: 1.2.3.

Q: 处 The name of this symbol is toxic sign. True False

A: TRUE It is a symbol representing biological hazard. A biological hazard could be made up of…

Q: n-propyl propenyl ether

A: 1) The name of the given molecule is, 1,2-divinylcyclohex-1-ene

Q: H. H. H. C%3C

Q: 2. What is the name for the following compound?

Q: A 6.949 gram sample of an organic compound containing C, H and O is analyzed by combustion analysis…

A: Given,mass of unknown organic compound = 6.949 gmass of CO2 = 9.854 gmass of H2O = 6.052 gmolar mass…

Q: Why is the formula shown for nitromethane incorrect?

A: Nitrogen atom cannot form five bonds. maximum 4 bonds can be formed by a nitrogen atom. Correct…

Q: Name this compound

Q: Which of the following equations represents the acid equilibrium associated with Kaz for H3PO3? A)…

A: Given : To write the acid equilibrium associated with Ka3 for H3PO3.

Q: Mercury (II) cyanide Aluminum sulfate Cobalt (III) hydroxide

A: Formula of the given name of the compound- 1)Mercury(II)cynide = Hg(CN)2 2)Aluminium sulfate =…

Q: Indicate the appropriate o (Me(CH2)11CO)2O

A: In this compound acid anhydride group is present. The general formula of anhydride group is (RCO)2O.…

Q: What is the name of the shown compound ? 01.5-(2-butyl)-2-methyloctane 2. none of the given answers…

A: First of all, we select the carbon chain containing the highest number of the carbon atoms. The…

Q: A certain compound contains only three elements: carbon, hydrogen, and chlorine. A sample of the…

Q: gold(I) oxide Express your answer as a chemical formula.

A: The gold(I) oxide is also known as gold oxide. Which have molecular formula of Au2O. This is because…

Q: Determine the name of the following molecule. A) 3-methyl-2-pentanone B) 3-methyl-4-pentanone

A: i) The longest carbon chain in the given molecule contains five carbon atoms. Therefore, the root…

Q: Name the compound using the Stock System. Pb(Cr,0,), Answer

A: In Stock system naming of a compound is done by showing the ionic charge and is usually done for…

Q: HO HN NO elect one: O 5-carboxy-3-nitroaniline 3-amino-5-nitrobenzoic acid 3-nitro-5-carboxyaniline…

A: In this question, we will select the correct name of this given Compound. You can see details…

Q: g e. CH3CH2CH(OCH3)CH2CH2CH2OH f. केभ

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: с с C с C ст è c / C C c C \ с

A: We are given with two compounds and we have to write their IUPAC names.

Q: 13. Identify the compounds A to E in each of the following reactions. conc. H2SO4 a) CH3CH,CH,OH A +…

A: conc H2SO4 is a dehydrating agent. It takes away water molecule from any compound making a double…

Q: The correct name of this compound is: H3C. CH3 N. N-pentlyheptanamide N-heptylpentanamide…

Q: 1. Using the previous rules, name the following compounds. a. H₂N NH₂ 1,3-Propanediomine

A: The International Union of Pure and Applied Chemistry (IUPAC) has established a set of rules for…

Q: correction: double bond in C=O * O CH3 С—С—СНз CH3 CH2=CHCH2OCH=CH2

Q: CH=CH2 3. 5. CH 3 CH-CH-CH;CH, CH -CH-CH3 i-CH2 CH,-CH-OH

A: We have to state the names of the compounds given. The given compound are mainly given cyclohexane…

Q: Enter the scientific name of the following compounds

A: (1) The scientific name of given compound is 4-ethyl-7-methyloctane.

Q: What is the correct formula triphosphorus hexaoxide

A: Given, Triphosphorus hexaoxideRequired, The correct formula

Question

Formula shown is incorrect

O Macmillan Learning
Consider the reaction between an alcohol and tosyl chloride, followed by a nucleophile. Write the condensed formula of the
expected main organic product.
CH₂CH₂CH₂OH
1. TsCl,pyridine
2. NC
CH₂CH₂CN
Incorrect
0

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

General Physical Properties of Organic Compounds

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Ⓒ Macmillan Learning Consider the reaction between an alcohol and tosyl chloride, followed by a nucleophile. Write the condensed formula of the expected main organic product. CH3CH₂OH 1. TsC1,pyridine 2. CH₂S-
Question 18.c of 20 Aldehydes and ketones are common carbonyl functional groups. Identify the structures and provide names of these molecules. Provide a systematic name for this structure. سکتے 5- H 1- 4- cyclo tert- 6- di n- tri 3- 2- sec- hex eth but Submit +
B. Draw structures for the products in the following reactions. my NH₂ NH₂ 1. LIAIH4 2. H₂O* xs EtBr 1. Mel 2. Ag₂O, H,O, heat acetone, formaldehyde cat. HCI
1l Normal l No Spac. A-空,A. KJIDPAL U - abx X, Paragraph Font Easter makes unique smells: 2-methyl-2-butanol + acetic acid →> 3-methyl-2-butanol + acetic acid –> 1-propanol + acetic acid –> 1-Octanol + acetic acid -> 2-methyl - propanol + formic acid acetic acid –> LA English (United States) to search
Ff.138.
taken in order to gor the product Please explain the mechanisms/steps
What is the preferred product in the following reaction? H.C Br NaOH the alkene The alcohol H₂C OH + H₂C CH₂
Macmillan Learning Consider the reaction between an alcohol and tosyl chloride, followed by a nucleophile. Write the condensed formula of the expected main organic product. CH₂CH₂CH₂OH 1. TsCl,pyridine 2. CH₂CH₂CH₂S CH,CH,CH,OS Incorrect
1. Which functional group is found in aldehydes? a. CHO b. -CH;OH c. -COOH d. RCOR' 2. Which functional group is found in ketones? a. -CHO CH:OH c. -COOH RCOR' 3. Which structural feature is common to aldehydes and ketones? a, an oxygen atom bonded to both a carbon atom and a hydrogen atom b. an oxygen atom bonded to two carbon atoms c. an oxygen atom double bonded to a carbon atom d. two oxygen atoms bonded to the same carbon atom 4. What is the IUPAC name for the following compound? a. I-pentaldehyde b. l-pentanal c. pentanal d. pentanealdehyde Cetoa of Fi
what is the product of this reaction
H. An ester is produced by the reaction of an alcohol with a carboxylic acid. For each ester below, underline the alcohol part and circle the carboxylic acid part. Then, name each ester. CHỊCH,CH,CH,CH,-O-C-CH,CH,CH, H CH₂ CH₂ CH 1 CH3
For each of the given reactions, pick the correct description and the correct reagent.