Name the the three sites in beryl including the coordination number: blue: name; CN light green: dark green: What is the name of the purple site?

Q: Name the following coordination compounds using systematic nomenclature. (a) [Cr(NH3)6](NO3)3: (b)…

A: In coordination chemistry for the naming of coordinate compound, IUPAC set some standard rule which…

Q: Heating 3.0 mol of a coordination compound gives 1.5 mol of ammonia, 3.0 mol of water 1.5 mol of HCl…

A: The compounds in which the metal atom is surrounded by the ligands is known as coordination…

Q: [Co(CO) C1₂]CIO4

A: A coordination compound is a complex chemical entity consisting of a central metal ion or atom…

Q: Assign a systematic name to the following coordination compounds: (a) [Zn(H2O);OH]Br (b) Na[CuFal

A: In coordination compounds, after the naming of ligands, naming of central metal atom is to be done.…

Q: One of the following solids is yellow, and the other is green: Fe(NO3)2-6 H₂O; K4[Fe(CN)6] -3 H₂O.…

A: The color of a coordination compound is due to the electronic transitions that occur within the…

Q: Pota um cobaltinitrite, also known as Indian Yellow, is a salt with the formula K3[Co(NO2)6]. It is…

A: Hello. Since the question contains more than three sub-parts, the first three sub-parts shall be…

Q: Consider the following coordination compound: [CoCl(NH3)4(H2O)]SO4-   What is its formula and…

A: A question based on coordination complex, which is to be accomplished.

Q: Identify each of the following coordination complexes as either diamagnetic or paramagnetic: (a)…

A: Given complexes are :  Identify whether the given complexes are diamagnetic or paramagnetic = ?…

Q: explain why heavier lanthanides form more stable complexes than lighter ones

A:

Q: The complex potassium dicyanoargenate(I) is used to make antiseptic compounds. Give the formula and…

A:

Q: [Cu (NH3) 4] SO4.H2O Describe the geometric structure of the compound with VBT by writing the…

A: Using concept of VBT to determine the geometry of co ordination compounds.

Q: The cobalt carbonyl complex, Co2(CO)8, undergoes an oxidation with hydrogen gas to form a monomeric…

A: The cobalt carbonyl complex, has more than one possible structures, due to which the product…

Q: Name the following coordination compound: K3[CrF6].

A: Coordination compounds: These are complexes that have a metal centre attached to groups of atoms.…

Q: Name the following compound: K4[Mn(Ox)3] a) Determine the coordination number  b) number of d-…

A: Coordination compounds are those compounds which are made by the transfer of electrons from ligands…

Q: 9. (NH,)2[Ni(C,O4)2(H,O),] 10. [Ag(NH;),][Ag(CN),] 11. [CoBr(NH;);]SO,

A: The above question contain multiple subparts ,hence only first 3 questions can be answered as per…

Q: Give the systematic name of this coordination compound. Na[Au(CN),] systematic name:

A:

Q: Assign a systematic name to the following coordination compound. Compound Name Li[RhF6|

A:

Q: Give the systematic name for the following coordination compound:

A: Coordination compounds are those compounds which are made by the transfer of electrons from ligands…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which there is a metal ion that forms coordinate bonds with…

Q: Explain the process of how coordination compounds are formed.

A: Coordination compounds or complexes are formed by transition elements or main group elements in…

Q: Heating 3.0 mol of a coordination compound gives 1.5 mol of ammonia, 3.0 mol of water 1.5 mol of HCl…

A: Given that: Heating of 3 mol of coordination compounds gives-NH3 = 1.5 molH2O = 3 molHCl = 1.5…

Q: Heating 2.0 mol of a coordination compound gives 1.0mol NH3, 2.0 mol H2O, 1.0 mol HCl, and 1.0…

A: The chemical equation must be:

Q: • d. Tris(ethylenediamine)copper(II) sulfate pe. Hexacarbonylmanganese(1) perchlorate \f. Ammonium…

A: For the complex compounds , there is a certain rule to provide a specific name for that complex…

Q: Draw the structures of the following compounds: a) Ammonium…

A:

Q: In which one of the following species does the transition metal ion have d electronic configuration?…

A:

Q: Calculating the LSFE of [Fe(H2O)6]Cl2, knowing that Δo = 10,400 cm–1 and P = 17,600 cm–1 Hints:…

A:

Q: Name the following: [Co(H2NCH2CH2NH2)3]2(SO4)3 [Pt(NH3)2]Cl4 (NH4)2[Ni(C2O4)2(H2O)2]

A: 1. [Co(H2NCH2CH2NH2)3]2(SO4)3 tris( ethylenediamine)cobalt(III) sulfate.

Q: Based on crystal field theory, please write the d-orbital energy diagrams in the Following…

A: The Crystal Field Theory (CFT) is a model for the bonding interaction between transition metals and…

Q: The compound Cr(en)2(OH)2Cl has been prepared in several isomeric forms: Isomer A is optically…

A: Given compound Cr(en)2(OH)2Cl isomer A  optically inactive and undergoes no reaction with either…

Q: NH3 Pd. NH3 O2N, O2N

A: Interpretation-  To given the name of the complex which is given in the question .    Concept-  To…

Q: Octahedral [Ni(NH₃)₆]²⁺ is paramagnetic, whereas planar[Pt(NH₃)₄]²⁺ is diamagnetic, even though…

A: Paramagnetic substances are those having unpaired electrons whereas diamagnetic substances are those…

Q: Give the systematic name of this coordination compound. [(en), ]Cl, systematic name:

A: Rules for naming complex compounds :-  In coordination sphere ligands are named fist in alphabetical…

Q: ii) the oxidation state of the central atoms. iii) type of ligands present in the compounds. iv)…

A: The given coordination compound is = Potassium tetrachloroaurate(III), KAuCl4

Q: 2. Give the name for each of the following coordination compounds. Ni(NH3)6](CIO3)2

A: As per our guidelines we are supposed to answer only one question. Kindly repost other question as…

Q: Give the systematic name for the following coordination compound:

A: Systematic name for the following coordination compound is