Moles, Molecules and Grams Question 2 How many moles of N, (MW = 28.02 g N2) are in 100.0 g N2?(Express as "mol N2") 100. 0 g N2 x- 1. 2. 3.569 mol N2 100.0 g times (1._ over 2. = 3.569 mol N2 2 28.02 g N2 3 1 mol N2 1. 1. 3 6.022E23 molecules N2 2 2. 1 1 molecule N2 3. Unused answer 3 1g N2 Question 3

Q: 9.51 g mixture of metal hydrate BaCl2*2H2O with an unknown amount of KCI is heated to remove water…

A: A question based on concentration terms that is to be accomplished.

Q: 1.08 ×10-3 mol H2S 57.2 mmol SO3 1.19 mol xenon dioxide  m(H2S) = m(SO3)= m(xenon dioxide)=

A: number of moles are given we have to calculate the mass of the given substances

Q: CH3CH₂CH(CH2CH3)CH₂CH₂CH3 Draw the molecule on the canvas by choosing buttons from the Tools (for…

A: Given -> 1-> CH3CH2CH(CH2CH3)CH2CH2CH3 2-> CH3CH(CH3)CH2CH2OH

Q: Calculate the mass (in g) of a single water (H2O) molecule. At. wt.g/mol: H=1 ,0=16 NA = 6.022 x…

A: Mole concept: The number of molecules or atoms present in the one mole of the substance is equal to…

Q: This is the chemical formula for acetone: (CH,),CO. Calculate the mass percent of hydrogen in…

A:

Q: How many moles are in 44.0 g of Al₂(CO3)3? Be sure to answer all parts. Enter your answer in…

A: Since, Moles is the ratio of mass to the molar mass of that atom or molecules. Thus,

Q: Calculate the mass percent of 2.50 moles of naoh in 0.900l of water at 25degress Celsius (the…

A: Given: The number of moles of NaOH is 2.50 mol. The volume and the density of water are 0.900 L and…

Q: The density of liquid benzene, C6H6, is 0.879 g/cm^3 at 15°C. How many moles are in 73.0 mL of…

A:

Q: What is the mass percent of the carbon in chloroform (CHCl3)? Note: Enter the percentage, not the…

A:

Q: mol M = What volume of 0.125 M KMNO4 is required to yield 0.180 mol? O 1.44 L 0.023 L O 22.5 L O.694…

A: Molarity = number of moles of solute / volume of solution in L Therefore, Volume of solution =…

Q: oluene (MW 92.141, d 0.87) is a chemical solvent. How many moles of toluene are present in 87.9 mL…

A: Given   volume of Toluene = 87.9 mL               density   = 0.87 gram/ mL   Number of mole of…

Q: How many equivalents of PO43 are there in 6.00 mol of Mg3(PO4)2 ?

A:

Q: 4. How many liters of Oz at STP will react with 8.7g 1 C,H, +3 0, → 2 CO;+2 H;O d lau baovig y isdaf…

A: Hey, since there are multiple questions posted, we will answer first question. If you want any…

Q: C. A student preparing this solution weighs 1.4802 g M9SO4•7H2O directly into the 50.00 mL…

A:

Q: Hydrogen peroxide decomposes as shown below: If a 5.951 g sample of hydrogen peroxide solution…

A:

Q: please answer this question in the same format that's in the picture below. (Example picture.)…

A: moles of hydrogen sulfide = 0.75 mol atomic mass of H = 1.00784 g/molatomic mass of S = 32.065…

Q: Based upon the following balanced equation: MnO2s) + 4 HClg - MnCl2{aq) + 2 H2OM + Clze) How many…

A: Hello. Since the question contains multiple parts, the first part is solved. In case the solution…

Q: Molly Cule weighed 8.61g of her hydrate (which is CaSO4*2H2O). After she did her hydrates lab, she…

A: a) Since the difference between the weight of hydrate and anhydrate should be equal to the weight of…

Q: Please assist with number 2

A: The number of moles of sodium atom can be calculated as given below.

Q: 0507 CHE114 POGILS11_12 Google... phrasing Extensions Help mal text 12 + BI UA 6 7 Balancing…

A: In the given equation, the cation is Pb which stands for lead. The charge of the lead cation is not…

Q: A mixture of gases has the following composition by mole: C2- 10% 02-75% N2- 15% What are the…

A:

Q: How many g of sodium hydroxide are contained in 10.6 mol of sodium hydroxide? Enter your answer in…

A:

Q: How many moles are in 87 g of Na2O? All answers have units of moles of Na2O O 1.4 6.0 x 1023 O 5.2 x…

A: Answer

Q: STEP 1. Calculate the %O in Cr2(CO3)3 to 4 significant figures. %O =  STEP 2. How many moles of…

A:

Q: In measuring the sample that is placed into a SCUBA diver's tank it has the following gases: 52.00 g…

A: A numerical problem based on percentage concentration, which is to be accomplished.

Q: Consider the following reaction Bacl, (aq) + Na, SO. (aq) - BaSO, (s) +2 Naci (aq) Suppose that 1496…

A: Given:  Concentration of BaCl2 = 1.220 mol/L  Volume of BaCl2 = 1.496 L  Concentration of Na2SO4 =…

Q: 0.279 g of the hydrate CoCl2•nH2O is heated to produce 0.197 g of anhydrous CoCl2 (MM = 129.83…

A: The water of crystallization means having a fixed number of molecules present in one formula of a…

Q: 17 - if the mass of 0.8 molar mixtures of NO and CH4 gases is 17 grams; The number of moles of I. NO…

A: From simple calculation by molar mass and mole of the compound we can calculate it

Q: When 15.00 g of mercury (I) oxide decomposes, how many moles of oxygen gas are produced? _HgO _Hg…

A: Given :  When 15.00 g of mercury (ll) oxide decomposes, how many moles of oxygen gas are produced?…

Q: Balanced Moleculer Equation! the Hy needed; 0109/19 x 74.34 x X Mg Breedad: #mol HCL X May (5) +…

A: Mg(s) + 2HCl(aq) ---> MgCl2(aq) + H2(g)

Q: Determine the number of moles in 247.6g of Cl2? Round to 2 decimal places.

A: Given: Mass of Cl2 =247.6 g The molar mass of Cl2 =70.906 g/mol Number of moles=?

Q: 1. What is the molecular formula for the unknown hydrate? 2. What is the percent mass of water in…

A: The molecular formula for the unknown hydrate is to be determined from the given experimental data.…

Q: Note: Reference the Fundamental constants table for additional information. 42.0 g OCT, chionine…

A:

Q: The mineral galena is composed of lead(II) sulfide and has an average density of7.46 g/cm3. (a) How…

A: Mineral are substances formed  naturally  in the earthGalena mineral  is ore of lead

Q: S + 6 HNO3 --> H₂SO4 + 6 NO2 + 2H₂O In the above equation how many moles of water can be made when…

A: We have to calculate moles of water in the reaction that can be made from given amount of HNO3

Q: 3.275 g of potassium bitartrate (KH5C4O6(s) are suspended in water and reacted with sodium carbonate…

A:

Q: Calculate the composition of the gaseous mixture obtained when 4.05 mol of carbon dioxide is exposed…

A:

Q: Mass Aluminum Foil (g) 2.5415 Mass Filter Paper (g) 0.2777 Mass Filter Paper + Product (g) 35.6484…

A: Calculate mass of product by using given data--

Q: A fungus that grows on peanuts produces a deadly toxin. When ingested in large amounts, this toxin…

A: we need to calculate the mass of fungus

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".