K-1x10" respectively A The equilibrium constants for dissolving slver sulfate and silver sulfide in water are 1.7 x 10" and 6 x 10 * white the balanced dissociation reaction equation and the associated equilibrium constant expression for each d) 2 Fe" (ag) +3 5 (aq) Fe,S,() process b) Which compound is more soluble? O Which compound is less soluble?

K-1x10" respectively A The equilibrium constants for dissolving slver sulfate and silver sulfide in water are 1.7 x 10" and 6 x 10 * white the balanced dissociation reaction equation and the associated equilibrium constant expression for each d) 2 Fe" (ag) +3 5 (aq) Fe,S,() process b) Which compound is more soluble? O Which compound is less soluble?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section12.5: Using Equilibrium Constants

Problem 12.6PSP

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
The following question is taken from a Chemistry Advanced Placement Examination and is used with the permission of the Educational Testing Service. Solve the following problem: MgF2(s)Mg2+(aq)+2F(aq) In a saturated solution of MgF2 at 18 C, the concentration of Mg2+ is 1.21103M . The equilibrium is represented by the preceding equation. (a) Write the expression for the solubility-product constant, Ksp, and calculate its value at 18 C. (b) Calculate the equilibrium concentration of Mg2+ in 1.000 L of saturated MgF2 solution at 18 C to which 0.100 mol of solid KF has been added. The KF dissolves completely. Assume the volume change is negligible. (c) Predict whether a precipitate of MgF2 will form when 100.0 mL of a 3.00103 -M solution of Mg(NO3)2 is mixed with 200.0 mL of a .2.00103 -M solution of NaF at 18 C. Show the calculations to support your prediction.. (d) At 27 C the concentration of Mg2+ in a saturated solution of MgF2 is 1.17103M . Is the dissolving of MgF2 in water all endothermic or an exothermic process? Give an explanation to support your conclusion.
Write the expression of the reaction quotient for the ionization of HOCN in water.
Use the solubility product constant from Appendix F to determine whether a precipitate will form if 10.0 mL of 1.0 106 M iron(II) chloride is added to 20.0 mL of 3.0 104 M barium hydroxide.
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
. The solubility product of iron(III) hydroxide is very small: Ksp=41038at 25 °C. A classical method of analysis for unknown samples containing iron is to add NaOH or NH3. This precipitates Fe(OH)3, which can then be filtered and weighed. To demonstrate that the concentration of iron remaining in solution in such a sample is very small, calculate the solubility of Fe(OH)3in moles per liter and in grams per liter.
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?