Consider the molecule of chloroform. Its tetrahedral structure is shown.H|CICCICIIs this molecule polar? If yes, consider which side of the molecule has partial negativecharge and which - partial positive. Then, indicate the direction of the dipolemoment relative to the molecule as shown.Non-polar, zero dipole moment.Polar. The dipole vector points along one of the C-Cl bonds.Polar. The dipole vector points along the vertical axis. parallel to the C-H bond.Polar. The dipole vector points along the horizontal axis.Polar. The dipole vector is perpendicular to the plane of the figure.

Given : structure of molecule. Tip : more electronegative will have negative charge

Is this molecule polar? If yes, consider which side of the molecule has partial negative charge and which - partial positive. Then, indicate the direction of the dipole moment relative to the molecule as shown.

Is this molecule polar? If yes, consider which side of the molecule has partial negative charge and which - partial positive. Then, indicate the direction of the dipole moment relative to the molecule as shown.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Draw the geometry of BrF3 molecule based on VSEPR theory, indicate the bond dipole moment and the…

Q: Carbon dioxide is a nonpolar molecule, whereas sulfur dioxide is polar. Provide an explanation that…

A: Polar covalent bond:The covalent bond is formed by the sharing of electrons between the atoms. If…

Q: This compound has the formula C6H5CH3ClCH=CHCHO Each intersection of adjoining lines is a carbon…

A: To write the structure we could know the VALENCE ELECTRONS of each atom i.e H - 1…

Q: Bean hexene is an odor compound used in cosmetics and cleaners. It is also known as leguminal. Its…

A: The formula of given compound is, CH3CH2CHCHCH2CH2OCH(OCH3)CH2CH3 In dash and wedge structure,…

Q: a Select one or more answers and submit. For keyboard navigation... SHOW MORE ✓ b C Multiple…

A: Bond angle is defined as the angle between the two bonds i.e. angle between two orbitals containing…

Q: A molecule that contains polar bond is not necessarily polar. What other factor is required if the…

Q: Answer the questions in the table below about the shape of the hydrogen cyanide (HCN) molecule. How…

Q: Based on electronegativity trends in the periodic table, which of the following molecules is most…

A: From the given molecules, which is most polar has to be identified.

Q: Determine whether the polar bonds add together to form a net dipole moment

A: Definition :- It is a covalent bond between two atoms where the electrons forming the bond are…

Q: A student who missed this class needs to know how to predict the bond angles and shape of a molecule…

A: Each molecule is made up of its constituent particles such as atoms/ions. The molecular geometry of…

Q: Both individual bonds and whole molecules can be polar or non-polar. First, (i) explain what causes…

A: Answer - According to the question - Within a molecule each polar bond has a bond dipole; A polar…

Q: In VSEPR theory, when considering the electron-pair geometry, single bonds, double bonds, and lone…

A: Answer:- In VSEPR theory, the molecule has two geometries. One is electron pair geometry and second…

Q: A molecule exhibits the trigonal planar shape. How many electron groups exist in the valence shell…

A: The question is based on the concept of chemical bonding. We have to identify number of valence…

Q: Which molecule is correctly paired with its VSEPR shape?

A: The correct shapes of each molecule is given below:

Q: If all of the electron groups around a single central atom are bonding, and the same outer atom is…

A: All of the electron groups around a single central atom are bonding, and the same outer atom is…

Q: Which of the following would you expect to be a polar molecule? O CH4 O CO2 O CCI4 O CHCI3 O N2

A: Interpretation - To tell about which one of following would you expect is the polar molecule.…

Q: Why is it important to take both the polarity of the bonds and the VSEPR shape of the molecule into…

A: VSEPR theory is known as valence shell electron pair repulsion theory,which explains the molecules…

Q: the following table. Only consider the central atom when filling in the steric #, # of bonding…

A: The polarity of a molecule depends upon the electro negativity difference between the atoms.Molecule…

Q: O Determine whether SF2 is polar. To do this, you must: draw the 3D structure of the molecule, use…

A: A molecule is said to be polar if there is some net dipole moment present in the molecule.

Q: Predict the ideal bond angles around each central atom in this molecule. carbon: :N=C-N-H nitrogen:…

Q: The caffeine molecule is shown below. Indicate the electron geometry AND the molecular shape around…

A: "A" denotes a carbon atom. This Carbon atom has 3 sigma bonds here in the caffeine molecule.…

Q: A molecule exhibits the trigonal bipyramidal shape. How many electron groups exist in the valence…

A: Geometry of molecule is based on number of bonding pair of electrons and non bonding pair of…

Q: Explain percent ionic character of a bond. Percent ionic character is defined as the ratio of a…

Q: (co} ) Answer the questions in the table below about the shape of the carbonate anion. How many…

A: Shape of carbonate anion CO32-. Total valence electron = 4+3×6+2=25

Q: Suppose that a molecule has four bonding groups and one lone pair on the central atom. Suppose…

A: Given information is as follows: Molecule has four bonding groups and one lone pair on the central…

Q: Dispersion forces are produced when an electronegative atom pulls on the electron of a hydrogen atom…

A: To clarify, let's examine each of the given statements to see which one accurately describes…

Q: Which of the following statements could be true regarding polar molecules?

A: A polar molecule is the one which have a non zero dipole moment. For the polar molecule to have non…

Q: Which statements about resonance are correct? Select all that apply

A: Resonance structures are the structures where there is delocalization of electrons to impart overall…

Q: Complete the table. Number of electron groups Bond angle Outer atoms/Lone pairs 2 ? 2/0 3 ? ? bond…

A: While deciding the geometry of the molecule we look for both lone pairs and bond pairs but while…

Q: Carbon disulfide (CS₂) is [Select] dichloride (SCl₂) because [ Select] [ Select] geometry. ✰ sulfur…

A: we have to fill the missing boxes with given options

Q: Carbon dioxide, CO2, is a byproduct of combustion reactions and an important greenhouse gas in…

A: For, the first question, we have to find the electron domain geometry of CO2. For the second…

Q: How does adding an atom affect the position and angles of existing atoms or lone pairs? How does…

A: Hey since you have posted a question with multiple sub-parts, we will solve first three sub-parts…

Q: 3) Determine whether CH3CI is polar. To do this, you must: draw the 3D structure of the molecule,…

A: In this question, CH3Cl is given and it is to be determined whether the given molecule is polar or…

Q: Based on the Lewis structure and your knowledge of VSEPR theory, approximate the smallest bond angle…

A: Since,According to the VSEPR theory, steric number (which represent hybridization) is the…

Q: Determine the number of electron groups around the central atom for each of the following molecules.…

A: The objective of the question is to determine the number of electron groups around the central atom…

Q: Examine the model structures for SF4and XeF4. Both molecules have four fluorine atoms attached to…

A: Following are the differences between the model structure of SF4 and XeF4.

Q: What effect does the presence of lone-pair electrons have on the bond angles in a molecule?

A: We know that lone pair-lone pair repulsion is greater than bond pair-lone pair repulsion and which…

Q: ule pictured with the formula C3H4, the CENTER carbon atom in the molecule has lone pairs, and other…

A: As Carbon has four valence electrons. So, it can form maximum four bonds

Q: Answer the questions in the table below about the shape of the iodine trifluoride (IF. 3) molec How…

A: We can determine the number of electronic groups around a central atom from its hybridization. The…

Q: 2.1 H₂O, polar Bond dipoles 3.5 2.1 Overall dipole moment

Q: For the following molecule, indicate the positive and negative ends of the dipole, using the symbol…

A: For the following molecule indicate the positive and negative ends of the dipole using the symbol…

Question

100%

Consider the molecule of chloroform. Its tetrahedral structure is shown.
H
|
CI
CCI
CI
Is this molecule polar? If yes, consider which side of the molecule has partial negative
charge and which - partial positive. Then, indicate the direction of the dipole
moment relative to the molecule as shown.
Non-polar, zero dipole moment.
Polar. The dipole vector points along one of the C-Cl bonds.
Polar. The dipole vector points along the vertical axis. parallel to the C-H bond.
Polar. The dipole vector points along the horizontal axis.
Polar. The dipole vector is perpendicular to the plane of the figure.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Following is a molecule with polar bonds whose shape was obtained using the VSEPR theory. Specify the molecular shape of this molecule, and whether the molecule is polar or nonpolar. (Hint: In terms of polarity, see whether the dipoles in the molecule cancel or not. A molecule containing polar bonds can be nanpolar if the dipoles cancel each other. You can imagine the dipoles as ropes pulling on the central atom–If the pulls cancel each other, that is, the central atom cannot move, then the molecule is nonpolar. If on the other hand the opposite is true, then the molecule is polar.) O trigonal pyramidal shape, nonpolar O trigonal planar shape, nonpolar O tetrahedral shape, polar O trigonal pyramidal shape, polar O trigonal planar shape, polar
Mark the following statements as true or false. A molecule with very polar bonds can be nonpolar. blank The electrons in a polar bond are found nearer to the more electronegative element. blank Fluorine is very polarizable. blank Covalent bonds are partially ionic because of polarizability of atoms. blank Kr and Sr2- are isoelectronic.
Is it possible for a molecule with polar bonds to be non-polar? Why or why not?
why are some gases polar molecules? For example, SO2 is a polar molecule and a gas. CHCl3 is a polar molecule but a liquid. How come these two examples are both polar molecules but are in different states of matter?
A Lewis structure is a two-dimensional representation of a molecule that does not necessarily show what shape that molecule would take in three dimensions. Based on the Lewis structure and your knowledge of VSEPR theory, approximate the smallest bond angle in this molecule. *Picture attached*
Draw the Lewis structure of chlorine pentafluoride. Identify BOTH its electron pair and molecular geometries. If an overall dipole moment is present, draw the arrow.
In the following list of molecular formulas identify which violate the octet rule for the central atom. a) NH3 b) PCl5 c) CS2 d) ClF3 e) PCl3
Predicting the arrangement of electron groups around the central atom of a molecule.
A hypothetical molecule has the following formula XY2. The B-P bonds are polar covalent, with B being most electronegative, however the molecule itself is non polar. What molecular geometry(ies) are possible for this molecule. Use 3-D drawings to explain.
Which of the following elements are capable of expanding their octet? Select all that apply. Br Se F
Which of the following statements is/are true about the Lewis bond theory? (a) It explains the stability of the molecule. (b) It explains why one covalent bond might differ from another. (c) It ignores the energy changes in chemical bond formation. (d) It treats all covalent bond in the same manner. a and b O b and c O c and d a and d
A molecule is made of one hydrogen atom bonded to one fluorine atom. What information is necessary to determine whether this is a polar molecule?