If the molecules in the above illustration react to form IF3 according to the equationI2 + 3 F2 2 IF3 , the limiting reagent is the number of IF3 molcules formed is the number of atoms/molecules in excess is .

If the molecules in the above illustration react to form IF3 according to the equationI2 + 3 F2 2 IF3 , the limiting reagent is the number of IF3 molcules formed is the number of atoms/molecules in excess is .

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.88E

See similar textbooks

Similar questions

or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
Billions of pounds of urea, CO(NH2)2, are produced annually for use as a fertilizer. The principal reaction employed is: 2NH3+CO2CO(NH2)2+H2O By assuming unlimited amounts of CO2, how many moles of urea can be produced from each of the following amounts of NH3? a.2molNH3b.0.45molNH3c.10gNH3d.2.0kgNH3
When white phosphorus burns in air, it produces phosphorus(V) oxide. P4(s)+5O2(g)P4O10(s);H=3010kJ What is H for the following equation? P4O10(s)P4(s)+5O2(g)
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Fertilizer The compound calcium cyanamide (CaNCN) is used as a nitrogen source for crops. To obtain this compound, calcium carbide is reacted with nitrogen at high temperatures. CaC2(s)+N2(g)CaNCN(s)+C(s) What mass of CaNCN can be produced if 7.50 mol of CaC2 reacts With 5.00 molOf N2 ?
4.17 Phosgene is a highly toxic gas that has been used as a chemical weapon at times in the past. It is now used in the manufacture of polycarbonates, which are used to make phone cases and plastic eyeglass lenses. Phosgene is produced by the reaction, CO+Cl2COCl2 . Given an excess of carbon monoxide, what mass of chlorine gas must be reacted to form 4.5 g of phosgene?
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
Nitrogen (N2) and hydrogen (H2)react to form ammonia (NH3). Consider the mixture of N2 and H2 in a closed container as illustrated below: Assuming the reaction goes to completion, draw a representation of the product mixture. Explain how you arrived at this representation.
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?