If the following molecule cyclized, which of the following statements would be true?H-HOHOH-CHO-OHHH-OHCH₂OHA five membered ring would be formedMannopyranose would formHemiketal chemistry would result from the C5-OH doing nucleophilic attack of the carbonyl carbonThis cyclized sugar could be amide linked to a sphingosine as part of formation of sphingomyelinThis cyclized sugar could modify a cerebroside

it is the structure of galactose. It is a monosacharide. cyclization results when C5-OH doing…

Answered: If the following molecule cyclized,…

Science

Chemistry

If the following molecule cyclized, which of the following statements would be true? H- HO- HO H- CHO -OH H H -OH CH₂OH

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: What is the correct IUPAC name for the following molecule? 2-ethoxy-3-methylbutane…

Q: What is the IUPAC name of the compound below? (Z)-2-methyl-6-phenyl-2-hexen-5-one O…

Q: Macmillan Learning Arrange the compounds by boiling point. Highest boiling point Lowest boiling…

A: Given compounds : pentane, neopentane , hexane All of the given compounds are alkanes. Boiling…

Q: Determine whether each of the following molecules is a hemiacetal, acetal, or neither and select the…

A: The objective of the question is to find whether the given molecule is Acetal,Hemiacetal or…

Q: Н- HO H H OH -H OH CH₂OH ? НО Н CH₂OH =0 -H -OH CH₂OH

A: Product of following reaction can be made by applying appropriate reaction mechanism.

Q: 11. CH;CHCH3 CH2-CH2-OH What is the IUPAC name for the above? O 1-hydroxy-3-methylbutane O…

A: IUPAC nomenclature is used for naming the organic compounds as recommended by international union of…

Q: Write the complete common (not IUPAC) name of each molecule below. Note: if a molecule is one of a…

A: Given that, the structures of the molecule are:

Q: [H+] HẸN NH, -H₂O ?

A: The given reactant is a ketone. When a ketone reacts with hydrazine (NH2-NH2), one mole of H2O will…

Q: B) 1-chloro-6-methylbenz C) 1-chloro-2-methylbenzene D) 1-chloro-2-methycyclohexane H₂C- CH3 A)…

A: By using IUPAC rules, we can give names of the organic compounds.

Q: Match the correct formula of Alcohols Methanol 1-Pentanol. 3-Pentanol 2-methylpropan-2-ol C6H5OH…

A: A substance classified as an alcohol has an aliphatic carbon atom attached to a hydroxyl (OH)…

Q: What is the correct name for the following compound? CH3 OH H3C-CH-CH-CH3

Q: CH3- You Br Provide a name for each of the following CH,CH,CH

Q: Choose the most appropriate systematic (IUPAC) name from the choices below that accurately describes…

A: B is the correct option CH3 and OH are opposite side so they are anti position Name will be…

Q: Complete the table with the bond line structure and its respective IUPAC name.

A: Rules for the IUPAC name : Find and name the longest continuous carbon chain. Identify and name…

Q: Which of the following compounds is expected to give a positive Tollen's test? HC-CH2-CH3 CH…

A: Tollen's test given by aldehyde.

Q: What is the correct IUPAC name for the following compound? CH3 H3C CH CH3 Type your response in the…

Q: a ketone and an ether?

Q: Write the correct IUPAC name for the compound below CH, OH CH₂CHCH₂CHCH,CH, O B) 5-methylhexan-2-ol…

A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…

Q: hello. Name the following alcohols in tH Br H H ОН HO, —С- C C- Br Br H H НО. H -c= —С—н CH3 H H OH

Q: What is the most correct name for the molecule? CH3 cyclohexylpentylketone O 1-cyclohexylpentanal…

Q: 土 1111 애 1111 + 에 111노

A: Here to understand which conformation is the most stable, we need to know about the decalin…

Q: OH CI CH3OH OCH3 OCH3 KLM MLK

A: The reaction given is,

Q: Name the following compounds

A: The objective of this question is to name the given phosphate compounds.Chemicals known as phosphate…

Q: Among the following compound, which are the same? он H C он CH₂ -ОН -ОН -ОН -ОН A A and B A and C B…

A: For seeing similar compounds we should draw all the given molecule in Fischer projection form .

Q: What is the IUPAC name of the following compound? F -CI O (1R, 3R)-1-cho-3-fluorocyclohexane O (1S,…

A: The IUPAC stands for International Union of Pure and Applied Chemistry.The IUPAC name of any…

Q: Name the following of each problem

A: In the giving of numbering in the carbon chain the substituted carbon atoms should get first…

Q: Н СНз н н Н-С-с-с-С-С-н H H H CH2H CH3

Q: What is the product of CH₂OH H-C-OH HO-C-H H-C-OH H-C-OH CH₂OH COOH H-C-OH HO-C-H H-C-OH H-C-OH…

A: We have to choose the correct option.

Q: Classify each molecule as an aldehyde, ketone, or neither. Aldehyde CH CH₂CHCH, i CH₂CH₂CCH, Ketone…

A: The organic compound is formed by two main elements, carbon, and hydrogen. The specific group of…

Q: 0 H NaOH 1-cyclopentylpropan-1-one benzaldehyde

A: A mixed aldol condensation reaction involves the condensation of two different carbonyl compounds to…

Q: 4000 2000 1500 1000

A: IR data analysis 3300-3350 cm-1 indicates sharp peak of C-H bond stretching frequency of terminal…

Q: Classify each molecule as an aldehyde, ketone, or neither. Aldehyde H₂C-O-CH3 || CH₂CH₂CH i…

Q: Which chemical would you use to create an artificial orange flavored drink? H O HCCH H- CH

A: Artificial flavors are not defined as the natural products, even if they have the same chemical…

Q: What is the IUPAC name for the following molecule? OH je 4-hydroxyhexan-3-one 3-hydroxyhexen-one…

A: For IUPAC naming following steps are required- First of all find the longest carbon chain…

Q: Which of the following compounds are identical?

A: Given : structure of molecules

Q: Write the complete common (not IUPAC) name of each molecule below. Note: if a molecule is one of a…

Q: Check the box under each compound that exists as a pair of mirror-image twins. If none of them do,…

Q: he correct IUPAC name for the compound shown her

A: IUPAC nomenclature: In IUPAC nomenclature a molecule's longest chain of carbons is taken as parent…

Q: Which of the following is the correct name for the trisubstituted cycloheptane ring shown below? ó O…

Q: Classify each molecule as an aldehyde, ketone, or neither. Aldehyde CH₂CH₂CCH3 OH I CH₂CH₂CHCH₂ CH I…

Q: What is the IUPAC name?

A: Let us find out its R/S nomenclature and then name it normally according to IUPAC.

Q: Which of the following molecules would be expected to have the highest boiling point?

Q: Classify each of the following hydrocarbons as saturated or unsaturated. H H H H H- H -C- H H -C H H…

A: Unsaturated hydrocarbons: unsaturated hydrocarbons contains multiple covalent bonds [double (-C=C-)…

Q: Which of the following compounds is a secondary alcohol? O CH3 -CH-O-CH3 C H3 0 CH3-O-H O CH3 -…

Q: Н СНЗ н н H-C-C-C-C-C-H HH H CH2H CH3

A: The given compound is a hydrocarbon and contains carbon-carbon single bonds, hence it is an alkane.

Question

If the following molecule cyclized, which of the following statements would be true?
H-
HO
HO
H-
CHO
-OH
H
H
-OH
CH₂OH
A five membered ring would be formed
Mannopyranose would form
Hemiketal chemistry would result from the C5-OH doing nucleophilic attack of the carbonyl carbon
This cyclized sugar could be amide linked to a sphingosine as part of formation of sphingomyelin
This cyclized sugar could modify a cerebroside

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: introduction

VIEW

Step 2: formation of cyclic compound

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

What the correct IUPAC name for the compound shown? CH2 I CH3-C-CH-CH2-CH3 I Br What the correct IUPAC name for the compound shown? CH3-CH2-CH-CH2-CH3 I CH2OH What the correct IUPAC name for the compound shown? CH3 I CH3-O-CH2-CH2-CH-CH3
Arrange the following compounds in order from the most stable to the least stable. CH CH (HC,C (H,CHC CH CH CICH CH, IV ON> II> l> |I| O>> l> IV OIl> Il> l> IV
What is the IUPAC name of the compound shown below? CH3 CH-CH-CH C-O Nat O 2-methyl sodium butanonate 3-methyl sodium butanonate O sodium 3-methylbutanonate O sodium 2-methylbutanonate
X Incorrect. Assign an IUPAC name for the following compound. 3-thiohexane Ethyl propyl sulfoxide O Propyl ethyl sulfide O Propyl ethyl sulfoxide 4-thiohexane O Ethyl propyl sulfide
Write the IUPAC name for each of the following:
4) Listen Which of the following is an alcohol? NaOH O O _i_CH₂ H₂C-C-CH₂ CH 3 CH 2 OH OH₂C-NH₂
None
estion 12 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: 0 CH2-0-C-(CH2)16-CH3 о о O= = = CH-O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 13 of 33 Write down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: CH₂-01 CH-O ང CH₂-01 Separate each name with a comma. You will find useful information in the ALEKS Data resource. Question 14 of 33 Draw the skeletal ("line") structure of the triacylglycerol that could be formed from lauric acid.
1
r Provide the correct systematic name for the compound shown here. H3C Time's Up! 4- iso NH₂ CH3 (E)- (R)-(S)- (Z)- CH3 2- 6- 3- 5- sec- tri di cyclo tert- prop amino but meth nitro hex Submit +
SC What is the correct IUPAC name for the following compound? O 6-cyclopropyl-5-hexyne O 1-cyclopropyl-1-hexyne O 1-cyclopropane-4-nonyne O 3-propylhept-2-yne Save for Later 2 9 W # 3 e C 미 $ % 4 5 RS 6 7 t y
Which of the choices is the correct name for the given structure?