The Haber process is used to industrially produce ammonia (NH3). Ammonia is theactive ingredient in a variety of household cleaners. The data table belowsummarizes the experimental quantities of reactants and products collected from aspecific batch.N2 (g) + 3 H2 (g) --> 2 NH3 (g)SubstanceAmount UsedN210,000 gH215,000 gAmountProduced11,150 gSubstanceNH3If the company chemist calculated that 12,163 g of NH3 should be produced, what isthe percent yield?

Answered: If the company chemist calculated that…

Science

Chemistry

If the company chemist calculated that 12,163 g of NH3 should be produced, what is the percent yield?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 113AE: Gold is produced electrochemically from an aqueous solution of Au(CN)2 containing an excess of CN....

See similar textbooks

Related questions

Q: A student isolated 25 g of a compound following a procedure that would theoretically yield 81 g.…

A: Theoretical yield is actually the product obtained on complete reaction of the limiting reactant.…

Q: A 1.00 gg sample of potassium bicarbonate is decomposed by heating. If the resulting potassium…

A: Given, A 1.00 g sample of potassium bicarbonate is decomposed by heating. Actual yield = 0.710g…

Q: The percent yield of this reaction is

A: Given reaction is 2 Al + 3 F2 --> 2 AlF3 2 x 27 g.…

Q: what is the theoretical and percent yield of the reaction?

Q: Lead(III) sulfide reacts with calcium chloride to produce lead(III) chloride and caleium sulfide. If…

Q: What is the percent yield of BrCl?

A: Kc = Kp /(RT)∆n . ∆n = 2-2 = 0 Hence, Kc = Kp So, mass of BrCl in g = 12.71214 g Calculation :

Q: what is the mass in grams of aluminum iodide that would be required to yield an actual amount of…

A: Number of moles = mass/molar mass Mass = moles × molar mass Percent yield = (actual…

Q: The theoretical yield of aluminum is 1.16 moles. If only 1.03 moles of aluminum were collected, what…

A: Given, Theoretical yield = 1.16 moles Actual yield = 1.03 moles % yield = ?

Q: If the theoretical yield of a reaction is 0.118 g and the actual yield is 0.104 g, what is the…

A: The given data contains, Theoretical yield = 0.118 g. Actual yield = 0.104 g.

Q: What does it mean when the percent yield is about the same amount as the theoretical yield?

A: Percentage yield : Percentage yield is the ratio of actual yield to the theoretical yield ie.…

Q: 1.39 mol Nal is used in a reaction. What is the mass of Nal present?

Q: based on the data and information below how do I calucalted the experimental percentage yield? what…

A: The formula for experimental percent yield is: Experimental percent yield = Actual yield of…

Q: e percent yield of c

Q: what is the percent yield of this reaction?

A: Given :- C(s) + 2 Cl2(g) ----> CCl4(l) Theoretical yield of CCl4 = 31.363 g Actual yield of…

Q: I actually produced 6 grams of lithium chloride. What is my percent yield?

A: number of moles = mass/molar mass mass = moles × molar mass percent yield ={actual…

Q: A 1.50 gg sample of sodium nitrate is decomposed by heating. If the resulting sodium nitrite has…

A: Given: The actual yield of NaNO2, = 1.22 g. The theoretical yield of NaNO2, = 1.32 g.

Q: What is the percent yield?

A: percent yield = (actual yield/theoretical yield) × 100%

Q: e the percent yield of se

Q: A 0.4011 g sample of aluminum reacts according to our experiment to produce alum. 5.7968 g of dried…

A: The ratio of actual yield to the theoretical yield multiply by 100 is known as percent yield.

Q: What is the percent yield of a reaction if it had a theoretical yield of 125g but an actual yield of…

A: The equation for percent yield is: percent yield = (actual yield/theoretical yield) x 100% Where:…

Q: A small winery is expected to produce 685 bottles of wine this year. If the actual amount of wine…

A: Given Actual yield and expected of bottles of wine in the year. To find Percent yield of wine…

Q: What experimental information do you need in order tocalculate both the theoretical and the percent…

A: To calculate the theoretical yield of any chemical reaction, we need to know the quantity of one of…

Q: Explain how percent yield is calculated.

A: Experimentally, in any chemical reaction, not all reactant molecule will get converted into…

Q: How many moles of NH3 are present in this equation?

A: The given reaction is; 2NH3 + 3CuO → 3Cu + 3H2O + N2 Here, copper, water, and nitrogen are formed as…

Q: If MnO2 at 0.86 moles and HCl at 48.2 g react as follows, which reactant is the limiting reactant.…

A: The limiting reagent is a substance whose mole to stoichiometric coefficient ratio is the least.

Q: The limiting reactant determines what the actual yield is.

A: About Limiting reactant : When two Reactants reacted with each other but after the Reaction one…

Q: d. How many grams of phosphorus pentachloride are theoretically produced? If 0.450g of phosphorus…

A: From the given problem, the balanced equation is: P4 (s) + 10 Cl2 (g) → 4PCl5 (s) For chlorine gas…

Q: A chemist measures the amount of bromine liquid produced during an experiment. She finds that 2.3 g…

A: Given :- mass of bromine liquid produced = 2.3 g To calculate :- Number of moles of bromine liquid…

Q: Consider the balanced chemical reaction below. What is the maximum amount of grams of Fe that can be…

A: The limiting reagent in a chemical reaction is a reactant that is totally consumed when the chemical…

Q: What is the percent yield of nitrogen monoxide ?

A: Number of moles = mass/molar mass Percent yield = (actual yield/theoritical yield) × 100% Molar…

Q: What is the actual yield?

A: Actual yield: It is defined as the quantity of a product that is obtained from a chemical reaction.…

Q: Given the reaction has a percent yield of 88.8%, what is the mass in grams of aluminum iodide that…

A: Interpretation- To determine the mass in grams of aluminum iodide that would be required to yield…

Q: What is the theoretical yield of carbon dioxide formed

A: Number of moles = mass/molar mass Mass = moles × molar mass Molar mass of Octane = 114.23 g/mol…

Q: , what is the limiting reactant and the theoretical yield of water?

A: Number of moles = mass/molar mass Molar mass of O2 = 31.999 g/mol Molar mass of H2 = 2.0159 g/mol…

Q: the theoretical yield of water

A: Number of moles = mass/molar mass Mass of H2O = number of moles of water × molar mass of water

Q: For the following reaction, 0.162 moles of carbon (graphite) are mixed with 0.501 moles of oxygen…

A: Given :- Number of moles of C = 0.162 mol Number of moles of O2 = 0.501 mol To be determined :…

Q: . what is the percent yield?

A: given :- number of moles of N2 = 0.68 mol actual yield (in terms of moles) = 1.00 mol NH3 To…

Q: In a reaction to produce sulfuric acid, the theoretical yield is 300. g. What is the percent yield…

A: Therotical yield of H2SO4 = 300 g Actual yield of H2SO4= 111.4 g

Q: b. If the percentage yield of sodium chloride is 67%, what is the actual yield of sodium chloride?

Q: What is the percent yield of nitrogen gas ?

A: Given :- actual yield of N2 = 2.40 g Mass of NO = 6.70 g To calculate = theoretical yield of N2…

Q: percent yield of carbon dioxide.

Q: How many grams of potassium chloride are produced if 25.0 grams of potassium chlorate decompose?

Q: What information is required to determine how many grams of sulfur would react with a gram of…

A: To find : what information is required to determine how many grams of sulfur would react with a gram…

Q: In a reaction to produce ammonia, the theoretical yield is 420.0 g. What is the percent yield if the…

A: Percent yield of the reaction is equal to the ratio of actual yield and theoretical yield multiplied…

Q: please help find percent yield of the product? given the data

A: Given data :

Q: What is the percent yield of Na?

A: Given :- Actual yield = 26 g Theoretical yield = 46 g To calculate :- percent yield

Q: What is the Actual yield and Percentage yield of calcium hydroxide?

A: Let᾿s take a chemical reaction in which X & Y are combined to generate Calcium hydroxide…

Q: th diatomic oxygen, the iron will form iron (III) oxide known as red ru gen gas, which is the…

Q: If 15.0 g of N2 and 12.5 g of H2 are reacted what mass of NH3 (theoretical yield) is produced?

Q: If 250. grams of sodium azide undergoes decomposition, how many molecules of nitrogen gas are…

A: We have to predict the molecules of nitrogen gas Produced.

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

The Haber process is used to industrially produce ammonia (NH3). Ammonia is the
active ingredient in a variety of household cleaners. The data table below
summarizes the experimental quantities of reactants and products collected from a
specific batch.
N2 (g) + 3 H2 (g) --> 2 NH3 (g)
Substance
Amount Used
N2
10,000 g
H2
15,000 g
Amount
Produced
11,150 g
Substance
NH3
If the company chemist calculated that 12,163 g of NH3 should be produced, what is
the percent yield?

Expert Solution

Step 1

Percent yield = (actual yield/theoritical yield) × 100 %

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What characterizes an electrolytic cell? What is an ampere? When the current applied to an electrolytic cell is multiplied by the time in seconds, what quantity is determined? How is this quantity converted to moles of electrons required? How are moles of electrons required converted to moles of metal plated out? What does plating mean? How do you predict the cathode and the anode half-reactions in an electrolytic cell? Why is the electrolysis of molten salts much easier to predict in terms of what occurs at the anode and cathode than the electrolysis of aqueous dissolved salts? What is overvoltage?
When jump-starting a car with a dead battery, the ground jumper should be attached to a remote part of the engine block. Why?
Gold is produced electrochemically from an aqueous solution of Au(CN)2 containing an excess of CN. Gold metal and oxygen gas are produced at the electrodes. What amount (moles) of O2 will be produced during the production of 1.00 mole of gold?
The hydrocarbon naphthalene was frequently used in mothballs until recently, when it was discovered that human inhalation of naphthalene vapors can lead to hemolytic anemia. Naphthalene is 93.71% carbon by mass, and a 0.256-mole sample of naphthalene has a mass of 32.8 g. What is the molecular formula of naphthalene? This compound works as a pesticide in mothballs by. sublimation of the .solid so that it fumigates enclosed spaces with its vapors according to the equation Naphthalene(s)naphthalene(g)K=4.29106(at298K) If 3.00 g solid naphthalene is placed into an enclosed space with a volume of 5.00 L at 25C, what percentage of the naphthalene will have sublimed once equilibrium bas been established?
In the text, the equation G=G+RTIn(Q) was derived for gaseous reactions where the quantities in Q were expressed in units of pressure. We also can use units of mol/L for the quantities in Q, specifical.ly for aqueous reactions. With this in mind, consider the reaction HF(aq)H+(aq)+F-(aq) for which Ka = 7.2 104 at 25C. Calculate G for the reaction under the following conditions at 25C. a. [HF] = [H+] = [F] = 1.0 M b. [HF] = 0.98 M, [H+] = [F] = 2.7 102M c. [HF] = [H+] = [F] = 1.0 105 M d. [HF] = [F] = 0.27 M, [H+] = 7.2 104M e. [HF] = 0.52 M, [F] = 0.67 M, [H+] = 1.0 103M Based on the calculated G values, in what direction will the reaction shift to reach equilibrium for each of the five sets of conditions?
The following data apply to the unbalanced equation A(g)B(g) (a) On the basis of the data, balance the equation (simplest whole-number coefficients). (b) Has the system reached equilibrium? Explain.
The equilibrium constant for the reaction 2CrO42+2H+Cr2O72+H2O is 4.2 1014. The molar absorptivities for the two principal species in a solution of K2 Cr2 O2 are Four solutions were preparedby dissolving 4.00 10-4, 3.00 10-4, 2.00 10-4,and 1.00 10-4 moles of K2 Cr2 O7 in water and diluting to 1.00 L with a pH 5.60 buffer. Derive theoretical absorbance values (1.00-cm cells) for each solution and plot the data for (a) 345 nm, (b) 370 nm, and (c) 400 nm.
Consider the equation G = -nF. What are the four terms in this equation? Why does a minus sign appear in the equation? What does the superscript o indicate?
Cobalt metal can be prepared by reducing cobalt (II) oxide with carbon monoxide. CoO(s)+CO(g)Co(s)+CO2(g)Kc=4.90102 at 550 C
One of the many remarkable enzymes in the human bodyis carbonic anhydrase, which catalyzes the interconversionof carbon dioxide and water with bicarbonate ionand protons. If it were not for this enzyme, the body couldnot rid itself rapidly enough of the CO2 accumulated bycell metabolism. The enzyme catalyzes the dehydration(release to air) of up to 107 CO2 molecules per second.Which components of this description correspond to theterms enzyme, substrate, and turnover number?
(a) In 20 or less of yourown words define the term “leachate”and describe how it forms. (b) Previous records had shown that to prevent acute toxicity to organisms, the maximum mass of CdSO4 that should be allowed into the landfill was determined to be 0.1 kg. This was calculated using a standard concentration of Cd in mg/L where the volume of the leachate pond was used as 500 000L. (i) Provide the name of the CdSO4 compound. State the oxidation number of Cd in this compound (ii) You need to ensure that the concentration used to determine the mass of Cd allowed in the landfill, meets the current regulatory standard. Assuming that previous calculations determined that all of the CdSO4 would be deposited in the leachate pond, what standard concentration of Cd in mg/L was used to determine the maximum mass of allowable CdSO4?
Automobile air bags inflate by a rapid decomposition reaction. One typical compound used is guanidinium nitrate, C(NH2)3NO3, which decomposes very rapidly to form nitrogen, water vapour and carbon. Another airbag reactant produces nitrogen gas and sodium. Suggest, including an equation, why the products of this reactant present a safety hazard.