How many electron domains are around the central atom in each of the following molecules or ions? Enter your answer as a whole number. Hint: Start by drawing the Lewis structures. BH3: type your answer... NH3: type your answer... CO2: type your answer... SO32: type your answer...
Q: 6. On the ribose molecule to the right: • Number the 5 carbons from 1' to 5', starting with the…
A: Question 6: Ribose MoleculeNumber the 5 carbons from 1' to 5'Ribose, a crucial component of RNA, is…
Q: Can somene help me thanks
A: Step 1:
Q: None
A: Part 1: Concise AnswerBased on the image, here is the completion of the table with the appropriate…
Q: What is the IUPAC name for the following compound? HO H O2-hydroxypropanal O 2-hydroxybutanal O…
A: Step 1: Guidelines for IUPAC nomenclature of organic compounds:Consider the carbon chain with the…
Q: g. h. OH i. HBr [1] NaOCH 3 [2] H₂O NaH
A: Thank you,Please rate my response.
Q: in text form with proper workings and explanation for each and every part and steps with concept and…
A: Step 1:C)n(HCl) = 0.1424 mol / 2 = 0.0712 molThe number of moles of CH3NH2 remaining is:n(CH3NH2) =…
Q: 296 Experiment 36 Qualitative Analysis of Group I Cations 4. You are given an unknown solution that…
A: Given: Group 1 cationsRequired: Flowchart to determine the cation presentSolution:1. Analysis of…
Q: What is the major organic product obtained from the following reaction? O1 ○ 2 ○ 3 O4 Ph Pd(OAc)2…
A: Step 1: Heck ReactionUnsaturated halide reacts with an alkene in the presence of a palladium…
Q: what the factors involve in a change of the values of a pH initial to a different, final pH?
A: The factors that involve a change in pH from an initial to a final value include:1. Addition of…
Q: а A solution is prepared at 25 °C that is initially 0.51M in chloroacetic acid (HCH2CICO₂), a weak…
A: The given values are the initial concentration of chloroacetic acid ([HCH2CICO₂]) which is 0.51 M,…
Q: chloride A solution is prepared at 25 °C that is initially 0.69M in dimethylamine ((CH3)2NH), a weak…
A: First, we need to identify the reaction that is occurring. Dimethylamine ((CH3)2NH) is a weak base,…
Q: Review questions 2: Rank the radicals below by stability (least stable to most stable) CH3 ㅅ IV 0…
A:
Q: 14. For the SN1 reaction below: What is the relationship between A and B? H₂O A+B+ C+D major minor…
A: Analysis of the Given SN1 ReactionLet us analyze the SN1 reaction and the relationships between the…
Q: Give me detailed mechanism Solution with explanation needed. don't give Handwritten answer. don't…
A: Step 1: Acetylene on hydrogenation with Lindlar's catalyst gives ethylene.Ethylene with HBr gives…
Q: The acid dissociation constant K of carbonic acid (H2CO3) is 4.5 × 10¯7. Calculate the pH of a 3.8M…
A: Carbonic acid:H2CO3 + H2O <-< H3O+ + HCO3- Ka = [H3O+][HCO3-]/[H2CO3]initially[H3O+]= 0[HCO3-]…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1:
Q: Identify the major and minor products for the E2 reaction that occus when each of the following…
A: Step 1:The products from the E 2 elimination reactions explained by the geometrical arrangements of…
Q: Solution Preparation Prepare the following solutions by class: 1. 250.0 mL 0.2 M KI 2. 250.0 mL 0.2…
A: To prepare a solution, we first need to calculate the amount of solute needed. The formula to…
Q: Calculate the amount of heat needed to boil 178. g of benzene (C6H6), beginning from a temperature…
A:
Q: Predict the major product of the following reaction. Zn(Hg), HCI heat ? 0 Br O There is no reaction…
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: A Li-ion battery is a type of rechargeable battery in which lithium ions move from the negative…
Q: None
A: To synthesize the target molecule using 1-bromo-2-ethylhexane and any alkyl halide, follow these…
Q: Compound A has the formula C10H16. When treated with hydrogen and palladium, Compound A takes up 1…
A: The degree of unsaturation is C+1−(H/2) whereC = number of carbon atoms H = number of hydrogen…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1:
Q: None
A: Step 1: Step 2: Step 3: Step 4:
Q: 3.3. Which of the following carbocation intermediates will undergo a 1,2-hydride shift rearrangement…
A:
Q: give the structure corresponding to each name
A: The International Union of Pure and Applied Chemistry (IUPAC) has established a system for naming…
Q: Which principle or rule is violated by the following orbital diagram of an atom in its ground state?…
A: Step 1:Aufbau principle The lower energy orbitals fill before higher energy orbitals 1S < 2…
Q: One mole of N2 and 3 moles of H2 are placed in a flask at 397 °C. Calculate the total pressure of…
A: Step 1:Given:One mole of N2 and three moles of H2 are placed in a flask.Mole fraction of NH3 at…
Q: Which principle or rule is violated by the following orbital diagram of an atom in its ground state?
A: Step 1: In this case Hund's rule is violating because According to Hund's rule - "Every orbital in…
Q: Predict the major product of the following reaction. OH PCC ? O There is no reaction under these…
A:
Q: The synthesis above used bromoethane, but acetylene is the only allowed source of carbon atoms.…
A:
Q: What is the maximum mass, in kilograms, of scandium metal that can be made from 1230.2kilograms of…
A: First, we need to determine the mass of Sc2O3 in the thortveitite. Given that the thortveitite is…
Q: How many grams of sulfur tetrafluoride forms if 68.05 g sulfur dichloride reacts with 30.29 g of…
A: Step 1: Step 2: Step 3: Step 4:
Q: The acid dissociation constant K of hypobromous acid (HBrO) is 2.3 × 10¯ 9 Calculate the pH of a…
A:
Q: 5. Discuss and draw the MO diagrams of diatomic homonuclear molecules (N2 and O2) [10]
A: MO diagram of N2The valence orbitals used to create the molecular orbital diagram of N2 are the 2s…
Q: None
A: Asphalt pavers were designed to evenly spread and level the layers of asphalt or concrete. This is…
Q: None
A: Infrared (IR) spectroscopy is a powerful analytical technique used to identify functional groups…
Q: Please show reaekson and don't use hend raiting
A: Step 1:To determine which compound matches the given IR spectrum as well as we need to work the…
Q: Uranium-238 undergoes radioactive decay until a stable isotope is reached. One of the steps is shown…
A: GUIDE: (1) Alpha Decay ZAX→Z−2A−4Y+24αwhere:X = Parent NucleusY = Daughter Nucleusα = alpha…
Q: Determine the pH of a solution that is 0.30 M CH3COOH and 0.50 M CH3COONa. Be sure your answer has…
A: Step 1: GivenpH = ?[CH3COOH] = 0.30 M[CH3COONa] = 0.50 MKa = 1.8 x 10-5 Step 2: Calculation of…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: To rank these chemicals in decreasing order of water acidity, we must consider each compound's…
Q: 6-41 Allylic halides have the structure cccx a. Show how the first-order ionization of an allylic…
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: highest second ionization energy is for lithium (Li)because after losing one electron, it achieves a…
Q: 3. Draw the orbital overlap for the following molecule, using the valence bond theory. The sigma and…
A:
Q: Al(NO3)3(aq) + 3K3PO4(aq) ⟶ AlPO4(s) + 9KNO3(aq) What is the maximum mass of aluminum phosphate that…
A: In this reaction, the limiting reactant is K3PO4 because it is the only reactant with a given…
Q: Please correct answer and don't use hend raiting
A: Step 1:The given data Equilibrium constant ( K) = 7.00 The initial concentration of CoF2 is 2.00 M…
Q: Determine the Ka of an acid whose 0.294 M solution has a pH of 2.80. O 4.3 x 10-4 8.6 x 10-6 O 4.9 x…
A: The problem is asking us to find the Ka (acid dissociation constant) of an acid. We are given the…
Q: Incorrect. How many signals would you expect in the 1H NMR spectrum of the following compound? I…
A: 1. Identify the Compound: - The given compound is 1,3,5-trimethylbenzene (also known as…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: To analyze the Pourbaix diagram for the CuO-H2O system at 1M concentration based on the given…
Show work. Don't use Ai for answering this...
Step by step
Solved in 2 steps with 1 images
- To answer the questions, interpret the following Lewis diagram for NHF2 . 1. For the central nitrogen atom: ... The number of non-bonding electrons = The number of bonding electrons = The total number of electrons = 2. The central nitrogen atom fill in the blank 4 ... A. obeys the octet rule. B. has more than an octet. C. has less than an octet.To answer the questions, interpret the following Lewis diagram for SO42- . 1. For the central sulfur atom: ... The number of non-bonding electrons = The number of bonding electrons = The total number of electrons = 2. The central sulfur atom fill in the blank 4 ... A. obeys the octet rule. B. has more than an octet. C. has less than an octet.To answer the questions, interpret the following Lewis structure for SO42-. For the central sulfur atom: ... The number of lone pairs = The number of single bonds = The number of double bonds = The central sulfur atom: obeys octet rules or expanded octet rules or has incomplete octet rules? 2) To answer the questions, interpret the following Lewis diagram for CO2 .For the central carbon atom: ... The number of lone pairs = The number of single bonds = The number of double bonds = The central carbon atom: obeys octet rules or expanded octet rules or has incomplete octet rules? 3) To answer the questions, interpret the following Lewis structure for BCl3. For the central boron atom: ... The number of lone pairs = The number of single bonds = The number of double bonds = the central boron atom: obeys octet rules or expanded octet rules or has incomplete octet rules?
- Decide whether these proposed Lewis structures are reasonable. proposed Lewis structure Is the proposed Lewis structure reasonable? Yes. .. : Cl: No, it has the wrong number of valence electrons. The correct number is:| : Cl N- Cl: No, it has the right number of valence electrons but doesn't satisfy the octet rule. | The symbols of the problem atoms are:* Yes. No, it has the wrong number of valence electrons. .. :0-C- 0: The correct number is:| No, it has the right number of valence electrons but doesn't satisfy the octet rule. The symbols of the problem atoms are: Yes. O No, it has the wrong number of valence electrons. Cl : The correct number is: No, it has the right number of valence electrons but doesn't satisfy the octet rule. The symbols of the problem atoms are:* * If two or more atoms of the same element don't satisfy the octet rule, just enter the chemical symbol as many times as necessary. For example, if two oxygen atoms don't satisfy the octet rule, enter "O,O". оо O O :0:…Decide whether the Lewis structure proposed for each molecule is reasonable or not. molecule proposed Lewis structure OF 2 BeH₂ PF4 || :O: H - Be H F - P F W ... :F: :F: Is this a reasonable structure? If not, why not? Yes, it's a reasonable structure. O No, the total number of valence electrons is wrong. The correct number is: No, some atoms have the wrong number of electrons around them. The symbols of the problem atoms are: O Yes, it's a reasonable structure. No, the total number of valence electrons is wrong. The correct number is: O No, some atoms have the wrong number of electrons around them. The symbols of the problem atoms are: O Yes, it's a reasonable structure. No, the total number of valence electrons is wrong. The correct number is: No, some atoms have the wrong number of electrons around them. The symbols of the problem atoms are: 0 * If two or more atoms have the wrong number of valence electrons around them, just enter the chemical symbol for the atom as many times as…To answer the questions, interpret the following Lewis diagram for XeO3. :0–Xe–6: I :0: .. 1. For the central xenon atom: The number of non-bonding electrons = The number of bonding electrons The total number of electrons 2. The central xenon atom A. obeys the octet rule. B. has more than an octet. C. has less than an octet. = =
- Use To answer the questions, interpret the following Lewis diagram for BC13. .. :Ci-B-CI: .. .. 1. For the central boron atom: The number of non-bonding electrons = The number of bonding electrons %3D The total number of electrons 2. The central boron atom A. obeys the octet rule B. has less than an octet. C. has more than an octet. Submit Answer Retry Entire Group No more group attempts remainDecide whether the Lewis structure proposed for each molecule is reasonable or not. molecule proposed Lewis structure BF3 SF 3 CO₂ :F: | -B-F: :F- .. | SIF: S-F: || .. :F: 01010 Is this a reasonable structure? If not, why not? OYes, it's a reasonable structure. No, the total number of valence electrons is wrong. The correct number is: O No, some atoms have the wrong number of electrons around them. The symbols of the problem atoms are: Yes, it's a reasonable structure. O No, the total number of valence electrons is wrong. The correct number is: O No, some atoms have the wrong number of electrons around them. The symbols of the problem atoms are: 0 Yes, it's a reasonable structure. No, the total number of valence electrons is wrong. The correct number is: No, some atoms have the wrong number of electrons around them. The symbols of the problem atoms are: * If two or more atoms have the wrong number of valence electrons around them, just enter the chemical symbol for the atom as many…Recognising exceptions to the octet rule.
- Recognising exceptions to the octet rule.Could someone help me?? The answer to this question must look similar to the example attached. Back ground info: Atoms of different elements combine with one another to form compounds. It is important to be able to explain how atoms actually come together to form these compounds or chemical bonds. One of the three types of bonds is an ionic bond which is a bond between a metal atom and a nonmetal atom, or a cation and an anion. The Octet Rule is the driving force behind ionic bond formation. The octet rule refers to the tendency of atoms to prefer to have eight electrons in the valence shell. When atoms have fewer than eight electrons, they tend to react and form more stable compounds. When discussing the octet rule, we do not consider d or f electrons. Only the s and p electrons are involved in the octet rule, making it useful for the main group elements (elements not in the transition metal or inner-transition metal blocks); an octet in these atoms corresponds to an electron…proposed Lewis structure Is the proposed Lewis structure reasonable? Yes. No, it has the wrong number of valence electrons. .. The correct number is: H= Br No, it has the right number of valence electrons but doesn't satisfy the octet rule. The symbols of the problem atoms are:* O Yes. :0: O No, it has the wrong number of valence electrons. The correct number is: : Cl C- Cl: No, it has the right number of valence electrons but doesn't satisfy the octet rule. The symbols of the problem atoms are:* Yes. O No, it has the wrong number of valence electrons. .. :0-C- The correct number is:|| No, it has the right number of valence electrons but doesn't satisfy the octet rule. The symbols of the problem atoms are:* * If two or more atoms of the same element don't satisfy the octet rule, just enter the chemical symbol as many times as necessary. For example, if two oxygen atoms don't satisfy the octet rule, enter "0,0". :C: