How does a Li - air battery differ from an Li-ion battery? Why does this difference matter for transportation applications but less so for utility applications?

Q: Draw the least stable resonance form for the intermediate in the following electrophilic…

A:

Q: Please provide detailed solution and give the explanation of the correct and incorrect options....…

A: Step 1: Step 2:

Q: Please correct answer and don't use hend raiting

A: The given reaction involves treating the alcohol with HBr, which will result in the formation of an…

Q: Balance the molecular equation for aqueous lead(II) nitrate reacts with aqueous sodium sulfate to…

A: The unbalanced equation is given as: Pb(NO3)2 + Na2SO4 ⟶ NaNO3 + PbSO4

Q: Provide the IUPAC name for the following compound: CH3CH2CH2CH2CH(CH3)CH2CH2CH(CH2CH3)2

A: Step 1:Long chain has 10 carbons So called dec   Step 2: Step 3: Step 4:

Q: What is the nuclear binding energy of a helium nucleus in KILOJOULES? A. 4.5 x 10 9 kJ B. 6.3 x 10…

A: To determine the nuclear binding energy of a helium nucleus (also known as an alpha particle), we…

Q: Practice 9: What is the hydronium ion concentration in a 0.100-M solution of ammonium nitrate,…

A: Step 1:NH4NO4 is a salt formed from a strong acid ( HNO3) and a weak acid ( NH3) . This salt…

Q: None

A: We need to convert "mol / kg.m2" into "mol / g.cm2" First let us convert the kg to g1 kilogram (kg)…

Q: Determine the Ka of an acid whose 0.294 M solution has a pH of 2.80. ○ 5.4 x 10-2 ○ 4.9 x 10-7 8.6 x…

A: The problem is asking us to find the Ka, or acid dissociation constant, of an acid. The Ka is a…

Q: Chemistry

A: Step 1: Step 2:

Q: Macmillan Learning Draw the major organic product of the reaction. Show the stereochemistry, if…

A: Your answer: Thank you

Q: A neutral solution at 25⁰C has a [H 3O +] = 1.0 x 10-7M. Which hydronium ion concentration…

A: The pH scale is a measure of the acidity or basicity of a solution. It is defined as the negative…

Q: ☐ 5:41 PM Sat Jun 29 kennesaw.view.usg.edu Name: Lab Section (Day & Time): 3361L Molecular Modeling…

A: The properties of a molecule may be due to its shape in space. Molecules can have various…

Q: Describe the structure, bonding, and properties of this organic functional group. What is the…

A: The structure shown in the image is 2-Methyl-2-hexene, which is an alkene with the chemical formula…

Q: Give detailed mechanism Solution with explanation needed. don't give Handwritten answer

A: E2 elimination is a bimolecular, single-step elimination reaction. The leaving group leaving and the…

Q: name of this reaction? [8] 2) Propose a detailed mechanism for the following transformation? What is…

A: Intra molecular aldol condensation: First the base abstracts proton and the enolate then attacks on…

Q: Please correct answer and don't use hend raiting

A: Given coompound:The compund is named as follows: 1) We select the longest carbon chainThe longest…

Q: Draw the first step in the mechanism for the acid-catalyzed addition of HCI to the alkene in the…

A: Step 1:In the step 1 , the alkene pi bond protonated by the HCl at the more substituted carbon,…

Q: Please provide detailed solution and give the explanation of the correct and incorrect options....…

A: Step 1:  Step 2:

Q: Solid barium hydroxide is dissolved in pure water, increasing the pH of the solution to 8.61. What…

A:

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Given :Initial pressure = 0.908 atmInitial temperature = 26.5°CInitial volume = 16.2 LFinal…

Q: Practice 8: What is the Ka of a weak acid if a 0.100 M solution has a pH of 4.25?

A: Thank you.

Q: What is the maximum mass, in kilograms, of scandium metal that can be made from 1230.2kilograms of…

A: First, we need to determine the mass of Sc2O3 in the thortveitite. Given that the thortveitite is…

Q: Help

A: Two isomeric carboxylic acids:Two isomeric esters:A ketone and a primary alcohol:An aldehyde and a…

Q: What is the major product of the following reaction? Br OEt Multiple Choice I III EtOH || OEt OEt IV…

A: Let's analyze the reaction and the given options: The response that is displayed is that the result…

Q: Please provide detailed solution and give the explanation of the correct and incorrect option

A: Thank you,Please rate my response.

Q: Combustion of hydrocarbons such as butane (C4H10) produces carbon dioxide, a "greenhouse gas."…

A: Please see the attached images for the solution.If there are queries or if the images are not…

Q: 4. Predict the major organic product for each of the following reactions. Be sure to include…

A: a. b. c.

Q: Check In: A solution of methylamine (CH3NH) has a pH of 10.8, what is the hydroxide ion…

A: Step 1:pH of the solution is 10.8 The relationship between pH and pOH is pH+pOH = 14 pOH= 14-pHfrom…

Q: None

A: EXPLANATION :Part 1 : Find expression of rate constant , rFirst of all in step one we have formed…

Q: OI O IV 3 What is the major organic product obtained from the following reaction? (Remember whether…

A: Step 1:

Q: 5. Do you think the toluene/water combination would be a good binary solvent system for a mixed…

A: In some cases where a single solvent does not exhibit good recrystallization behavior, a mixed…

Q: Please provide detailed solution and give the explanation of the concept... What masses of…

A: To prepare a buffer solution with a specific pH, use the Henderson-Hasselbalch equation, which…

Q: None

A:

Q: in text form with proper workings and explanation for each and every part and steps with concept and…

A: To approach the multistep retrosynthetic analysis of the target molecule shown in the image, we will…

Q: None

A: Step 1: Step 2: Step 3: Step 4:

Q: A syringe contains 0.388 moles of He gas that occupy 750.0 mL. What volume (in L, 3 significant…

A: Step 1:Step 2:

Q: Please don't use hend raiting and step by step solutions

A: Step 1: Regardless of the number of steps required to achieve the reaction, the change in enthalpy…

Q: What is the product of the following reaction? Sanlimanem O Na Na+ Ова A) 1 ole of allo IV B) II C)…

A: Step 1:Step 1 Attack of nucleophile on the carbonyl carbon to form tetrahedral intermediate   Step…

Q: Please correct answer and don't use hend raiting

A: Let's follow the strategy given. Step 1: Convert kg of calcium carbide (CaC2) to grams and then to…

Q: Electromagnetic waves consist of: a) Electric fields only b) Magnetic fields only c) Both electric…

A: (c) Both electric and magnetic fieldsElectromagnetic waves are a disturbance that propagates through…

Q: Questions THE CHARACTERIZATION OF CARBOHYDRATES 1. Indicate whether the following carbohydrates are…

A: Answer:Benedict's Test: This test is used to identify reducing sugars. Reducing sugars are those…

Q: What is the name of Hmc040 -1. jpgSOmc040-2.jpg?

A: 1. Extracted TextThe text extracted from the image using OCR (Optical Character Recognition) is:…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Step 1:Step 2:Step 3:Step 4:

Q: Curved arrows are used to illustrate the flow of electrons. Use the reaction conditions provided and…

A: Step 1: For the first box, before the addition of thionyl chloride, there is only carboxylic acid.…

Q: Question 13 4 pts Following the curved arrows, draw the contributing resonance structure on a piece…

A: Step 1:Therefore, the answers are:The formal charge on the oxygen between H and N is +2. Step 2:The…

Q: 9. Complete the following reactions by filling in the blanks with the appropriate organic or…

A: Part a)   (CH3​CH2​CH2​CH2​)2​CuLi + CH3​CH2​CH2​I  → CH3​CH2​CH2​CH2​CH2​CH2​CH3​ + CuI This is a…

Q: 8.Naphthalene , acetanilide , benzoin , or biphenyl  Which of the above four compounds would be…

A: Step 1: Polar compounds are soluble in polar compounds while non Polar compounds are soluble in non…

Q: 1. (a) Explain the following: (i) iR drop (ii) an ideally polarisable electrode (iii) reference…

A: Step 1: Explanation of each term : 1. iR drop:Definition: The iR drop (also known as the ohmic drop)…

Q: Chilean niter deposits are mostly sodium nitrate, but they also contain 0.3%iodine in the form of…

A: from I2 calculate mass of NaIO3 Step 2:then calculate mass of Chilean niter  Step 3: Step 4: