Given the equation 3A + B→ C + D, you react 2 moles of A with 1 mole of B. Which of the following is true? Select one: a. A is the limiting reactant because you need 3 moles of A and have 2. b. Neither reactant is limiting. C. B is the limiting reactant because you have fewer moles of B than A. d. B is the limiting reactant because 3 A molecules react with 1 B molecule. e. A is the limiting reactant because of its higher molar mass.

Given the equation 3A + B→ C + D, you react 2 moles of A with 1 mole of B. Which of the following is true? Select one: a. A is the limiting reactant because you need 3 moles of A and have 2. b. Neither reactant is limiting. C. B is the limiting reactant because you have fewer moles of B than A. d. B is the limiting reactant because 3 A molecules react with 1 B molecule. e. A is the limiting reactant because of its higher molar mass.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Consider the following reaction: Solid calcium oxide reacts with carbon dioxide gas to form solid calcium carbonate. A chemist allows 14.4g of calcium oxide and 13.8g of carbon dioxide to react. When the reaction is finished, the chemist collects 19.4g of calcium carbonate. Determine the limiting reagent, theoretical yield, and percent yield.
ded for this question. When iron(III) oxide reacts with aluminum, aluminum oxide and iron are produced. The balanced equation for this reaction is: Fe2O3 (8)+2Al(s) → Al2O3 (8) + 2Fe(8) If 4 moles of aluminum react, The reaction consumes The reaction produces moles of iron(III) oxide. moles of aluminum oxide and moles of iron.
1. A mixture of hydrazine (N2H4) and hydrogen peroxide (producing nitrogen and water) is used as a fuel for rocket engines. A. Write the valid chemical equation. B. What mass of N2H4, in grams, is needed to react completely with 35.0 g of H2O2? When, H= 1.01g. O=16.00g. N=14.01g.
Consider the generic chemical equation: 2 A + 4 B = 3 C What is the limiting reactant when each of the initial quantities of A and B are allowed to react? 1.) 2 mol A; 5 mol B 2.) 3 mol A; 4 mol B
29. Consider the following balanced equation: 2N₂O5 ‒‒‒‒‒‒‒> 4NO₂ How many moles of N₂0s are required to produce 62.7 g of NO₂ ? b. 2.73 mol e. 0.681 mol a. 73.6 mol d. 0.00631 mol + O₂ C. 1.36 mol
How many grams of N2 are needed to completely (stoichiometrically) react with 222 g of Br2 ? N2 + 3 Br2 2 NB13 + 44.0 kJ The molar mass of Br2 is g and the molar mass of N2 is mol Br2 (2.22 x 102 g Br2)(- mol Br2 g Br2 mol N2 mol Br2 (-- -) = mol N2 mol Br2 g N2 mol N2 (-- -) = |v g N2 mol N2 а. 1 b. 2 С. 3 d. 4 е. 5 f. 253.719 g. 3.38 х 100 h. 3.26 x 103 i. 44.0 j. 1.33 x 102 k. 9.77 x 103 I. 4.44 x 102 m. 6.66 x 10² n. 500.0 o. 556 р. 90.0 q. 3.2852 r. 159.81 s. 28.013 t. 1.750 u. 0.8750 v. 13.0 w. 0.46306 х. 1.3892 у. 24.5 z. 38.5 аа. 2.190 bb. evolved Cc. absorbed dd. exothermic ee. endothermic
Consider the generic chemical equation: 2 A + 4 B --------> 3 C 1. If 10.0 moles of each reactant were used to complete that reaction, which of the following is true. a. A is the limiting reactant and 15.0 moles of C will be produced. b. A is the limiting reactant and 20.0 moles of C will be produced. c. B is the limiting reactant and 7.50 moles of C will be produced. d. B is the limiting reactant and 22.5 moles of C will be produced. 2. What is the percent yield of this reaction if 6.40 moles of C were actually produced?
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
61. Consider the reaction between calcium oxide and carbon dioxide: CaO(s) + CO2(g) →→ CaCO3(s) A chemist allows 14.4 g of CaO and 13.8 g of CO₂ to react. When the reaction is finished, the chemist collects 19.4 g of CaCO3. Determine the limiting reactant, theoretical yield, and percent yield for the reaction.
10.Which of the following statements is TRUE for the chemical equation given below in which nitrogen gas reacts with hydrogen gas to form ammonia gas assuming the reaction goes to completion? N2 + H2 NH3 A. The reaction of three moles of hydrogen gas will produce 34 g of ammonia. B. One mole of N2 will produce one moles of NH3. C. One mole of nitrogen produces 6.02 x 1023 molecules of ammonia. D. The reaction of one mole of H2 will produce 1/2 moles of NH3.
Sodium and chlorine react to form sodium chloride: What is the theoretical yield of sodium chloride for the reaction of 32.0 g Na with 107.2 g Cl2? A. 1.40 x 104 g NaCl B. 35.4 g NaCl C. 122 g NaCl D. 81.2 g NaCl
4. C3H8 +O2 _CO2 +_H20 a. Balance the reaction b. What is the reaction type? c. What is the theoretical volume (L) of carbon dioxide produced from the reaction of 20.3L of propane? d. If 58.2L of CO2 is actually produced, what is the percent yield? e. What is the percent error?