Consider the following dissolution of lead(II) chloride(PbCl2(s)):PbCl2(s)Pb2*(aq) + 2 Cr(aq)Below is a table of thermodynamic quantities pertainingto this reaction:SubstanceA;H° (kJ mol-1) s° (J K-1 mol-1)PBCI2(s)-359.4136.0Pb2*(aq)0.918.5CI(aq)-167.156.6 Given that A,G° = 27.5 kJ mol-1, at 42 °C, calculate the equilibrium constant K at this temperature.3.6x104O 7.1×10-35O 0.99O 2.8×10-5

Answered: Image /qna-images/answer/b45ddc29-eb9e-4179-bb38-bcbaca0e4bcc.jpg

Answered: Given that A,G° = 27.5 kJ mol-1, at 42…

Given that A,G° = 27.5 kJ mol-1, at 42 °C, calculate the equilibrium constant K at this temperature. 3.6x104 O 7.1×10-35 O 0.99 2.8×10-5

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

A mixture of 1.00 Atm of NO, 0.50 Atm of H2, and 1.00 Atm of N2 was allowed to reach equilibrium according to the reaction given below (initially there was no H2O). At equilibrium, the partial pressure of NO was found to be 0.62 Atm. Determine the value of the equilibrium constant, Kp, for the reaction: 2NO(g) + 2H2(g) ⇄ N2(g) + 2H2O(g)
Using any data you can find in the ALEKS Data resource, calculate the equilibrium constant k at 25.0 °C for the following reaction. TiC14(g) + 2 H₂O(g) TiO₂ (s) + 4 HC1 (g) Round your answer to 2 significant digits. K = 0 0 X
Choose the letter of the correct answer. N204 (g) = (reversible to) 2NO2 (g), K = 4.63 x 10-3 I. the given is equation is an example of homogenous equilibrium II. Equilibrium will lie to the right Which statement(s) is/are correct?
Consider the following equilibrium process at 686. °℃: CO₂(g) + H₂(g) CO(g) + H₂O(g) The equilibrium concentrations of the reacting species are [CO]=0.0560 M, [H₂] = 0.0400 M, [CO₂]=0.0830 M, and [H₂O]=0.0430 M. Part 1 of 5 Calculate K for the reaction at 686. °C. Round your answer to 3 significant digits. с Kc- Part 2 of 5 x10 If we add CO₂ to increase its concentration to 0.510 M, what will the concentrations of all the gases be when equilibrium is reestablished? Round your answer to 3 significant digits. [CO₂] = M x10 X Ś
At 1000 K, a sample of pure NO₂ gas decomposes: 2 2NO₂(g) = 2NO(g) + O₂(g) The equilibrium constant Kp, is 158. Analysis shows that the partial pressure of O₂ is 0.41 atm at equilibrium. Part 1 of 2 What is the pressure of NO? Be sure your answer has the correct number of significant digits. Part 2 of 2 atm x10 atm X What is the pressure of NO₂? Be sure your answer has the correct number of significant digits. Ś x10
If Q is greater than K, the system will shift to the right to attain equilibrium. true or false?
Consider the following equilibrium: 2NOC1 (g) → 2NO(g) + Cl₂ (g) AG = 41. kJ Now suppose a reaction vessel is filled with 8.30 atm of nitrosyl chloride (NOC1) and 5.80 atm of chlorine (C1₂) at 878. °C. Answer the following questions about this system: Under these conditions, will the pressure of Cl₂ tend to rise or fall? Is it possible to reverse this tendency by adding NO? In other words, if you said the pressure of Cl₂ will tend to rise, can that be changed to a tendency to fall by adding NO? Similarly, if you said the pressure of Cl₂ will tend to fall, can that be changed to a tendency to rise by adding NO? If you said the tendency can be reversed in the second question, calculate the minimum pressure of NO needed to reverse it. Round your answer to 2 significant digits. оо rise fall yes no 0 atm x10 X Ś
In a particular experiment 1.0 mole of H2O (g) and 1.0 mole of CO (g) are put into a flask and heated to 350 oC. In another experiment 1.0 mol of H2 (g) and 1.0 mole of CO2 (g) are put into a different flask with the same volume as the first. This mixture is also heated to 350 oC. After equilibrium is reached, will there be any difference in the composition of the mixture in the two flasks?
Consider the reactions and their respective equilbrium constants: NO(g) + 1/2BR(g) > NOBR(g) KP = 5.3 2NO(g) > N2(g) + O2(g) KP = 2.1 x 1030 Use these reactions and their equilbrium constants to predict the equlibrium constant for the following reaction: N2(g) + O2(g) + Br2(g) > 2NOBR(g)
Consider the following equilibrium: N,0, (g) = 2NO, (3) AG' = 5.4 kJ Now suppose a reaction vessel is filled with 0.496 atm of nitrogen dioxide (NO,) at 137. °C. Answer the following questions about this system: O rise Under these conditions, will the pressure of NO, tend to rise or fall? O fall Is it possible to reverse this tendency by adding N,O,? In other words, if you said the pressure of NO, will tend to rise, can that O yes be changed to a tendency to fall by adding N,04? Similarly, if you said O no the pressure of NO, will tend to fall, can that be changed to a tendency to rise by adding N,0,? If you said the tendency can be reversed in the second question, calculate the minimum pressure of N,0, needed to reverse it. O atm Round your answer to 2 significant digits.
Consider the following equilibrium: 2NH3(g) = N₂ (g) + 3H₂(g) 2 AG = 34. kJ Now suppose a reaction vessel is filled with 7.87 atm of ammonia (NH3) and 1.17 atm of hydrogen (H₂) at 448. °C. Answer the following questions about this system: Under these conditions, will the pressure of NH3 tend to rise or fall? Is it possible to reverse this tendency by adding N₂? In other words, if you said the pressure of NH3 will tend to rise, can that be changed to a tendency to fall by adding N₂? Similarly, if you said the pressure of NH3 will tend to fall, can that be changed to a tendency to rise by adding N₂? If you said the tendency can be reversed in the second question, calculate the minimum pressure of N₂ needed to reverse it. Round your answer to 2 significant digits. rise fall yes no atm x10 X 5
demonstrate an understanding of the concept of dynamic equilibrium and the variables that cause shifts in the equilibrium of chemical systems.