Gaseous methane (CH4) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H,O). If 26.8 g of carbon dioxide is produced from the reaction of 12.2 g of methane and 65.2 g of oxygen gas, calculate the percent yield of carbon dioxide. Round your answer to 3 significant figures.

Gaseous methane (CH4) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H,O). If 26.8 g of carbon dioxide is produced from the reaction of 12.2 g of methane and 65.2 g of oxygen gas, calculate the percent yield of carbon dioxide. Round your answer to 3 significant figures.

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 49A

See similar textbooks

Similar questions

Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
The principal constituent of natural gas is methane, which burns in air according to the reaction CH4+2O2CO2+2H2O How many grams of O2 are needed to produce 3.50 g of CO2?
Ammonia can be formed by a direct reaction of nitrogen and hydrogen. N2(g) + 3 H2(g) 2 NH3(g) A tiny portion of the starting mixture is represented by the diagram, where the blue circles represent N and the white circles represent H. Which of these represents the product mixture? For the reaction of the given sample, which of these statements is true? (a) N2 is the limiting reactant. (b) H2 is the limiting reactant. (c) NH, is the limiting reactant. (d) No reactant is limiting: they are present in the correct stoichiometric ratio.
You react nitrogen and hydrogen in a container to produce ammonia, NH3(g). The following figure depicts the contents of the container after the reaction is complete. a Write a balanced chemical equation for the reaction. b What is the limiting reactant? c How many molecules of the limiting reactant would you need to add to the container in order to have a complete reaction (convert all reactants to products)?
Propane, C3H8, is the fuel of choice in a gas barbecue. When burning, the balanced equation is C3H8+5O23CO2+4H2O a What is the limiting reactant in cooking with a gas grill? b If the grill will not light and you know that you have an ample flow of propane to the burner, what is the limiting reactant? c When using a gas grill you can sometimes turn the gas up to the point at which the flame becomes yellow and smokey. In terms of the chemical reaction, what is happening?
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
Consider the following balanced chemical equation: A+5B3C+4D a. Equal masses of A and B are reacted. Complete each of the following with either A is the limiting reactant because ; B is the limiting reactant because ____ ; or we cannot determine the limiting reactant because _____ i. If the molar mass of A is greater than the molar mass of B, then ii. If the molar mass of B is greater than the molar mass of A, then b. The products of the reaction are carbon dioxide (C) and water (D). Compound A has a similar molar mass to carbon dioxide. Compound B is a diatomic molecule. Identify compound B, and support your answer. c. Compound A is a hydrocarbon that is 81.7 1% carbon by mass. Determine its empirical and molecular formulas.
Write the balanced chemical equation for the complete combustion of heptene, C7H14. In combustion, hcpLcnc reacts with oxygen to produce carbon dioxide and water. What is the mole ratio that would enable you to calculate the number of moles of oxygen needed to react exactly with a given number of moles of heptene? What mole ratios would you use to calculate how many moles of each product form from a given number of moles of heptene?