Gaseous methane (CH₂) will react with gaseous oxygen (0.) to produce gaseous carbon dioxide (CO) and gaseous water (H₂O). Suppose 9.1 g of methane is mixed with 21.2 g of oxygen, Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 3 significant digits

Gaseous methane (CH₂) will react with gaseous oxygen (0.) to produce gaseous carbon dioxide (CO) and gaseous water (H₂O). Suppose 9.1 g of methane is mixed with 21.2 g of oxygen, Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 3 significant digits

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter1: The Nature Of Chemistry

Section: Chapter Questions

Problem 123QRT: The element magnesium reacts with the element oxygen to form a white solid compound, magnesium...

See similar textbooks

Similar questions

Magnesium ribbon reacts with acid to produce hydro- gen gas and magnesium ions. Different masses of magnesium ribbon are added to 10 mL of the acid. The volume of the hydrogen gas obtained is a measure of the number of moles of hydrogen produced by the reaction. Various measurements are given in the table below. (a) Draw a graph of the results by plotting the mass of Mg versus the volume of the hydrogen gas. (b) What is the limiting reactant in experiment 1? (c) What is the limiting reactant in experiment 3? (d) What is the limiting reactant in experiment 6? (e) Which experiment uses stoichiometric amounts of each reactant? (f) What volume of gas would be obtained if 0.300 g of Mg ribbon were used? If 0.010 g were used?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
3.83 For the reaction of nitrogen, N2, and hydrogen, H2, to form ammonia, NH3, a student is attempting to draw a particulate diagram, as shown below. Did the student draw a correct representation of the reaction? If not, what was the error the student made?
3.68 Magnesium is lighter than other structural metals, so it is increasingly important in the design of more efficient vehicles. Mg2+ ions are present in seawater, and the metal is often prepared by "harvesting" these ions and converting them to Mg metal. The average magnesium content of the oceans is about 1270 g Mg2+ per ton of seawater, and the density of seawater is about 1.03 g/mL. What is the molarity of Mg2+ ions in seawater? The design for a concept car calls for 103 kg of magnesium per vehicle. How many gallons of seawater would be required to supply enough magnesium to build one of these ears?
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
hat do the coefficients of a balanced chemical equation tell us about the proportions in which atoms and molecules react on an individual (microscopic) basis?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
What mass of solid NaOH (97.0% NaOH by mass) is required to prepare 1.00 L of a 10.0% solution of NaOH by mass? The density of the 10.0% solution is 1.109 g/mL.
Tin metal (Sn) and purple iodine (I2) combine to form orange, solid tin iodide with an unknown formula. Sn metal + solid I2 solid SnxIy Weighed quantities of Sn and I2 are combined, where the quantity of Sn is more than is needed to react with all of the iodine. After SnxIy has been formed, it is isolated by filtration. The mass of excess tin is also determined. The following data were collected: Mass of tin (Sn) in the original mixture 1.056 g Mass of iodine (I2) in the original mixture 1.047 g Mass of tin (Sn) recovered after reaction 0.601 g What is the empirical formula of the tin iodide obtained?