Answered: For which reaction in each set will AS°…

For which reaction in each set will AS° be more significant? For which reaction will AS be positive? 1. A B or A + B C 2. A B +C or A+ B C+ D

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Kp will be equal to Kc if Select one: a. Δn = 1 b. Δn = 0 c. RT = 0 d. Δn = -1

A: Answer: option b. ∆n = 0 Relationship between Kp and Kc

Q: 2- A reaction has a positive entropy and enthalpy. What can be inferred about the progress of this…

A: According to the second law of thermodynamics, the spontaneous nature of the reaction is determined…

Q: A reaction where DH is positive, and DS is positive will occur only at high temperatures True False

A: A reaction is spontaneous means it will occur if ∆G<0

Q: For a particular reaction, AH = -28.4 kJ and AS = -87.9 J/K. Assuming these values change very…

A: Here is your answer.......

Q: a. b. CH3 + CH 3* C. (CH3)2C(OH)2 d. CH3COOCH3 + H₂O CH3CH3 (CH3)2C=O + H₂O CH3COOH + CH3OH

A: refers to the standard entropy change of a chemical reaction or a physical process under standard…

Q: 1) For which one of the following reactions is AH° predicted to be positive? a. CaCO3(s) →→→…

A: Answer:- This question is answered by using the simple concept of determination of enthalpy change…

Q: QUESTION 4 Determine AH° for the decomposition of hydrogen peroxide. H 20 2(0) →0 2(g) + H 20(1) H…

A: We have given different reactions and we have to find hear of decomposition.

Q: 1. Calculate Eo, E and ∆Gfor the ff rxns: a.) Mg(s) + Sn2+ Mg2+(aq) + Sn(s) [Mg2+] = 0.045M,…

Q: Calculate AH-AU C(s) + 1/2 O₂ (g) ----> CO (g) A) 1.24 kJ/mol B -2.48 kJ/mol C D E -3.72 kJ/mol…

Q: b) Ме. Me Me Me Me Me. Me

A: Here we have synthesize the given compound from the starting material 5-methylcyclohex-2-en-1-one by…

Q: 9. For the reaction shown here, describe how the entropy changes from 1 to 2 to 3 to 4. The change…

A: Entropy is used to define randomness. Randomness increases entropy increases. Number of molecules…

Q: In a reaction in which reactant A is in equilibrium with product B at 25 °C, what relative amounts…

A: Given reaction is, Relative amount of amounts of A and B are present at equilibrium is known as…

Q: 1. a) True or False? For a reaction at equilibrium, the value of AG is 0, which means that the…

A: The value of ∆G determines the extent of reaction.

Q: Consider the reaction of tin(IV) oxide with carbon. SnO2 (s) + C(s) → Sn(s) + CO2(g) A;H° (kJ/mol)…

Q: For the reaction below, predict if the entropy increases, decreases or does not change in the course…

A: Entropy is a measure of the randomness of the system. The entropy change in a chemical reaction can…

Q: Calculate AS° at 298 K for the reaction below. OF2(g) + H20(9) → 02(9) + 2HF(g) AG°= -358.4 kJ/mol…

Q: A reaction is carried out at 25 °C with AHO = 20 kcal/mol and AS° = 25 cal/K-mol. (R: 8.314 J/K-mol…

A: Answer: This is the question based on the second law of thermodynamics.

Q: For the reaction in which reactant A is converted to product B, tell whether this process is…

A: According to the Gibbs-Helmholtz equation:Here, = the change in Gibbs free energy = enthalpy change…

Q: 24) Consider the following free energy curve for the reaction: A=B Pure A Pure B extent of reaction…

A: 24) The considered reaction is, The reaction seems to proceed initially with pure substance A, that…

Q: C. A +B e. a. d. C+D Progress of the Reaction 55) Which of the following terms best describes the…

A: We are to discuss what type of reaction is taking place in the given graph.

Q: If ∆H > 0 and ∆S < 0, a reaction will be: a.) spontaneous b.) nonspontaneous c.) at equilibrium…

Q: When 1.00g of magnesium metal is burned to give magnesium oxide, 5.92 kj of heat are set free.…

A: Given that 1.0 g magnesium was burned to give magnesium oxide. Number of moles can be calculated…

Q: H2(g) + I2(g) --> 2HI (g) H2: deltaH = 0 kJ/mol; S = 131 J/molK I2: deltaH = 0 kJ/mol; S = 118…

Q: Which of the energy diagrams shown are associated with spontaneous reactions?

A: Given : energy diagrams Tip : for spontaneous reaction energy of product must be less than…

Q: Calculate the ∆0H when 1 mole of methyl alcohol,CH3OH reacts with O2 and the product of reactions is…

A: Balanced equation is : 2CH3OH + 3O2 = 2CO2 + 4H2O

Q: Calculate the ∆?° at 298K of the following reaction, H2(g) + F2(g) ----> 2HF(g). Given that our ∆H°…

Q: b. Thermodynamics Circle the correct choice or fill in the blanks in each of the following: f. Which…

A: All the given problems are related to the chemical thermodynamics. Entropy is a measure of…

Q: Which of the following combinations of ΔH and ΔS values could lead to a spontaneous reaction?…

A: A chemical reaction is said to be spontaneous when the value of ∆G is less than ZERO.…

Q: Find DH°, for the reaction rxn 2Na(s) + 2H2O(1) ® 2NaOH(aq) + 2H2(g). (DH°F (NAOH(aq)) = –426.8…

Q: Explain why each of the following statements is incorrect. a. Entropy increases in all spontaneous…

A: Since you have posted a question with multiple sub parts, we will solve first three sub parts for…

Q: Explain why each of the following statements is incorrect. a. Entropy increases in all spontaneous…

A: Given that : We have to identify which of the above given statements are correct for each.

Q: Predict DS for the reaction below at 125 degrees Celsius C2H5OH(g)+3O2(g)=2CO2+3H2O(g) A.negative…

A: The reaction given is C2H5OH (g) + 3 O2 (g) ------> 2 CO2 (g) + 3 H2O (g)

Q: Determine AS° for the reaction: Sº (J/K-mol) 256.2 SO3 H₂O 69.9 H₂SO4 156.9 1343.2 J/K-mol -29.4…

A: The objective of the question is to calculate the change in entropy (ΔS°) for the given reaction.…

Q: 5. Which of the following are factors that determine whether a reaction is spontaneous or…

A: Any process is called spontaneous if there is not any output force is applied during the process or…

Q: 3. A reaction has a standard free energy change (G⁰) of -21.6 kJ/mol at 25 ⁰C. a. Is this reaction…

A: Given , The reaction has a standard free energy change (ΔG⁰) of -21.6 kJ/mol at 25 ⁰C. We have to…

Q: 9. What is favored more in this reversible reaction, the reactants or products? Explain. OH Lo…

Q: answer choice) : always, at low pressure, at low temperature, never, at high pressure a. When ΔH…

A: All the details are explained in handwritten solution.

Q: Select the circumstances under which a reaction would most likely be spontaneous. a. delta H is…

A: Select the circumstances under which a reaction would most likely be spontaneous.

Q: Can someone draw a energy diagram with the following: Overall reaction is non-spontaneous, it’s 2…

A: The energy profile diagram is given below

Q: at 25 ̊C , calculate the ΔG ̊sys for: N2 + 3H2 → 2NH3 ΔG ̊f N2(g) = 0 kJ/mol ΔG ̊f H2(g) = 0…

A: The free energy change for the reaction is the difference between the sum of the free energies of…

Q: P12. If Keq for a reaction at 450 C was 3.4x10°, what would be the standard free energy change at…

Q: ∆Gº for the reaction, 2HBr(g)⇄ H2(g)+Br2(g), is 33.3 kJ. Which statement below is true? This…

Q: True or false: ∆S for the reaction below is 4 NO2 (gas) + O2 (gas)

A: Given :- 2 N2O5 (solid) --> 4 NO2 (gas) + O2 (gas) ∆S for the above reaction is less than zero…

Q: Which of the following statements are true? ∆G tells you nothing about the rate of the reaction. If…

A: Answer; Both b and c. Because, b) ∆Gf° <0 means that the formation of a compound from its…

Q: Calculate AS°sys for the below chemical reaction using the provided AS° values. CacO3 (s, calcite) +…

A: Consider the given balanced equation is as follows; CaCO3 s, calcite + 2 HCl g → CaCl2 s +…

Q: 17. Using the data below, calculate AHg (at 298K) in KJ/mol for the reaction below: SBra(g) → S) + 2…

A: At a given temperature T, ∆G = ∆H - T∆S∆G = Change in Gibbs free energy∆H = Change in…

Q: For which of the following reactions is ΔS° a positive value?

Q: estion 11 A free energy diagram for a generic reaction, reactants products, shown below. On the…

Q: Of the following, the entropy of __________ is the largest. Group of answer choices HCl (s) HCl (l)…

A: Order of entropy of the given components

Q: Which one of the following reactions has AS°, < 0? rxn O A. Formation reaction of CS2(g) B.…

A: Entropy denotes Randomness or disturbance. As the disturbance increase entropy also increase

Question

For which reaction in each set will AS° be more significant?
For which reaction will AS be positive?
1. A B or A + B C
2. A B +C or A+ B C+ D

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

Draw the orgamic molecule(s) which is(are) formed in the following reaction. Do not include molecules like H,0 or HCl. (You have 2 chances until the answer will be given; you have already tried 0 times) H,C H* + CH;CH,CH,OH (1 mol) H,C CH, °. H,
Given the reaction: 4 Fes) + 3 02(g) - 2 Fe2031s) Delta H = -822.16 kJ --> What is Delta H for the reaction below? ----> 2 Fes) + 3/2 O2(2) + 822.16 kJ + 411.08 kJ 411.08 kJ O + 1644 kJ
q E For each of the following pairs of substances, which substance has the greater value of Sº? a. Pwhite hite (8) and Pred (8) OP white (8) OPred (8) b. Br₂ (1) and Br₂ (9) Br₂ (1) OBr₂ (9) c. CO₂ (s) and CO2 (g) OCO2 (s) O CO2(g) Submit Answer R % 5 Retry Entire Group 9 more group attempts remaining Cengage Learning Cengage Technical Support FS 6 MacBook Air & 8 9 1 (Prev
4. Determine whether the hydrogenation of propene gas reaction at 298 is spontaneous or nonspontaneous by calculating AG C,H, (g) + H, (g) → CH, (1) Enthalpy of formation Entropy C,H, 267 J/mol*K 20.6kJ/mole. C,H, 270.2 J/mol*K-103.9 kJ/mol.
c, d, and e only
If the products of a certain reaction are favored (i.e., the AG value of the reaction is negative), one would expect a significant amount of product to form when the reactants are combined. Which of the choices could explain why such a reaction might produce very little product? negative change in entropy, AS O positive change in enthalpy, AH high activation energy, Ea low activation energy, Ea
34. Which of the following reactions has a positive entropy change? 2SO + Oe) 2S0) 2NH,NO, - 2N + 4H,0 + Oe) BF + NH F,BNH) H,O, - H,O CLEAR ALL < PREVIOUS O 27 26 28 O 29 O 30 О 31 32 O 37 36 38 39
b 40. From the following data at 25°C, H2(g) + Cl2(g) → 2HCl(g) 2H2(g) + O2(g) → 2H2O(g) Calculate AHO at 25°C for the reaction below. 4HCl(g) + O2(g) (a) +299 kJ b-114 kJ AHO=-185 kJ AHO = - 483.7 kJ → 2C12(g) + 2H2O(g) (c)-299 kJ (d) +114 kJ (e)-86.8 kJ
Calculate the ∆S 0 for each given reaction. 1. 2H2 (g) + O2 (g) ---> 2H2O (g) 2. Ca3(PO4)2 (s) ---> 3Ca+2 (aq) + 2PO4 -3 (aq)
5 B b) 2NO(g) + O2(g) → 2NO2(g) The AH° and AS° values of the above reaction at 298 K are -114.1 kJ/mol and -146.5 J/(K. mol) respectively. What is the AG° value of the reaction at the given temperature?
Esc Lock Fn 150 A reaction is thermodynamically unstable (spontaneous) but no change is observed. The reaction is probably Select the correct answer below: O kinetically unstable. kinetically stable. thermodynamically stable but kinetically unstable. O None of the above N F2 N W S F3 X Alt # m 3 E D F4 C $ F5 F dos % 5 V F6 G B F7 DELL Y H F8 7 N F9 * 00 8 J₁ 00 M F10 5 K 2 F11 Alt L 3 F12 E P Ctrl PrtScr + 11 ? { } [ LG 1 Insert 11 Page Up +Home
_______1. When the ∆G of a given reaction is positive, what does this mean? The reaction will proceed spontaneously to produce a product The reaction is spontaneous in reverse reaction The reaction is at equilibrium where the concentration of both reactant and product seems to stop in interacting. None of the above _______2. When the ∆G of a given reaction is negative, what does this mean? The reaction will proceed spontaneously to produce a product The reaction is spontaneous in reverse reaction The reaction is at equilibrium where the concentration of both reactant and product seems to stop in interacting. None of the above _______4. For a reaction to being spontaneous under standard condition at all temperature, the signs of ∆H and ∆S must be _____ and _____, respectively. Positive, positive Positive, negative Negative, positive Positive, 0