21.13 For the following reaction, what is the energy released, in GJ/mol? (1 GJ = 1E9 J)Use \(2.998E8 \, \text{m/s}\) as the speed of light.1 amu has a mass of \(1.6605E-27 \, \text{kg}\).\[ A + B \rightarrow C + D \]| | A | B | C | D ||--------|--------|--------|--------|--------|| mass (amu) | 3.1693 | 6.3763 | 4.1446 | 5.1623 |

Answered: Image /qna-images/answer/c9c4bdd8-3513-4c23-bc06-fe9429c057f0.jpg

For the following reaction, what is the energy released, in GJ/mol? (1 GJ = 1E9 J) Use 2.998E8 m/s as the speed of light 1 a mu has a mass of 1.6605E-27 kg A+B - C+ D A B C D mass 3.1693 6.3763 4.1446 5.1623

For the following reaction, what is the energy released, in GJ/mol? (1 GJ = 1E9 J) Use 2.998E8 m/s as the speed of light 1 a mu has a mass of 1.6605E-27 kg A+B - C+ D A B C D mass 3.1693 6.3763 4.1446 5.1623

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Classify the amino acid depicted here in the form at physiological pH (-7.4). H₂N* CH₂ A) acidic B)…

A: Acidic amino acids have side chains carrying a negative charge at certain pH value. This Amino acid…

Q: intermediate product 15 4 2

A: We have to determine the intermediate product.

Q: Aspartic acid is a polyprotic system whose forms can be written as H3A+, H2A, HA-, and A2-. Its Ka…

A: The problem at hand involves a complex chemical calculation that combines principles of acid-base…

Q: Suppose you discovered a new amino acid. Its R-group contains only hydrogen and carbon atoms.…

A: Hydrophobic and hydrophilic are terms used to describe the interactions between substances and…

Q: 16.26 Indicate whether each of the following statements describes primary, secondary, tertiary, or…

A: Detailed explanation: a. Hydrophobic R groups seeking a nonpolar environment move toward the inside…

Q: 24.98 Draw the condensed structural formula for and give the name of the amino acid formed when the…

Q: 15.34 Use line-angle formulas to write the balanced chemical equation for the acid hydrolysis of…

A: glycerol trioleate is a ester. So in presence of acid, ester hydrolysis takes place to give…

Q: Metalloprotein linkages are most likely to be formed between: Select one: O a. Two cysteines O b. An…

A: The correct answer is given below

Q: Denaturation of a protein breaks OA. covalent bonds between amino acids in an alpha helix. OB.…

A: Denaturation is the process in which modification of structure of the Protein Molecules occurs and…

Q: b) Break down this fatty acid. Show all steps, the products made and the enzymes needed for any…

A: Beta oxidation can be defined as a process in which long chain fatty acids gets degraded.

Q: 8. The following proteins represent a wide range of molecular weights and isoelectric points. Mr is…

Q: 7. 8. 9. Br Provide IUPAC name: 10. Arginine at pH=7 Draw structure OH leq l OH H₂SO4 Provide…

A: Reductive amination is play important role in pharmaceutical and medicinal chemistry.

Q: 1.8 Which enzyme is specific to the gluconeogenic pathway? A. Hexose isomerase B. Pyruvate…

A: Gluconeogenesis is a metabolic pathway that allows the generation of glucose from non-carbohydrate…

Q: (2) 20.4 Match the terms, (1) active site, (2) induced-fit model, and (3) lock-and-key model with…

A: Dear student this question is related concept of enzyme models.

Q: intermediate product 13 2 7 5 NO2

A: Intermediate is " m-chloroethylbenzene "

Q: H2N-CH-c-OH CH2 CH2 CH2 CH2 NH2 A) Glycine B) Tyrosine C) Histidine D) Lysine E) Alanine

Q: intermediate product NH, 1 2 6 10 8 9 -1

A: The sequence of reaction to reagent 10 and the role of reagent are express below Reagent 1 :…

Q: If the pl for asparagine is 5.43, draw the structure at a pH of 9.5?

A: The pl for asparagine = 5.43 pH = 9.5

Q: 19.36 What typė of ing groups in a tertiary structure? a. phenylalanine and isoleucine c. asparagine…

A: Following interaction are seen in the given amino acid groups in a tertiary structure.

Q: (2.48) Which of the following bases are strong enough to deprotonate C6H5OH (pKa=10) so that the…

A: The equilibrium always favors the formation of the weaker acid (higher Pka). The Pka values of each…

Q: opy of The following reaction scheme shows the states of the amino acid hisitdine. Histidine has…

A: When pH > pKa then deprotonation occurs When pH< pKa then protonation occur

Q: 6. Draw the correct structure of the amino acid Glutamine (pl=5.7) at Glutamine: R=CH₂-CH₂- 0 -NH₂

A: We know the structure below pI is Catholic or Quarternery ammonium salt (R3NH+) and above pI anionic…

Q: H₂N NH3+ COOH Arginine Lysine O Valine Proline

A: The given compound Chemical formula is.,COOHCH(NH2)CH2CH2CH2CH2NH3+

Q: The chemical reaction to make acetaminophen (paracetamol) is shown below. C6H7NO3 + C4H2O3 ---->…

A: The number of moles (n) of p-aminophenol is calculated as shown below where m is the mass…

Q: 15.6 Stearic acid and linoleic acid each have 18 carbon atoms. Why does stearic acid melt at 69 °C…

A: we have to explain the melting point difference of stearic acid and linoleic acid and draw the…

Q: 16.22 What type of interaction would you expect between the R groups of the following amino acids in…

Q: 8. What is the optimum pH to separate a mixture of lysine (2.2, 9,0, 10.0), arginine (1.82, 8.99,…

A: Differences in isoelectric point (pI) can be used to separate a mixture of amino acids by…

Q: What type of Intermolecular forces exist between the side chains of isoleucine and valine?

A: The types of intermolecular forces possible between the amino acid side chains are electrostatic…

Q: 17.28 Write the base sequence in a complementary DNA segment if each original segment has the…

A: The DNA is heredity unit of gene. Here we are required to find the complementary base sequence for…

Concept explainers

Types of Polymers on the basis of Method of Preparation

Question

21.13

For the following reaction, what is the energy released, in GJ/mol? (1 GJ = 1E9 J)

Use \(2.998E8 \, \text{m/s}\) as the speed of light.

1 amu has a mass of \(1.6605E-27 \, \text{kg}\).

\[ A + B \rightarrow C + D \]

| | A | B | C | D |
|--------|--------|--------|--------|--------|
| mass (amu) | 3.1693 | 6.3763 | 4.1446 | 5.1623 |

Expert Solution

Step 1

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Types of Polymers on the Basis of Method of Preparation

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

dont handwriting solution
Give correct answer
d. réčombinants 20. What functional group is found on every amino acid not in a zwitterion form? a. -SH b. -NH, C. -C- d. -S-S- e. no correct response is given 21. The peptide linkage that bonds the monomers together in proteins is also corr
1. Identify the amino acids with the following components in their R group: 1.1. Hydroxyl group 1.2. A sulfur atom 1.3. A second chiral carbon 1.4. An amide group 1.5. An amino group 1.6. A branched side chain 2. Compare and contrast the following pairs: 2.1. Cysteine & Cystine 2.2. Reduced glutathione & Oxidized glutathione 2.3. Lysine & Hydroxylysine 2.4. D-amino acid & L-amino acid .Draw the titration curves of an acidic amino acid, a basic amino acid, and a neutral amino acid ased on their R group. Explain also how titration of amino acids is performed.
Question 4 What is the isoelectric point of the tripeptide gly-ala-cys? pka values are as follows: Gly: 2.3, 9.6 Ala: 2.4, 9.7 Cysteine: 1.7, 8.3 (R group), 10.8 9.0 5.7 10.3 6.6 5.0
Solve these 3 questions
(44) What is the correct name of the following amino acid?
16.17 What happens when a primary structure forms a secondary structure? 16.18 What are two types of secondary protein structure?
1.15 The enzyme which catalyzes crosslink formation in collagen is called O Silk fibroin O Lysyl hydroxylase O Lysyl oxidase O Prolyl hydroxylase
Analyze each molecular formula: 6. 8. 7. How many atoms of each element are in a molecule of the amino acid lysine C6H14N3O2? 9. ARBE How many atoms of each element are in a molecule of oxaloacetic acid C4H4O5? How many atoms of each element are present in the nucleotide adenine: C9H14N3O8P ? Wh Tell how many atoms of each element are in a molecule of the phospholipid phosphatidate: C35H65O7P CHO
16.48 Oxaloacetate is an inhibitor of succinate dehydrogenase. COO COO CH2 CH₂ CH₂ C=0 COO Succinate COO Oxaloacetate a. Would you expect oxaloacetate to be a competitive or a noncompetitive inhibitor? Why? b. Would oxaloacetate bind to the active site or elsewhere on the enzyme? c. How would you reverse the effect of the inhibitor?