Find the following:9. Mass of NiCl2*6H2O consumed during thereaction10. Mass of H2NCH2CH2NH211. Calculated grams of excess reactant 7910111213141516Stoichiometric ratio of H,NCH,CH,NH, toNH(H,NCH,CHÍNH,) C,Moles of Ni(H,NCH CH₂NH₂),CI, if NICI, 6H₂Ois the limiting reactantMoles of Ni(H,NCH CH₂NH₂),Cl, if H₂NCH,is the limiting reactantIdentity of the limiting reagentMass of NICI, 6H₂Oconsumed during the reaction.CH₂NH₂Mass of H₂NCH₂CH₂NH₂consumed during the reactionCalculated grams of excess reactantMolar mass of Ni(H₂NCH₂CH₂NH₂),CL,Theoretical yield (in mass) of Ni(H₂NCH₂CH₂NH₂),CI,producedTheoretical yield (in mass) of H₂O producedTotal mass of all reactants consumedTotal mass of all (theoretical) products0-11406chmoks0.015/ molerH₂NCH₂CH₂NH₂309.8944 g/mol

The reaction for the experiment is: NiCl2 + H2NCH2CH2NH2 → Ni(H2NCH2CH2NH2)Cl2 Mass of NiCl2.6 H2O…

Answered: Find the following: 9. Mass of…

Find the following: 9. Mass of NiCl2*6H2O consumed during the reaction 10. Mass of H2NCH2CH2NH2 11. Calculated grams of excess reactant

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 5RQ: Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds....

See similar textbooks

Related questions

Q: 2KHCO3(s) - K2CO3(s) + CO2(g) + H20(1); How many moles of potassium carbonate will be produced if…

A: e option is correct. 2.43 moles

Q: Use the following Unbalanced reaction and the information about starting material to determine the…

Q: Period: Name: 1. Explain what % yield is. Use an everyday example.

Q: ximum amount of sulfur trioxide that can be formed? grams PRMULA for the limiting reagent? of the…

A: Given, Balanced chemical reaction, 2SO2(g) + O2(g) ---> 2SO3(g) Mass of SO2 = 28.8 g Moles of…

Q: 1. Consider the given for nos. 1 to 4: 6 Li(s) + N2(g) →2 LiŞN(s) Determine: _1) the mass of N2…

A: Hello. Since the question contains multiple subparts, the first three subparts are solved. In case…

Q: In the reaction 2KCIO, - 2KCI + 30, potassium chlorate is heated to produce potassium chioride and…

A: Option; C) 2.4 moles is correct. Given reaction; 2KClO3 -----> 2KCl + 3O2 Given moles of…

Q: 1. C6H12O6(s) 6 O2(g) 6 CO2(g) +6 H2O(g) Starting with 25.0 g C6H12O6 and 15.5 g O2, what is the…

A: The limiting reagent refers to the compound that is fully utilized after the completion of chemical…

Q: 11. The combustion of glucose is represented by the following balanced equation: C6 H1206+6 02 6…

A: Limiting reagent: The reagent that consumed completely during course of reaction is known as…

Q: 3.Use the following Unbalanced reaction and the information about starting material to determine the…

Q: 2. KCIO3 _KCI +_O2 a. Balance the reaction b. What is the reaction type?. C. What is the theoretical…

A: Since you have posted question with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: What is the max CaCO3 produced?

Q: Which (if any) of the following is (are) true regarding the limiting reactant in a chemical…

A: Limiting reactant in a chemical reaction is a reactant that is totally consumed when the chemical…

Q: 5.- If 154 g of Al react with 801 g of Fe2O3 to produce Al2O3, and Fe A) Write the balanced equation…

A: A) Balanced equation:B) To find the limiting reactant, we need to calculate the moles of each…

Q: In a particular reaction 8.60g of dinitrogen trioxide gas (N2O3) was actually produced by reacting…

Q: n the reaction of 10.00 mL of FeCl3{aq) and 12.4 g of <½C2O4laq). you calculate that 9.58 g of…

A: Volume of FeCl3 = 10.00 mL Mass of K2C2O4 : 12.4 g Mass of K3FeC2O43H2O = 9.58 g

Q: 3. How many grams of O2 are produced from 12.39 grams of H2O2, according to the following balanced…

A: Balanced reaction is 2 H2O2(l) → 2 H2O(l) + O2(g) 2 mol =…

Q: 32. For the equation given: 2C₂H4 + 60₂ 4H₂O If 14.0 grams of C₂H4 is reacted and the actual yield…

A: A balanced chemical equation contain equal number of atoms of each elements on both sides of the…

Q: Nitromethane Fuel CH3NO2 is burned with atmospheric air in a stoichiometric ratio. The total number…

A: We know that When Nitromethane is burn in atmospheric air to produce Carbon dioxide and water and…

Q: Consider the equation: Sb,0, +3 C 2 Sb+ 3 CO 5. How many atoms of Antimony are produced when 1.423…

A: Given mass of Sb2O3 = 1.423 g Given chemical equation: Sb2O3+3C→2Sb+3CO

Q: Consider the reaction: N2(g) + 202(g) → 2NO2(g) 0.250 mol of N2(g) is reacted with 0.300 mol of…

A: According to the balanced chemical equation, 1 mole of N2 reacts with 2 moles of O2.

Q: For the reaction 2KClO3(s)→2KCl(s)+3O2(g) calculate how many grams of oxygen form when each…

A: The balanced reaction given is, => 2 KClO3 (s) ------> 2 KCl (s) + 3 O2 (g) Molar mass of…

Q: Consider the balanced equation: 2 Na + H₂SO4 → Na2SO4+H₂ 1. If 35.0 g of Na is reacted with excess…

A: The Answer to the following question is-

Q: According to the following reaction, how many moles of nitrogen monoxide will be formed upon the…

A: Given :-Mass of N2=26.6 g To calculate :- Number of Moles of NO Number of moles = mass/molar mass

Q: DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction:…

Q: Refer to this equation: 3SCl2 + 4NaF --> SF4 + S2Cl2 + 4NaCl 64.0 grams SCl2 is reacted with…

A: Given chemical equation: 3SCl2 + 4NaF --> SF4 + S2Cl2 + 4NaCl Number of moles =(given…

Q: [Review Topics] [References] Use the References to access important values if needed for this…

A: 2CO(g) + O2(g) ----> 2CO2(g) Excess reactant: carbon monoxide (CO) mass of Oxygen gas (O2) react…

Q: dinitrogen trioxide gas (N2O3) was actually produced by reacting 6.85 g of oxygen gas (O2) with…

A: The question is based on the concept of Reaction Stoichiometry. we have to write balanced chemical…

Q: Refer to this equation: 3SCl2(l) + 4NaF(s) → SF4(g) + S2Cl2(l) + 4NaCl(s) 12.0 grams SCl2 is reacted…

A: The balance chemical equation : 3SCl2(l) + 4NaF(s) ----> SF4(g) +S2Cl2(l) + 4NaCl(s) Mass of…

Q: For the following reaction, 3.76 grams of hydrogen gas are allowed to react with 40.5 grams of…

A: Part 1: The maximum Mass of HI produced is 40.82g Part 2: Molecular formula for limiting reagent…

Q: Given the combustion reaction: C3H8 + O2 -> CO2 + H2O, what is the balanced equation? 1.a. If…

Q: The combustion of methane produces carbon dioxide and water. Assume that 52.8 grams of methane…

Q: reactant controls the amount of product formed in a chemical reaction? A. excess reactant B. mole…

A: Since you asked multiple questions so as per Q&A guidelines of portal I solved first question…

Q: For the following reaction, 5.33 grams of hydrogen gas are allowed to react with 47.7 grams of…

A: Given,

Q: 6.50 g of a certain Compound X, known to be made of carbon, hydrogen and perhaps oxygen, and to have…

Q: For the following reaction, 9.09 grams of nitrogen monoxide are allowed to react with 7.90 grams of…

A: Given: The reaction is as follows, Nitrogen monoxide(g) + oxygen(g) → nitrogen dioxideg Mass of…

Q: DDT, an insecticide harmful to fish, birds and humans, is produced by the following reaction 2C6H5Cl…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: Aluminum reacts with iodine in the presence of hot water, to exothermically produce aluminum iodide.…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Find the following:

9. Mass of NiCl2*6H2O consumed during the

reaction

10. Mass of H2NCH2CH2NH2

11. Calculated grams of excess reactant

7
9
10
11
12
13
14
15
16
Stoichiometric ratio of H,NCH,CH,NH, to
NH(H,NCH,CHÍNH,) C,
Moles of Ni(H,NCH CH₂NH₂),CI, if NICI, 6H₂O
is the limiting reactant
Moles of Ni(H,NCH CH₂NH₂),Cl, if H₂NCH,
is the limiting reactant
Identity of the limiting reagent
Mass of NICI, 6H₂O
consumed during the reaction
.
CH₂NH₂
Mass of H₂NCH₂CH₂NH₂
consumed during the reaction
Calculated grams of excess reactant
Molar mass of Ni(H₂NCH₂CH₂NH₂),CL,
Theoretical yield (in mass) of Ni(H₂NCH₂CH₂NH₂),CI,
produced
Theoretical yield (in mass) of H₂O produced
Total mass of all reactants consumed
Total mass of all (theoretical) products
0-11406
ch
moks
0.015/ moler
H₂NCH₂CH₂NH₂
309.8944 g/mol

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Answer of 9:

VIEW

Answer of 10:

VIEW

Answer of 11:

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Write the balanced chemical equation for the complete combustion of adipic acid, an organic acid containing 49.31% C, 6.90% H, and the remainder O, by mass.
A power plant is driven by the combustion of a complex fossil fuel having the formula C11H7S. Assume the air supply is composed of only N2 and O2 with a molar ratio of 3.76:1.00, and the N2 remains unreacted. In addition to the water produced, the fuels C is completely combusted to CO2 and its sulfur content is converted to SO2. In order to evaluate gases emitted at the exhaust stacks for environmental regulation purposes, the nitrogen supplied with the air must also be included in the balanced reactions. a Including the N2 supplied m the air, write a balanced combustion equation for the complex fuel assuming 100% stoichiometric combustion (i.e., when there is no excess oxygen in the products and the only C-containing product is CO2). Except in the case of N2, use only integer coefficients. b Including N2 supplied in the air, write a balanced combustion equation for the complex fuel assuming 120% stoichiometric combustion (i.e., when excess oxygen is present in the products and the only C-containing product is CO2). Except in the case of use only integer coefficients c Calculate the minimum mass (in kg) of air required to completely combust 1700 kg of C11H7S. d Calculate the air/fuel mass ratio, assuming 100% stoichiometric combustion. e Calculate the air/fuel mass ratio, assuming 120% stoichiometric combustion.
Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
Billions of pounds of urea, CO(NH2)2, are produced annually for use as a fertilizer. The principal reaction employed is: 2NH3+CO2CO(NH2)2+H2O By assuming unlimited amounts of CO2, how many moles of urea can be produced from each of the following amounts of NH3? a.2molNH3b.0.45molNH3c.10gNH3d.2.0kgNH3
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Write an equation from the following description: reactants are gaseous NH3 and O2, products are gaseous NO2 and liquid H2O, and the stoichiometric coefficients are 4, 7, 4, and 6, respectively.
3.59 The composition of materials such as alloys can be described in terms of mole percentage (mol%), atom percentage (at%), or weight percentage (wt%). Carry out the following conversions among these units. (a) 60 Cu and 40 Al to at%, (b) 25 mol% NiO and 75 mol % MgO to wt%, (C) 40 wt% MgO and 60 wt% Feo to mol %
Sodium carbonate reacts with nitric acid according to the following equation. Na,CO:(s) + 2HNO; – 2NANO, + CO, + H,O If 17.6 g of Na,CO, reacts, how many moles of Co, are produced?
The composition of materials such as alloys and ceramics can be described in terms of mole percentage (mol%), atom percentage (at%), or weight percentage (wt%). Carry out the following conversions among these units. (Enter unrounded anwers.) (a) 93.8 wt% Cu and 6.2 wt% Al to at% at% Cu at% Al (b) 70. mol% Ni0 and 30. mol% MgO to wt% wt% NiO wt% MgO (c) 22.6 wt% MgO and 77.4 wt% Fe2O3 to mol% mol% MgO mol% Fe2 O3