Explain why each name is incorrect, and then write a correct name for the intended compound: (a) 2-Ethyl-1-propene The name is incorrect because The correct IUPAC name is (b) 5-Isopropylcyclohexene The name is incorrect because The correct IUPAC name is (c) 4-Methyl-4-hexene The name is incorrect because The correct IUPAC name is

Q: Draw the structural formula of  (E)-1,2-dibromo-3-isopropyl-2-hexene. EXPLAIN reasoning behind the…

A:

Q: I would like to ask how to draw the Structural Formula for 4-ethyl-trans-2-heptene?

A: Given: 4-ethyl-trans-2-heptene

Q: Draw structures corresponding to the following IUPAC names 2-Methyl-1,5-hexadiene Explain why each…

A: Since you have posted multiple questions, we will solve the first question for you. If you want any…

Q: C-C- =C -C -c -C-C C-C-C

A: Aldehydes and ketones are the class of organic compounds that incorporates a carbonyl functional…

Q: Draw the structures of the following compounds (R)-2–methyl–1-chloro–butane b)…

A: Given two compounds are, a) (R)-2-methyl-1-chlorobutane b) (S)-3-methyl-3-hexanol

Q: Write two complete balanced equations for each of the following reactions, one using condensed…

A: In condensed structural formula atoms of same type are bonded to one another and are grouped…

Q: Below, write the names of the compounds whose open structures are given and the open structures of…

A: According to this IUPAC naming or nomenclature system, every different chemical compound is given a…

Q: Write the structures of each of the following organic compounds  a) 2-Methyl-1,3-butadiene b)…

A: 1) first find the alkane moiety and draw it. 2) Then do the numbering from any side. 3) Attach the…

Q: Write the structures of each of the following organic compounds  a) 3-Ethyl-5-methylheptane b)…

A: Structures of the following organic compounds are shown below:

Q: The correct structural formula for 1-chloro-2-methyl-benzene

A: structural formula for 1-chloro-2-methyl-benzene

Q: + What is the classification of the carbocation shown here? A) 1° B) 2° C) 3° D) 4° III

A:

Q: Provide the IUPAC name the compound CH3(CH2)4-C=C-CH2CH=CH(CH2)7CH3. Parent name: Locants: IUPAC…

A: Given compound is :

Q: Write the IUPAC name of the product of this reaction: HBr CH2=C(CH3)2

A: in electrophilic addition reaction pie bonds break and new species are attached to substrate with…

Q: 3-methylhexane is A Linear saturated hydrocarbon B Branched saturated hydrocarbon Linear unsaturated…

A:

Q: The name below is incorrect. Draw the structure. Explain what is incorrect about the name and rename…

A: In organic chemistry, C plays a very important role. This is because the C-atom shows some unique…

Q: Only 1 of the following chemicals can exist. Which chemical is it and why can't the other chemicals…

A: Out of these three compounds, only 2 compound exists which is 2,2,3-methylbutane. The other…

Q: Draw the skeletal ("line") structure of 2-chloro-1,4-dimethylcyclohexane.

A: The skeletal structure of 2-chloro-1,4-dimethylcyclohexane is given below the lines represent the…

Q: Reaction product ( HCI Ethylene) is نقطة واحدة +

A: Addition reactions may convert unsaturated hydrocarbons into saturated hydrocarbons. Single bond…

Q: Write a complete structural diagram for 1-ethyl-4methylcyclopent-1-ene

A:

Q: What is the correct IUPAC name for 2,2-dimetil-6-ethylheptane ?

A: The introduction frames the inquiry within the context of IUPAC nomenclature, emphasizing the…

Q: What is the drawing for 4-cyclopropylhex-1-ene ?

A: Drawing for 4-cyclopropylhex-1-ene ?

Q: For the following reaction, draw the major organic product and select the correct IUPAC name for the…

A:

Q: 25. Which compound has the highest boiling point? a) Ethene b) Propene

A: Boiling point increases as the number of carbon atom increases. As carbon atom increases, higher the…

Q: Name the alkene. 3-ethyl,hept-3-ene The IUPAC name is: Incorrect

A: In this question, we will give the IUPAC name of the Compound.  You can see details Solution below.

Q: Are there cis/trans isomers of 1-propene?

A:

Q: 8) Which of the following is a structural isomer of 2-methylbutane? А) п-propanc B) 2-methylpropane…

A: The compound given is 2-methylbutane.

Q: Draw a skeletal (line-bond) structure of cyclohexane.

A: The structure of a chemical compound can be represented by Lewis structure, structural formula,…

Q: Draw the structural formula of 4-tert-butylheptane

A: Answer: It is an organic compound whose structural formula we have to draw.

Q: Draw a complete structural diagram for 1-ethyl-4methylcyclopent-1-ene

A:

Q: The IUPAC name 4-hexylhexane is incorrect. What should be the correct name?   Group of answer…

A:

Q: Kim Chem referred to a compound as "2-methylcyclohexene" Give the correct name for this compound.

A:

Q: What is the name of the cycloalkane containing five carbon atoms?

A: Cycloalkane contains -CH2 group present in a cyclic ring. In cyclo alkanes all single bonds. The…

Q: Draw the structures of the following compounds. A) m-ethylbenzaldehyde B) 4-Bromo-2-nitrotoluene c)…

A: To draw the structure of the given iupac names:  1) first of all draw the given parent chain.  2)…

Q: Provide the IUPAC name of the product formed when 1-butene reacts with HCl

A:

Q: Name and draw a structural formula for the product of each alkene addition reaction

A: The addition reaction in organic chemistry is, in the simplest words, an organic reaction where two…

Q: what is the condensed formula for 2-methyl-2-hexene

A: Given :-  IUPAC name of compound = 2-methyl-2-hexene  To write :- its condensed formula

Q: Name or write the condensed structural formula of the compound: (a) trans-2-pentene

A: Compounds having the same molecular formula but a different arrangement of atoms in space are termed…

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.