Ethyl acetate is synthesized in a nonreacting solvent (not water) according to the following reaction:CH; CO,H + C,H OH = CH; CO,C,H; + H20 K = 2.2Acetic acidEthanolEthyl acetateFor the following mixtures (a-d), will the concentration of H2 O increase, decrease, or remain the same as equilibriumis established?а. [сH,CO,C, Ны] — 0.22 М, [Н,0] — 0.1о м, [сH,СО, н] — 0.010 м, [C, H, онј — 0.010 MO increaseO ecreaseO remain the sameb. [CH; CO2C,H5] = 0.22 M, [H2O] = 0.0020 M, [CH3 CO,H] = 0.0020 M, [C,H;OH] = 0.10 MO increaseO decreaseOremain the samec. [CH; CO2C,H5]= 0.88 M , [H2O] = 0.12 M, [CH; CO,H] = 0.044 M, [C,H; OH] = 6.0 Mс.O increasedecreaseOremain the samed. [CH3 CO,C,H5]= 4.4 M , [H2O] = 4.4 M, [CH3 CO,H] = 0.88 M , [C,H5 OH] = 10.0 MO increaseO decreaseOremain the samee. What must the concentration of water be for a mixture with [CH3CO,C,H5] = 1.0 M,[CH3 CO;H] = 0.10 M , and [C2H; OH] = 6.0 M to be at equilibrium?Concentrationм

At any time: Q = [CH3CO2C2H5][H2O]/[CH3CO2H][C2H5OH] If Q < K then reaction will occur in forward…

Ethyl acetate is synthesized in a nonreacting solvent (not water) according to the following reaction: CH;CO,H + C¿HgOH– CH;CO2C,Hs + H2O K=2.2 Acetic acid Ethanol Ethyl acetate For the following mixtures (a-d), will the concentration of H, O increase, decrease, or remain the same as equilibrium is established? a. [CH; CO,C,Hs] = 0.22 M , [H;O] = 0.10 M, [CH,CO,H] = 0.010 M, [C,H;OH] = 0.010 M O increase O decrease O remain the same b. [CH,CO,C, H,] — 0.22 М, [Н,0] — 0.0020 М, [CH,CO,H] - 0.0020 М, [С, Н,ОН) - 0.10 м O increase O decrease Oremain the same c. [CH;CO,C,Hs] = 0.88 M , [H;O] = 0.12 M, [CH;CO,H] = 0.044 M , [C,H,OH] = 6.0 M O increase O decrease Oremain the same

Ethyl acetate is synthesized in a nonreacting solvent (not water) according to the following reaction: CH;CO,H + C¿HgOH– CH;CO2C,Hs + H2O K=2.2 Acetic acid Ethanol Ethyl acetate For the following mixtures (a-d), will the concentration of H, O increase, decrease, or remain the same as equilibrium is established? a. [CH; CO,C,Hs] = 0.22 M , [H;O] = 0.10 M, [CH,CO,H] = 0.010 M, [C,H;OH] = 0.010 M O increase O decrease O remain the same b. [CH,CO,C, H,] — 0.22 М, [Н,0] — 0.0020 М, [CH,CO,H] - 0.0020 М, [С, Н,ОН) - 0.10 м O increase O decrease Oremain the same c. [CH;CO,C,Hs] = 0.88 M , [H;O] = 0.12 M, [CH;CO,H] = 0.044 M , [C,H,OH] = 6.0 M O increase O decrease Oremain the same

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Iron(III) oxide and hydrogen react to form iron and water, like this: Fe,0;(s)+3 H,(g)→2FE(s)+3H,O(9) At a certain temperature, a chemist finds that a 5.1 L reaction vessel containing a mixture of iron(III) oxide, hydrogen, iron, and water at equilibrium has the following composition: compound amount db Fe,O3 4.36 g H, 4.35 g Fe 3.23 g H,0 2.73 g Calculate the value of the equilibrium constant K, for this reaction. Round your answer to 2 significant digits. Explanation Check 2022 McGraw H LLC. A Rights Reserved Terms of Use Pvacy Center Accessibil DE P Type here to search JU P. Alt alexa ENADLED
Consider the reaction: SO₂(g) + 1/2O2(g) ⇒ SO3 (9) Write the equilibrium constant for this reaction in terms of the equilibrium constants, K₁ and K2, for the reactions below: 2S(s) + 30₂ (g)2SO3 (9) K₁ S(s) + O₂(g) ⇒ SO₂(g) K₂ For answers with both a subscript and a superscript, enter the subscript first. For example, enter Kif the first equilibrium constant should be squared. K =
Consider the following reaction: 2CH₂Cl2 (9) ⇒ CH4 (9) + CCl4 (9) If 0.436 moles of CH₂Cl2 (g), 0.335 moles of CH4, and 0.406 moles of CC14 are at equilibrium in a 17.4 L container at 599 K, the value of the equilibrium constant, Kc, is
For the reaction system Fe(s) + H2 O(g)= FeO(s) + H2 (9) which has already reached a state of equilibrium, predict the effect that each of the following changes will have on the position of the equilibrium. Tell whether the equilibrium will shift to the right, will shift to the left, or will not be affected. a The pressure of hydrogen is increased by injecting an additional mole of hydrogen gas into the reaction vessel. shifts left shifts right no effect b Hydrogen gas is removed as it forms by use of a chemical absorbent, or "scrubber." shifts left shifts right no effect C An additional amount of solid iron is added to the reaction vessel. shifts left shifts right no effect
None
Consider the following reaction where K. = 10.5 at 350 K: 2 CH;Cl2 (g)=CH4 (g)+ CCI4 (g) A reaction mixture was found to contain 1.10x10-2 moles of CH,Cl, (g), 4.63×10-2 moles of CH4 (g), and 3.70×10² moles of CCl (g), in a 1.00 liter container. Indicate True (T) or False (F) for each of the following: v 1. In order to reach equilibrium CH,Cl,(g) must be produced. v 2. In order to reach equilibrium K, must decrease v 3. In order to reach equilibrium CH, must be consumed. v 4. Qc is greater than K. 5. The reaction is at equilibrium. No further reaction will occur. T
For the reversible reaction: N 2 (g)+ O 2 (g) = 2 NO (g) AH= 181 kJ (a) What will happen to the concentrations of NO at equilibrium if O, is added? (b) What will happen to the concentrations of NO at equilibrium if NO is removed? (c) What will happen to the concentrations of NO at equilibrium if the volume of the reaction vessel is increased? (d) What will happen to the concentrations of NO at equilibrium if the temperature of the system is decreased? (e) What will happen to the concentrations of N,, 0,, and NO at equilibrium if a catalyst is added?
What is the equilibrium concentration of BCl3 if a solid sample of PH3BC13 is placed in a 0.250 L closed vessel at 80.0 °C and decomposes until equilibrium is reached? Assume that there is solid present at equilibrium. At 80.0 °C, Kc = 1.87 x 10-³ for the reaction: PH3BC13(s) ⇒ PH3(g) + BCl3(g) Provide your answer in M, without units, and use the correct number of significant figures. 534.8
4) At high temperatures nitrogen (N₂) and oxygen (O₂) will react to form NO. N₂(g) + O₂(g) 2 NO(g) The value for the equilibrium constant for reaction 4.1 is Kc = 2.7 x 10-¹7 at some temperature T. A system initially has [N₂] = 0.0800 M and [0₂] = 0.0500 M. There is no NO initially present in the system. Find the value for [NO] that will be present at equilibrium. (4.1)
Nitrogen and hydrogen react to form ammonia, like this: N2 (g)+3H,(g) 2NH;(g) Suppose a mixture of N,, H, and NH, has come to equilibrium in a closed reaction vessel. Predict what change, if any, the perturbations in the table below will cause in the composition of the mixture in the vessel. Also decide whether the equilibrium shifts to the right or left. alo perturbation change in composition shift in equilibrium Ar to the right The pressure of N, will to the left Some H, is removed. The pressure of NH, will (none) to the right The pressure of N, will ? to the left Some NH, is added. The pressure of H, will v ? O (none) go up. go down. not change.
Do 6-10.
Write the equilibrium constant expression, K, for the following reaction taking place in dilute aqueous solution. HF (aq) + OH- (aq)F- (aq) + H2O (l) K =