1. Draw the structure of Fe(OX).2H20.2. Draw the possible structures of [Fe(OX)a]* and explain why the complexes drawn areopticaily active,3. Explain how you would analyse Fe(OX).2H,0 for iron and oxalate if you wereprovided with a standardised solution of potassium permanganate, dilute sulphuricacid and zinc dust.4. Explain how you would analyse K3[Fe(OX);]3H2O for iron and oxalate if you wereprovided the same reagents as in 3 above.

Since you have asked multiple questions, we will solve the first question for you. If you want any…

Answered: Draw the structure of Fe(OX).2H20.

Science

Chemistry

Draw the structure of Fe(OX).2H20.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 95QRT

See similar textbooks

Similar questions

A 3.03-g petroleum specimen was decomposed by wet ashing and subsequently diluted to 500 mL in a volumetric flask. Cobalt was determined by treating 25.00-mL aliquots of this diluted solution as follows: Assume that the Co(II)-ligand chelate obeys Beer’s law, and calculate the percentage of cobalt in the original sample.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
4. Magnetite, Fe304, is one of the principal mineral sources of iron, along with Haematite and Limonite. Its crystal structure corresponds to that of a spinel. a) Provide the description of the unit cell, with ion packing and occupancy of holes. (Hint: AB2O4) b) Assuming O² as a weak field ligand, provide the crystal field splitting diagram for each cation under each coordination environment. Clearly label the energy axis as well as all orbitals, with their correct electron occupancy.
For each of the following pairs of metal hydride complexes, indicate which has the lower pKa. Explain your choice a. HRe(CO)3(PPh3)2 or HRe(CO)3(dmpe) (dmpe = bis(dimethylphosphino)ethane)b. Cp2Ti(Br)(H) or HCo(CO)4c. [HRu(N---CMe)(CO)4]+ (triple bond here) or HCo(CO)(PEt3)3
Part B Consider the formation of Ni(en)a2 from (Ni(H20)6? The stepwise AG values at 298 K are AG for first step = 42.9 kJ - mol AG, for second step =-35.8 kJ - mol AG', for third step -24.3 kJ - mol Calculate the overal formation constant (K) for the complex (Ni(en)a Express your answer numerically to three significant figures. > View Available Hint(s) Submit Previous Answers Request Answer
The stepwise formation constants for complexes of NH3 with [Cu(OH2)6]2+(aq) are log Kfl = 4.15, log Kf2 = 3.50, log Kf3 = 2.89, log Kf4 = 2.13, and log Kf5 = −0.52. Suggest a reason why Kf5 is so different.<
4. State whether you expect the following complexes to exhibit Jahn-Teller distortion. If there is, would it be a strong or weak distortion? a. [Fe(OH2)6]2 (high spin) b. [Ni(CN)]2 c. [ZnCl4]¹2 d. [Cu(CH3CN)4]*² e. UO2(OH₂)s (pentagonal bipyramidal) f. [RhCl4(OH₂)2] (low spin)
why [Cu(deen)2]X2(X = BF4-, ClO4-and NO3-) show thermochromic behavior, whereas most other bis-diamine Cu(II) complexes (e.g. ethylenediamine) do not exhibit this property
1. a) Explain the bonding of metal carbonyl (terminal) by VBT and by using orbital pictures (MOT). b) How will you synthesize Fe(CO)5, [V(CO6)]-, Ni(CO)4 c) Arrange all the molecules with increasing metal-carbon (Metal and carbonyl carbon) bond stretching frequency. Explain your answer: [Mn(CO)6]+, [Mn(CH3NH2)(CO)5]+, [Mn(tren)(CO)3]+, [Mn(en)(CO)4]+
General questions regarding Crystal Field Theory. Use Crystal Field Splitting Diagrams as necessary. a) Identify M (metal) that meets the requirements given - and briefly justify your answer. M(CN)6 with CFSE = 1.2Ao, M is second-row transition metal. MBr having one unpaired electron, M is first-row transition metal. b) Fe(H2O)6* is paramagnetic whereas Os(H2O)6* is diamagnetic. Account for this observation.