Answered: Determine the shape of the complex,…

Determine the shape of the complex, [MnBr2(en)2] Select one: O a. linear O b. either tetrahedral or square planar O c. tetrahedral O d. square planar Oe. octahedral

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 2ALQ

See similar textbooks

Related questions

Q: Which of the following can be exhibited by [Ni(en)2Cl2]? Draw and label what applies. A. mer-fac…

Q: What is the most likely molecular geometry of the complex [Fe(en)2CI2]* ? O trigonal planar O…

A: The oxidation number of iron in the given complex ion is +3 The central metal ion Fe+3 is surrounded…

Q: A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A: Given -> Complex -> [MA2B2]X2

Q: Write the state of hybridization, shape and IUPAC name of the complex [Ni(CN)4]2-. (Atomic no. of Ni…

A: The atomic number of Ni is 28 and its valence shell electronic configuration is 3d84s2.Ni is in +2…

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: C.Draw the molecular orbital diagram for B2 and find the bond order? D.The geometry of [Ni(CN)4]2-…

Q: 3+ When a certain strong-field ligand forms an octahedral complex with Mn³ cation, the energies of…

A: ll

Q: What is the coordination geometry of the following transition metal complexes? Select one: O i.…

A: We will first find out the oxidation state of the metal. And will write an electronic configuration…

Q: Ligands X, Y, and Z form octahedral complexes with Cu2* ion resulting to yellow, orange, and red…

A: ✓Following is the increasing order of ligand field strength Z<Y<X So the correct answer is (C)…

Q: 1. In coordination compound [Cr(en)2Cla]Cl the ligands the the coordination number is the donor…

A: In the coordination compound [Cr(en)2Cl2]Cl , the central metal atom is Cr and the ligands are…

Q: Na2[Fe(CN)4(en)] The complex ion of this compound is known to be diamagnetic. Draw the d-orbital…

Q: What is the geometry for the [Cr(H2O)4CI2] compound? O A. Square planar B. Tetrahedral OC. Trigonal…

A: We have to tell which option is correct from given choices of options by telling what is geometry of…

Q: what is the formula of: i. tetraamminebromochloroplatinum(IV) chloride ii.…

A: Since you have posted a question with multiple sub-parts,we will solve first three sub-parts for…

Q: What is the most likely molecular geometry of the complex [Fe(DMG)2 I 2] * ? O bent O octahedral O…

A: In the given complex the iron metal is attached with two dimethylglyoxime ligands and two iodide…

Q: 14. The oxidation number (O.N.) and coordination number (C.N.) of chromium in the coordination…

A: Here we are required to find the coordination number and oxidation number of the complex.

Q: Which of the following complexes has the highest oxidation state of metal? a. Cr(n6-C6H6)2 b.…

A: a) (η6-C6H6)2Cr Let the oxidation state of Cr= x The oxidation state of η6-C6H6 =0 Overall charge on…

Q: 1. Draw the following structures and determine the oxidation state of the central metal ion. a.…

Q: a) Naz[Fe(CN)4(en)] b) The complex ion of this compound is known to be diamagnetic. Draw the…

A: Since CN- is a strong field ligand, it forms low spin complex and has large crystal field splitting.…

Q: Complex ion # Unpaired electrons Relative A, [Mn(H,O),1²* [Mn(en)3]2*

A: CFT explains the bonding interaction of central transition metal and ligand. This theory assumes…

Q: What is the geometry of the coordination complex ion [NICI1?? A) octahedral B) tetrahedral C) square…

A: B) tetrahedral

Q: When a certain weak-field ligand forms a tetrahedral complex with Cocation, the energies of the…

A: A tetrahedral complex is created when a ligand binds to a cation Co2+The complex configuration of…

Q: The [Co(NH3)4Br2]Cl•H2O and [Co(NH3)4(H2O)Cl]Br2 complexes are examples of: Select one: a.…

Q: The number of unpaired electrons in dº, low spin, octahedral complex is-

A: Chemical compounds that consist of an arrangement of neutral molecules or anions that are bound to a…

Q: What is the oxidation number of the central ion in the coordination compound [Pt(NH3)4Cl2]Br2 ? O a.…

Q: How many isomers are possible for a tetrahedral complex [MA2BC]? а. О b b. 2 a с. 4

A: The number of isomers in tetrahedral complex having formula MA2BC are calculated as follows,

Q: What is the oxidation state of molybdenum in [n³-C6H6)Mo(CO)3]Cl? (atomic number of Mo is 42) a. +4…

Q: Which of the following ions could exist in only the high-spin state in an octahedral complex? Select…

A: A coordination compound in which there are unpaired electrons in the d orbitals of the central metal…

Q: Which of the following is the most stable complex? а. [Fe(CN)6]3- b. [Fe(CO)s] С. [Fe(C204)3]3- d.…

Q: or the square planar complex(es) (NH3)2PtCl2, which best possibilities? 2, Wh a. Two isomers exist,…

A: Given that (NH3)2PtCl2 is a square planar complex and it does exits in two isomers- Cis and Trans.

Q: The complex ion CoCl42- has a tetrahedral structure. How many d electrons are on the Co? What is its…

A: The atomic number of Cobalt Co = 27. The electronic configuration of Cobalt Co = [Ar] 3d7 4s2 (…

Q: Which of the following forms of isomerism can be exhibited by [Fe(H2O)3Cl3]? Draw and label those…

A: Given Compound ' [Fe(H2O)3Cl3] Type of isomerism shown by compound = to be determined

Q: What is the coordination number of the central ion? [Cr(H2O)6]+3 ? a. 3 O b. 6 с. 1 d. 2

A: Coordination number is the number of the ligands attached to the central metal atom or ion . for…

Q: Consider the coordination compound [FeCl2(NH3)4][FeBr4]. The geometry of the complex cation is…

Q: What is the name of the complex [Al(H2O)2Br4]? O none of these O bisaquaterbromoaluminate(lI) ion O…

A: Option B is correct

Q: How many ligands are found on the coordination compound: [Co(NH3)5CI]Cl2 ? O A. 8 B. 6 O C.4 O D.5

A: How many ligand found in the given complex ?

Question

Determine the shape of the complex, [MnBr2(en)2]
Select one:
O a. linear
O b. either tetrahedral or square planar
O c. tetrahedral
O d. square planar
Oe. octahedral

AI-Generated Solution

AI-generated content may present inaccurate or offensive content that does not represent bartleby’s views.

Unlock instant AI solutions

Tap the button
to generate a solution

Click the button to generate
a solution

SEE SOLUTION

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
For each d electron configuration, state the number of unpaired electrons expected in octahedral complexes. Give an example complex for each case. (Two answers are possible for some of these cases.) (a) d2 (b) d4 (c) d6 (d) d8
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
How many geometric isomers are possible for the square-planar complex ion [Pt(NH3)(CN)Cl2)?
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
What types of isomers are possible for the following compounds or complex ions? (a) K[Co(NH3)2Cl4] (b) Pt(en)Cl2 (square-planar) (c) [Co(NH3)5Cl]2+ (d) [Ru(phen)3]Cl3 (e) Na2[MnCl4] (tetrahedral) (f) [Co(NH3)5NO2)2+
Sketch and explain the most likely crystal field diagram for the following complex ion: Note: The CN ligand produces a much stronger crystal field than NH3. Assume the NH3 ligands lie on the z axis.