Determine the cell potential (E) from the following half-cells: Pbo/Pb2+ and Zno/Zn2+ where [Pb2+] = .86M and [Zn2+] = 0.35 M. Calculate K for this reaction. How long in hours would you have to let it go until you lower the voltage to 85 percent of the E from the Nernst equation at 7.2 amps?

Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.

At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.

At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.

Calculate the standard cell potential of the cell corresponding to the oxidation of oxalic acid, H2C2O4, by permanganate ion. MnO4. 5H2C2O4(aq)+2MnO4(aq)+6H+(aq)10CO2(g)+2Mn2+(aq)+8H2O(l) See Appendix C for free energies of formation: Gf for H2C2O4(aq) is 698 kJ.

Consider a cell in which the reaction is 2Ag(s)+Cu2+(aq)2Ag+(aq)+Cu(s) (a) Calculate E° for this cell. (b) Chloride ions are added to the Ag|Ag+ half-cell to precipitate AgCl. The measured voltage is +0.060 V. Taking [Cu2+]=1.0M, calculate [Ag+]. (c) Taking [Cl-] in (b) to be 0.10 M, calculate Kspof AgCl.

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?

An electrochemical cell consists of a silver metal electrode immersed in a solution with [Ag+] = 1.0 M separated by a porous disk from a copper metal electrode. If the copper electrode is placed in a solution of 5.0 M NH3 that is also 0.010 M in Cu(NH3)42+, what is the cell potential at 25C? Cu2+(aq)+4NH3(aq)Cu(NH3)42+(aq)K=1.01013

Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.

A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?