Correct1. Calculate the amounts of each reactant.2. Compare the ratio of reactants amounts to the stoichiometric ratio defined by the equation.1 mol Al2.70 g Al x0.100 mol Al26.98 g1 mol Cl25.33 g Cl, x0.0752 mol Cl270.90g0.100 mol Al1.33 mol Al2 mol Al0.0752 mol Cl21 mol Cl23 mol Cl2Cl, is the limiting reactant.b What mass of AICI3 can be produced?Mass =Submit

Answered: Image /qna-images/answer/1292b716-fbd3-4cc7-a09c-f875b58c218f.jpg

Correct 1. Calculate the amounts of each reactant. 2. Compare the ratio of reactants amounts to the stoichiometric ratio defined by the equation. 1 mol Al 26.98 g 2.70 g Al x = 0.100 mol Al 1 mol Cl2 5.33 g Cl2 x 0.0752 mol Cl2 70.90 g 0.100 mol Al 1.33 mol Al 2 mol Al 0.0752 mol Cl2 1 mol Cl2 3 mol Cl2 Cl2 is the limiting reactant. What mass of AlCl3 can be produced? Mass = Submit

Correct 1. Calculate the amounts of each reactant. 2. Compare the ratio of reactants amounts to the stoichiometric ratio defined by the equation. 1 mol Al 26.98 g 2.70 g Al x = 0.100 mol Al 1 mol Cl2 5.33 g Cl2 x 0.0752 mol Cl2 70.90 g 0.100 mol Al 1.33 mol Al 2 mol Al 0.0752 mol Cl2 1 mol Cl2 3 mol Cl2 Cl2 is the limiting reactant. What mass of AlCl3 can be produced? Mass = Submit

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: After performing the synthesis of aspirin, two groups of students got the following actual…

Q: laboratory. Initial Mass and Yield Sulfuric Acid Aluminum Hydroxide Initial Amount of Reactant…

Q: You place 3.24 g of iron filings into a test tube with an excess of sulfur, heat the mixture, and…

Q: In a laboratory experiment, the reaction of 3.0 mol of H2 with 2.0 mol of I2 produced 1.0 mol of HI.…

A: Given: Moles of H2 taken = 3.0 mol. Moles of I2 taken = 2.0 mol. And moles of HI produced = 1.0 mol.…

Q: Al + Fe2O3 → Al2O3 + Fe _KCIO3 _KCI + O2 _(NH4)2SO4 + _BaCl2→ _NHẠCI + _BaSO4 CH3OH CO2 + H2O

Q: Use the balanced equation for the combustion of ethane to complete the table. 2C2H6(g) +…

A: Since the balanced reaction given is 2C2H6(g) + 7O2(g) → 4CO2(g) + 6H2O(g) Hence we can say 2…

Q: A sample of 8.5 g NH3 on oxidation produces 4.5 g of NO. Calculate the percent yield. Reaction: 15%…

A: Amount of reacted = 8.5 gAmount of NO product formed (experimental yield or actual yield) = 4.5…

Q: 1. 3 4 5 6 7 8 9 10 11 12 13 14 15 Calculate the percent yield when: Theoretical yield = 4.5 g;…

Q: Balance the following chemical reactions: _____ CaCl2 + _____ AgNO3 → _____ Ca(NO3)2 + _____ AgCl…

A: Balancing of chemical reactions.

Q: Formula Amount of Molar Mass of Amount of Samples units or molecules mass(g/mol) sample(g) atoms…

Q: 1.5 kg Magnesium + 2 kg Water (purified) → 950 grams Milk of Magnesia 1. Balanced Chemical Equation…

A: Magnesium hydroxide is one of the inorganic compounds. Its chemical formula is Mg(OH)2. Naturally it…

Q: The actual yield can only be determined by: O Carrying out the reaction in a laboratory. Writing a…

A: We have been asked about determination of actual yield. We have been given four options and we have…

Q: The theoretical yield of a product is always calculated? True or False?

A: In the reaction, formed quantity of product based on taken quantity of reactants called theoretical…

Q: a. Convert the theoretical yield of Cu to units of mass (g). Show all calculations. b. Finally,…

A: tyuihjjj

Q: In the following reaction, oxygen is the excess reactant. SiCl4 + O2 → SiO2 + Cl2 The table shows…

A: Given that: For trial 1, Mass of SiCl4 = 120 g Mass of O2 = 240 g Actual yield = 38.2 g For trial 2,…

Q: balance this chemical reaction ____ C6H12O6 → _____CO2 + _____ C2H6O

A: Given : ___ C6H12O6 → ____CO2 + ____C2H6O To balance :- The given equation by writing…

Q: 2. What is the theoretical yield of sodium oxide if you start with 35g of calcium oxide? NaCl + Cao…

Q: A. Balancing Chemical Equations Write balanced equations for the following reactions, and make a…

A: In the given question ,three unbalance reaction is provided and we have to balance reaction at…

Q: Consider the following data. Determine the percent yield of copper. mass copper turning (g) 0.6929…

A: This can be calculated by using the following formula, Percent Yield = (Actual yield/Theoreticial…

Q: Chemistry The reaction between NH3 and Br2 produces N₂Br4 and HBr. What number of molecules of N₂Br4…

Q: What is the mass of 8.00 molesmoles of magnesium chloride, MgCl2MgCl2? Express your answer with the…

Q: What quantity in moles of precipitate will be formed when 80.0 mL of 2.00 M Nal is reacted with…

A: To solve this problem we have to calculate the mole of precipitate formed And know about actual and…

Q: 18. Reacting 8.85 g of SiO2 with excess carbon produces 2.25g of SiC. What percent yield? SiO2 +…

Q: Balance the following chemical equations. _____ H3PO4 + _____ Na2CO3 → _____ Na3PO4 + _____ H2O +…

A: We have to balance the given reactions.

Q: Suppose

A: Welcome to bartleby! Actual yield = 43.7 g Theoretical yield = 56.0 g

Q: 8. Consider the following balanced chemical equation: 2Na(s) + Cl2(g) → 2NaCl(s) If 4.12 mol of…

A: Since you have asked multiple type questions, we will solve only first questions for you. If you…

Q: For the sentence below answer the following questions: Q1) Change the sentence into a chemical…

A: In a chemical reaction there reactant and product both must be present. Each chemical reaction…

Q: A chemist recovers 2.76 L of CuSO4(s) in an experiment. What name is given to this volume? a)…

A: We have to calculate actual yield of Ca metal.

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

Correct
1. Calculate the amounts of each reactant.
2. Compare the ratio of reactants amounts to the stoichiometric ratio defined by the equation.
1 mol Al
2.70 g Al x
0.100 mol Al
26.98 g
1 mol Cl2
5.33 g Cl, x
0.0752 mol Cl2
70.90g
0.100 mol Al
1.33 mol Al
2 mol Al
0.0752 mol Cl2
1 mol Cl2
3 mol Cl2
Cl, is the limiting reactant.
b What mass of AICI3 can be produced?
Mass =
Submit

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the reaction, compute the theoretical yield of the product in moles for each of the following initial reactants. Ti (s) + 2 Cl2 (g) - TiCl4(s) Express your answers using two significant figures. a) 2 mol Ti; 2 mol Cl2 b) 5 mol Ti; 9 mol Cl2 C) 0.483 mol Ti; 0.911 mol Cl2 d) 12.4 mol Ti; 15.8 mol Cl2
If a reaction is run that is supposed to produce 125 g (theoretical yield) of product and the actual yield of product that was produced was 73.5 g, what is the percent of yield of this reaction? A. 170% B. 1.70% C. 73.5% D. 58.8%
the reaction of 15 moles of carbon with 30 moles of oxygen will result in a theoretical yield of ____ moles of CO2 is what?
ABS plastic is a polymer consisting of three monomer units: acrylonitrile (C₃H₃N), butadiene (C₄H₆), and styrene (C₈H₈). A sample of ABS plastic contains 11.9% N by mass. It took 1.56 g of Br₂ to react completely with a 2.00 g sample of ABS plastic. Bromine reacts 1:1 (by moles) with the butadiene units in the polymer and nothing else, so bromination is a method for determining the quantity of butadiene in the polymer. What is the percent by mass of styrene in the polymer?
The starting materials in a chemical reaction are called your "initial products". True False If the number of each type of atom on one side of the arrow differs from the number on the other side, the equation is still considered balance. True False Stoichiometry is the qualitative study of reactants and products in a chemical reaction. True False
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield
Balance the following chemical equations
How many moles of iron (Fe) will be produced from 6.20 moles of carbon monoxide (CO) reacting with excess iron (III) oxide (Fe₂O 23)? Fe₂O3 + 3C0→2Fe +3CO₂ A 4.13 mol Fe 00 B C 28.01 mol Fe 3.14 mol Fe 2.68 mol Fe
Sodium and chlorine react to form sodium chloride: What is the theoretical yield of sodium chloride for the reaction of 32.0 g Na with 107.2 g Cl2? A. 1.40 x 104 g NaCl B. 35.4 g NaCl C. 122 g NaCl D. 81.2 g NaCl
If 50 g of Iron(III) chloride react with 25 g of sodium hydroxide what is the maximum mass of Iron(III) hydroxide produced? FeCl3 + 3NaOH --> Fe(OH)3 + 3NaCl a. 0.208 grams b. 0.308 gramd c. 22.3 grams d 32.9 grams