Consider the following reaction which has a Kc= 47.2 at500 0C: H2 (g)+2(g)—2HI(g). H23123D0.250 M; HІ-ом 0.500.What will be the equilibrium concentrations of H2, I2, and2HI?

The given equilibrium reaction is as follows: H2(g) + I2(g) ⇌ 2HI(g). The initial…

Answered: Consider the following reaction which…

Consider the following reaction which has a Kc= 47.2 at 500 ОC: H2(g)+12(g)22HI(g). Н2%312%3D0.250 M; HI-0M 0.500. What will be the equilibrium concentrations of H2, I2, and 2HI?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: At a certain temperature, the equilibrium constant, Kc , is 0.00324 for the reaction…

A: A)The Kc expression for given reaction is as follows,

Q: The equilibrium constant, K, for the following reaction is 1.64×103 at 455 K. PCI5(g) PCI3(g) +…

A: EQUILIBRIUM constant is defined as the ratio of concentration of products to the ratio of…

Q: At 100 °C, the equilibrium constant for the reactionCOCl21g2 ∆ CO1g2 + Cl21g2 has the value Kc =2.19…

A: For a reversible reaction at any stage other than the equilibrium, the ratio of the products of the…

Q: 9. The following reaction is found to have a [O₂leq= 0.13. What is the equilibrium constant (to four…

Q: At 25 °C, K=2.2 x 10^-3 for the reaction shown below. Calculate the equilibrium constant for the…

A: The given reaction is : ICl(g) = 1/2I2(g) + 1/2Cl2(g) For the given reaction : K =…

Q: Be sure to answer all parts. The equilibrium constant (K) for the formation of nitrosyl chloride, an…

Q: Please use the values in the resources listed below instead of the textbook values. The following…

Q: The equilibrium constant K (i.e. Ke) for the following reaction equals 0.450 at 900 °C. 3 Fe) + 4…

Q: 1. Write the equilibrium constant expressions (K, and K) for the following reactions: 4NH,(g) +…

A: Write expression of Kc and Kp of the given reaction--

Q: The position of the equilibrium for a system where K = 4.6 × 10-3 can be described as being favored…

A: Given : equilibrium constant value ( K value) To find : Direction of equilibrium and concentration…

Q: If a 1.00 L container has 1.45 mol of trans-stilbene added to it, what are the concentrations of…

A: Concentration of trans-stilbene = mole/Volume (L) = 1.45/1 = 1.45 M Reaction Trans-stilbene…

Q: a. At equilibrium the concentrations of the ionized substances are: [C6H5NH₂] = 0.0537 mol/L…

A: Given , [C6H5NH2]=0.0537molL[C6H5NH3+]=4.79×10-6molL[OH-]=4.79×10-6molL

Q: For the following reaction, 2HI(g) --> H2(g) + I2(g) a. Write an equilibrium constant expression b.…

A: According to the question, The given reaction is, 2HI(g) → H2(g) + I2(g) The equillibrium constant…

Q: Determine the concentrations at equilibrium of the important species when 10.0 g ethanol (MW 46.07…

A: Consider the given balanced equation as; C2H5OH l + 3 O2 g ↔ 2 CO2 g + 3 H2O l…

Q: Suppose a 250. mL flask is filled with 0.30 mol of I, and 1.7 mol of HI. The following reaction…

A: Answer:For any reaction, value of equilibrium constant K is equal to the ratio of molar…

Q: 38. If the equilibium constants for the two reactions at 400 K: + ICl3 (g) = ICl;Br2 (g) Br2 (g) 2…

A: Given:

Q: cquilibrium constant expressions (F

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: At equilibrium, the concentrations in this system were found to be [N₂] = [0₂] = 0.100 M and [NO] =…

Q: Calculate the equilibrium concentration of NO2 given [O2]eq = 0.060M, [H2O]eq = 0.0478M, and [NH3]eq…

A: Reversible reactions proceeding inside containers after reaching a specified stage becomes stagnant.…

Q: At 500 K, the equilibrium constant for this reaction: X2(g) + 2Y2(g) =3Z2(g) is Kc = 0.222. At the…

A: Since,Equilibrium constant or Kc is the ratio of the equilibrium concentrations of product over…

Q: 9O2 + 2P3 yields 6PO3 What would the pressure be if there are 2.75 moles of each gas in a 2.31 L…

A: 9 O2 + 2 P3 --> 6PO3 Given: Moles of each gas = 2.75 moles Volume of the container = 2.75 L…

Q: Hello, I'm working on equilibriums, I'm not quite sure how to do this type of question with finding…

A: Given that, an equilibrium reaction is CO(g) + H2O(g) ↔CO2(g) + H2(g). Also, the equilibrium…

Q: 6.0 g of CO2 and 3.00 g of H2 are placed in a 3.00 L vessel at 395\deg C and the following reaction…

A: Given that,the given value of Kc is 0.802.The mass of The mass of Calculate equilibrium…

Q: What is the minim achieve equilibriu

Q: Consider the reaction below: 4HCl (g) 0:(g) 2C1: (g) + 2H₂O(g) Predict the direction of the…

Q: The reaction equilibrium constant N2 (g) + O2 (g) chemical balance NO (g) Kc = 1.00.10-5 at 1200 ºC…

Q: What is the equilibrium constant for equilibrium 2H2(g) + O2(g) 2H2O(l)

A: The equilibrium reaction for the formation of water is given. That is, 2H2 + O2 --------> 2H2O

Q: The K. for the formation of HI from iodine and hydrogen gas is 54. If the concentrations of HI, 12,…

Q: For the equilibrium reaction below K = 7.52 x 10 2CI2 (g) + 2H,O (g) 4HCI (g) + O2 (g) What is the…

A: for the given equilibrium reaction: 2Cl2(g) + 2H2O(g) ⇔ 4HCl(g) + O2(g) -1…

Q: The equilibrium constant K. for the equation CS2 (9) + 4H, (9) # CH4 (9) + 2H, S(g9) at 900°C is…

Q: Analysis of the gases in a sealed reaction vessel containing NH 3, 2, N, and H2 at equilibrium at…

A: Given, the equilibrium reaction as follows,N2(g)+3H2(g)⇌2NH3(g)and the equilibrium concentration of…

Q: Consider the equilibrium below A2lg) + B2lg) 2AB(g) where Kc = 57.7 If the following are the…

A: The given chemical reaction as follows,A2(g)+B2(g)⇌2AB(g)the equilibrium constant for the above…

Q: correct IUPAC name for CuClO

Q: Write the K expression for the following reaction

A: Given Reaction C2H5OH(g) + 3O2 (g) → 2CO2 (g) + 3H2O(g) Equilibrium Constant ( K )…

Q: The key step in the manufacture of sulfuric acid is the oxi-dation of sulfur dioxide in the presence…

A: The equilibrium reaction is: 2 SO2 (g) + O2 (g) ↔ 2 SO3 (g) Temperature, T = (727 + 273)K = 1000K…

Q: 6. To study the reaction between ammonia and oxygen, 4NH3(g) + 702(g)52N2O4(g) + 6H2O(g), A flask…

A: Given that , initially concentration of [NH3] = 2.40M [O2] = 2.40M And at equilibrium , [N2O4] =…

Q: Which of the following is true about finding the molar mass of potassium sulfate, K₂SO4? A. The…

A: The molar mass of a compound can be calculated by adding the standard atomic masses (in g/mol) of…

Q: For the reaction below, Kc = 1.10 x 10-8. What is the equilibrium %3D concentration of OH- if the…

A: The reaction given is HONH2 (aq) + H2O (l) ------> HONH3+ (aq) + OH- (aq)

Q: Consider the equilibrium reaction. H₂) 1₂(g) 2 HI(g) In this case, 1.000 M H₂ reacts with 2.000 M of…

A: Given - H2(g) + I2(g) <-> 2HI Moles of H2=1.000mol Moles of I2=2.000mol Kc=79

Q: For N₂O₄ (g) ⇋ 2NO₂ (g) at 300 K, Kc = 4.5 (standard state = 1 mol L⁻¹). In a mixture of these gases…

Q: H2 + Cl2 à HCl for which the equilibrium constant K = 320 at 150 C. Suppose 0.400 mol of H2…

Q: For the equilibrium reaction below K = 0.112. SO2 (g) + ½02 (g) = SO3 (g) What is the value of K for…

Q: At a certain temperature, 0.820 mol SO3 is placed in a 3.50 L container. 2 SO3(g) 2 SO₂(g) + O₂(g)…

Q: 0.750 mol of N, and 1.20 mol of H, are placed in a 3.00 liter container. When the reaction-N2(g) +…

A: To find the concentration of species at equilibrium, we need to create ICE table.

Q: Be sure to answer all parts. The equilibrium constant Kc for the reaction 2NH3(g) = N2(g) + 3H2(g)…

Q: The following reaction is important in the manufacture of sulfuric acid. SO2(g) + 1/2 O2(g) SO3(g)…

A: Given equilibrium reaction is SO2 (g) + 1/2 O2 (g) ⇔ SO3(g)…

Q: What is the value of K!2 for the following reaction? 250:(g) - O:g) = 25O) [so.] [so-}{o.] A K2=…

Question

Consider the following reaction which has a Kc= 47.2 at
500 0C: H2 (g)+2(g)—2HI(g). H23123D0.250 M; HІ-ом 0.500.
What will be the equilibrium concentrations of H2, I2, and
2HI?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step by step

Solved in 4 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the reaction, 2NH3(g)--> <---3H2 (g)+ N2 (g) the equillibrium concentrations were found to be [NH3 ]=0.250 M, [H2 ]=0.540 M, and [N2 ]= 0.750 M. What is the equilibrium constant for this reaction? Kc=?
Use the following set of reactions and equilibrium constants provided to determine the value of K for the reaction: H₂SO, (1) H₂S (g) + 3/2 O₂ (g) (T) a. H₂O (1) +SO₂ (g) = H₂SO) (1) b. S (s) + O₂(g) = SO₂ (g) c. S (s) + H₂O (1) H₂S (g) + 1/2 0₂ K₁ = 0.108 K₂ = 0.109 Ks = 0.123
9 Maps YouTube Grades for Kianna... 101 Chem101 Pratt O 3.65 O 5.66 x 103 O 13.3 O -0.0376 Question 9 At 1000 K, the equilibrium constant for the reaction 2No (g) + 02 (g) =Cl, (g) + H,O is Ko = 0.013. Calculate K, for the reverse reaction, 2HCI (g) + 02 (g) =Cl, (g) + H2O (g) O 0.99 O 1.6 x 10-4 O 1.1 O 7 O 0.013 Question 10 Consider the following equilibrium. 2 SO2 (g) + O2 (g) =2 SO3 (g) The equilibrium cannot be established when is/are placed in a
G.193.
H2+ F2 > HF for which the equilibrium constant K = 172 at 100 C. Suppose 0.300 mol of H2 and 0.600 mol of F2 were placed in a 3-liter vessel at 150 C. What will the concentrations of all species be once equilibrium is established?
What is the correct K, expression for the following reaction? N₂ (g) + 3 H₂ (g) = 2 NH₂ (g) O K₁ = [NH₂] O Kc = [Na][B₂] O K₁= O Ke [N₂] [H₂] [NH₂] = (NH₂)2 [N₂] [H₂]³ [Na] [H₂]³ (NH₂)2
4
Help me plsss.. *For the reaction N2(g) + O2(g) ↔ 2 NO(g), Kc = 4.080×10–4 at 2000 K. What is the equilibrium concentration of N2 and O2, for the reaction 2 NO(g) ↔ N2(g) + O2(g) if the initial concentration of NO is 0.1000 M? *Following the problem above, what is the equilibrium constant of the reverse reaction used? *Following the problem above, if the reaction is reduced to decomposition of 1 mole NO, what is the value of the equilibrium constant?
please don't provide handwrittin solution....
-96 At 700 °C, K.= 5.6 × 10 ° for the following reaction: %3| H,S (g) = 2 H2 (g) + S2 (g) Calculate K. value for the following reaction: 2 H2 (g) + S2 (g) H;S (g) 3 3 3
One mole of H;0 is heated to 3400 K at 3 pressure of 1 atm. Determine the equilibrium composition, assuming that only H20, OH, Oz, and H; are present.
A 13.4 L reaction vessel at 483°C contained 0.892 mol , H2, 0.620 mol I2, and 5.41 mol . HI. Assuming that the substances are at equilibrium, find the value of Kc at 483°C for the reaction of hydrogen and iodine to give hydrogen iodide. The equation is H2(g)+I2(g)->2HI(g) Kc=_________