Consider the coordination compound [Ni(C₂O4)2(H2O)2]Cl₂ and identify ligandsa. C₂04-2, CI-b. Ni, C₂04-2O c. Ni,He,d. H₂O, Hee.O f. C₂04-², H₂Og.

Answered: Image /qna-images/answer/ce1efca5-c7ba-4d5f-9506-5f2f5a6c2c29.jpg

Answered: Consider the coordination compound…

Consider the coordination compound [Ni(C₂O4)2(H₂O)2] Cl2 and identify ligands a. C₂04-2, CI- -2 O b. Ni, C₂04-² O c. Ni, He, d. H₂O, He e. f. C₂04-2, H₂O

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter19: Complex Ions

Section: Chapter Questions

Problem 52QAP: A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600...

See similar textbooks

Related questions

Q: 5. Identify isomer types that are possible for the following complex ions and coordination…

A: The answer is given below

Q: What is the formula of the coordination compound containing anion [Fe(OH)6]3- and cation Na+ ? a.…

A: Anion = [Fe(OH)6]3- Cation = Na+ To write the formula of coordination compound: Step 1. Write the…

Q: The complex below shows the symptoms of hydration isomerism.... a. [Co(H2O)4Cl2]Cl.H2O b.…

Q: 6. How many d electrons do each of the following transition metals in the coordination complexes…

A: Solving the first question with 3 subparts as per guidelines for further assistance please post the…

Q: Which one of the following compounds it IS a coordination complex? a.H3PO2 b.Na3[FeCl(CN)5]…

Q: What is the formula of the cation for coordination anion [Fe(OH)G]3 ? O a. NH3 O b. K* O c. Ni O d.…

A: Coordination compound is formed by a complex ion and a simple oppositely charged ion. In complex ion…

Q: Which of the following pairs are coordination isomers? O A. [PtCl4(H2O)2]Cl2 and [PtCl3(H20)2]Cl3 B.…

Q: What is the formula of the coordination compound containing cation [Co(NH3)5H2O]*+3 and the anion…

Q: What would you expect the coordination sphere for the complex ion formed from Ni^2+ and…

A: In coordination chemistry, the first coordination sphere refers to the array of molecules and ions…

Q: • Name these coordination complexes: •a. Cr(NH3);Cl3 •b. Pt(en)Cl, • . [Pt(ox),]? а. С.

A: a. Given, Cr(NH3)3Cl3 Name => Triamminetrichloridochromate(III)

Q: Which of the following pairs are coordination isomers? O A. [PtCl4(H2O)2]C12 and [PtCl3(H2O)2]Cl3 O…

A: coordination isomer : When both cation and anion are complex, in a coordination compound , then the…

Q: Consider the coordination compound Na4[Fe(ONO)2(ox)2]. 1. Write the chemical formula of the three…

Q: Consider the coordination compound [Pt(NH3)4(OH)2]SO4 and identify ligands ? a. NH3 , OH- O b. OH ,…

A: Ligands in the above coordinated complex are given below

Q: Consider the coordination compound [Pt(NH3)4(OH)2]sO4 and identify ligands ? O a. O b. NH3 , SO4 O…

A: [Pt(NH3)4(OH)2]SO4

Q: What is the formula of the coordination compound containing cation [Cu(NH3)4]2+ and the anion Cl- a.…

A: When compound C will be dissociate the cation and anoin will be [Cu(NH3)4]2-+ and Cl-…

Q: Consider the coordination compound [Ni(C204)2(H20)2]Cl2 and identify ligands O a. H20, CI- O b. C204…

Q: What is the formula of the coordination compound containing anion [Fe(OH)6]4- and cation K+ ? a.…

Q: 2. Give the correct systematic name for each of the following coordination compou a.…

A: Coordination compounds are formed between the transition elements and negatively charged ligands.…

Q: What is the formula of the cation for coordination anion [Zn(OH)4]²- ? а. НСО3 b. K+ с. Ni d. SiO2 O…

Q: Name these coordination compounds. formula Na [AUCI, (H₂O)] [VC1,(CO),]C!, [PtBr₂ (NH₂). Cl₂ name 0…

A: 1) Na[AuCl4(H2O)2]The name of this coordination compound is Sodium tetrachloroaurate(III)…

Q: H2C2O4.2H2O + K2Cr2O7 → K[Cr(C2O4)2(H2O)2].2H2O What is the role of oxalate ion in this reaction…

A: Given reaction; H2C2O4.2H2O + K2Cr2O7 → K[Cr(C2O4)2(H2O)2].2H2O On balancing the equation;…

Q: What is the oxidation number of the central ion in the coordination compound [Pt(NH3)4Cl2]Br2 ? O a.…

Q: at is the formula of the coordination compound containing anion [Fe(OH)6]3- and ion Na* ? а.…

A: Which one of the following is correct answer

Q: Consider the coordination anion [Al(OH)6]-3 How many possible geometric isomers are there? a. Only…

A: Here the ligands is same. So there is not possible any geometrical isomer

Q: chain theory, the complex compound K2[CrCO(CN)5] is an electrolyte by releasing A. 2 K+ ions B. 1…

A: We have to tell which option is correct from given choices of options by telling how given compound…

Q: What is the oxidation number of the central ion in the coordination compound K4[Fe(CN)6] ? O a. 0 O…

Q: Consider the coordination compound Na4[Fe(ONO)2(ox)2] A. Indicate the oxidation state, coordination…

Q: What is the formula of the cation for coordination anion [Zn(OH)4]2- ? а. НСО3 O b. K+ O c. Ni O d.…

A: Here, coordination anion have two negative charge . So to satisfy its 2 negative charge we need a…

Q: Name these coordination compounds. formula Na [AuC1₂(H₂O)₂] [VC1,(CO),]C! [PiBc. (NH₂), ]CL₂ name 0…

A: Sodium tetrachloroaurate(III) dihydrateDichlorobis(carbonyl)vanadium(IV) chloride…

Q: 6) Determine the type of isomerism. Choose from Coordination isomerism, linkage isomerism, geometric…

A: The coordination complexes show various types of isomerism which are as follows- 1- Coordination…

Q: What is the coordination number of the central ion? [Cr(H2O)6]+3 ? a. 3 O b. 6 с. 1 d. 2

A: Coordination number is the number of the ligands attached to the central metal atom or ion . for…

Q: What is the formula of the anion for coordination cation [Ag(NH3)2]* ? a. Ci b. NH3 c. Na+ O d. CO2…

A: The given coordination ion, [Ag(NH3)2]+ has +1 charge. In this coordination cation, the central…

Q: Consider the coordination compound [FeCl2(NH3)4][FeBr4]. The geometry of the complex cation is…

Q: Consider the coordination compound, K2[Cu(CN)4]. Between which species a coordinate covalent bond…

Q: Consider the coordination compound [Cr(H,O),Cl]CI and calculate the the coordination number of the…

A: Coordination number: Coordination number of a metal ion in a complex can be define as the number of…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

Consider the coordination compound [Ni(C₂O4)2(H2O)2]Cl₂ and identify ligands
a. C₂04-2, CI-
b. Ni, C₂04-2
O c. Ni,
He,
d. H₂O, He
e.
O f. C₂04-², H₂O
g.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

(a) Name this coordination compound: [Ag(NH3)2]NO3. (b) Write the formula of pentaaquaisothiocyanatoiron(III) chloride.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
The complex ion PdCl42is diamagnetic. Propose a structure for PdCl42.
What is the mass percent of sulfur in the [Ag(SCN)2-]complex ion?
A certain coordination compound has the simplest formula PtN2H6Cl2. It has a molar mass of about 600 g/mol and contains both a complex cation and a complex anion. What is its structure?
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.
Give the electron distribution in low-spin and/or high-spin complexes of (a) Ru4+ (b) Pt2+
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]