CH,OH Br NaOH b. Br 1. Mg, diethyl ether d. HI ONa Br H,0 OH PBr,

Q: 6. Which statement describes the atoms and mass in a chemical reaction? Oa. The mass and the number…

A: In a chemical reaction, the number of atoms remains same on the both side of the reaction that is…

Q: 1. CuSO4.5H2O + O2 (heated)_______ + H2O  CUSO2 CuSO4 Cu2SO2 2. FeSO4.7H2O is called _____________.…

A: The given sulfates are hydrated sulfates of transition metals.

Q: Solve the attached Problem.

A: The given reaction is represented as follows:

Q: Limestone is mostly consist of CaCo, You find that a sample of limestone weighing 153 mg gives 147…

A:

Q: Br2 (xs), CH3CO,H b.) Br Br3C CBr3

A: In an acidic medium ketone from enol react with bromine and gives mono-bromination. Then acetate…

Q: 12. Explain the stoichiometry (mole ratio of reactants) of this reaction. OH 3 + BH3 b. H2O2, OH

A: The given reaction is the hydroboration of but-2-ene. It is an oxidation reaction.

Q: b. CHO HO -H HO -H CH3OH HCL, A H- -OH H- OH CH₂OH C. HO OH OH 1. KCN,HỌ 2. H2SO4, H2O, A 3. Na(Hg)

A: b. In this reaction, the starting compound is a diol (a compound with two hydroxyl groups). The…

Q: Classify each hydrocarbon as an alkane, alkene, or alkyne. b. H3C-CH=CH-CH3 a. HC=CH d. H,C-C=C-CH,…

A: Note: Since you have posted a question with multiple subparts, we will solve the first three…

Q: vvnicn of the following reactions is a syntnesis reacTioN: O a. Li 2 0 + H 20 - 2 LIOH O b. 2KCIO3 -…

A:

Q: A. 2 H NaOH

A:

Q: Me. EtO₂C CO₂Et Me NaOEt EtO₂C Me

A:

Q: rtobstodafo I nominoq В. Determination of NaCl 86.096 1. Mass of evaporating dish #2, watch glass,…

A:

Q: Complete and balance each combustion reaction equation. a. S(s) + Oz(g) c. Ca(s) + O,(g) b. C,H(8) +…

A: (a) S(s)  + O2 (g) → SO2 (g)    (b) C3H6(g)  + 92O2 (g) → 3CO2 (g)  + 3H2O(l)    (c) 2Ca(s)  + O2…

Q: H,C HN-CH2 CH3 H2 C HC H2 CI H3C H2 CH.

A: The reaction is a nucleophilic substitution reaction.

Q: H,0, H* .COOH H,PO, 1. Оy 1. BH, KMnO4 KMNO4 2. H,O, OH 2. Zn, H2O

A: Hello. Since your question has multiple parts, we will solve the first question for you. If you want…

Q: Н Br 2.Nacn 2.NaOH, H2, 3.НЗ ОТ - ?

A: Given,The reaction:

Q: 37. Find the number of millimoles of solute in 3.0 L of 3.76 x 10-3 M KMN04. * a. 11.28 millimoles…

A:

Q: Br Meo Meo Me

A:

Q: 20. Determine the molar mass of NH3 and H2O. Then determine the number of moles of H2O in 6.01grams.…

A:

Q: tilanes, Cll, is a spe ihai iKSCin in fnita. Ii is sla: kratwn "lad agur berDE i is ieune in bl:ad…

A: Molality (m): Molality is the number of moles of solute present in one kilogram of solvent.

Q: The base that used in preparing shaving creams is .? O a. Nacl а. O b. NH3 C. КОН O d. NAOH

A: Shaving cream is a type of cosmetics. The main function of using shaving cream is to remove hair. It…

Q: iv. ОН MgBr ОН

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question…

Q: CI CI, CI NaOH CI. CI O. CI CI

A:

Q: One gram of each of the following compounds is mixed with 100mL of water. Which will form solutions…

A: Solutions of : Cu(OH)2PCl5Ca(CH3CO2)2C3H8NaNO3

Q: Determine the molecular formula of a compound

A:

Q: OH NH₂ 1. PCC 2. TSOH a.

A:

Q: Find the Mass of 3.65 x10² mole K,SO,?

A: Number of moles of K2SO4 = 3.65 × 10–2 mol  Molar mass of K2SO4 = 174.26 g/mol

Q: H Identify the element that has the highest mass percent composition in C,H120. Он Oc Identify the…

A: Applying concept of%mass of elements.

Q: 2. Percentage Composition a. % of water in Iron (III) phosphate tetrahydrate b. % of hydroxide ions…

A: A). Molecular weight of FePO4 .4H2O = 222.88 g/mol Molecular weight of four  moles H2O = 4×18.015 =…

Q: d. HO CH₂CH-C3 NH₂ I 01 N-CHCH₂ OCH 3

A:

Q: Which of the following is a product of the reaction below? NaOCH, CH;OH Select one:

A: In presence of Nucleophile,  epoxide undergo ring opening reaction.  As at transition state,…

Q: 5. 20 a LDA Η,Ο

A:

Q: d. HNO3/H2SO4 Br Na HN solvent f. SO₂H g. CI b, CuCh AICI H₂O'

A: Reactions goes through Electrophilic aromatic substitution reaction (d, f, g).Reaction (e) goes…

Q: 51 Caffeine Caffeine, found in coffee, tea, chocolate, cola beverages is a highly popular stimulant…

A: Note - “Since you have posted a question with multiple sub-parts, we will solve first three…

Q: What is the molarity of a solution prepared by dissolving 26.2 g of KCI in enough water for a total…

A:

Q: Which of the following compounds is a electrolyte? O A. water O B. dihydrogen monoxide C. copper…

A: The electrolyte is a substance that produces ions in its aqueous solution and conducts electricity.…

Q: g. h. i. H₂ Pd/C 1. BH3, thf 2. H₂O2, NaOH Br

A:

Q: 2 KMN0, + 16 HCI → 2 KCI + 2 MnCl, + 8 H,0 + 5 Cl, a. What is the ratio between KMnO, and H,0? 4:2 1…

A: In given balance reaction , ratio of compounds eaisly calculated

Q: 1. H;O* 2. , рyridine

A:

Q: The law of conservation of mass states that A. Matter is neither created nor destroyed B. The mass…

A: Answer: Law of conservation of mass is one of the fundamental laws used for chemical calculation.

Q: Br ОН 1. LiAIH4 2. H2O OCH3 ОН Br 1. 2. H2O MgCl ОН

A: j) The reagents and products are shown below:

Q: The composition of a commercial cold remedy mixture is 87% aspirin, 7% caffeine, 6% vitamin C. What…

A: Mixture composition  87% aspirin 7% caffeine 6% vitamin C Mass of mixture that has 5 g Caffeine =?