CH3CH2CH2-N-CH2CH3 Name: Submit NH-CH2CH3 Name:

Q: hat are three properties of acids and three properties of bases?

A: To give the three properties of both acids and bases.

Q: Provide the correct systematic name for the compound shown here.

A: The basic skeleton of IUPAC nomenclature: Prefix + Parent carbon + suffixParent carbon: Te longest…

Q: proper name of this compound

A:

Q: Give the common names for each compound H3C- HO HO common name: common name: common name:

A: Common name is the name by which a organic compound is familliar to public rather than its…

Q: Give the systematic name of the compound below.

A: We have to predict the name of given compound.

Q: Name the following compound:

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: What is the common name of the following compound?

A: The given compound is an ether.

Q: Name the following compound S.

A:

Q: a) describe with chemical equation how to prepare the following compound

A: Chemical equation: 2-phenyl-1-pyrroline was selectively dehydrogenated to 2-phenylpyrrole using…

Q: ot

A: The IUPAC names of the above given compounds are as follows:

Q: provide the correct systemic name for the compound shown here

A: Given,The molecule is:

Q: Give the TUP AC name of the compound

A:

Q: What is the correct IUPAC name for HC₂H₃O₂(aq)?

A: We have to predict the IUPAC nomenclature.

Q: Provide the correct systematic name for the compound shown here. Y

A: Rules for IUPAC naming of ether: 1. The alkyl group with shorter carbon chain is considered as…

Q: N.

A: IUPAC Rules for NomenclatureFind and name the longest continuous carbon chain.Identify and name…

Q: What is the chemical name of the following structure? OX

A: The objective of the question is to determine the chemical name of the given structure.

Q: What is the chemical name of Laughing gas?

A: The chemical name of laughing gas is given in step two.

Q: Systematically name the following compounds.

A: According to IUPAC nomenclature, first we have to select the longest carbon chain as parent…

Q: what is name this

A: The purpose of this question is to explain the nomenclature of given compound which represents two…

Q: II III

A: General formula: it is a representation  where formula of organic compound is written in such a…

Q: None

A: Let's analyze the given reaction to predict the products:CH3-N(CH3)-CH2-C(OH) +…

Q: G) CH3 H;CH,C

A:

Q: What are the different types of Isomers?

A: Isomers can be divided into two broad categories, one is structural isomerism and another is…

Q: Identify the systematic name

A: The name of given compounds is given using IUPAC nomenclature rules.

Polymers

Polymers are naturally occurring or synthetically produced large molecules or compounds which are made up of series of repeating units called monomers. They are joined together by chemical bonds. The term polymer is coined from Greek roots meaning 'many parts' and are found almost everywhere from the plastics bags to the rubber of our tires to our DNA strands.