Part ACalculate the standard cell potential for each of the followingelectrochemical cells.Standard Electrode Potentials at 25 °CCa2tag) + Mg(s)→Cd(s) + Mg²taq)Reduction Half-ReactionE°(V)Express your answer using two decimal places and include the appropriate units.Cd2 (ag) + 2 e- → Cd(s)-0.40Mg²(ag) + 2 e- → Mg(s)-2.37Templates Symbols uado redo resat keyboard shortcuts help2 H (ад) + 2 е H2(9)Zn2tag) + 2 e- → Zn(s)EoValueUnits-0.76cell=РЬ?ад) + 2 е > РЫ()-0.13NO3 (aq) + 4 H(aq) + 3 e → NO(g) + 2 H2O(1)SubmitRequest Answer0.96Part B2H (aq) + Zn(s)→H2(g) + Zn²(ag)Express your answer using two decimal places and include the appropriate units.Templates Symbols undo redo reset keyboard shortcuts helpEcell=ValueUnitsSubmitRequest Answer

Answered: Image /qna-images/answer/75701a16-5326-4fba-9e05-44ae8d4381cf.jpg

Answered: Calculate the standard cell potential…

Calculate the standard cell potential for each of the following electrochemical cells. Standard Electrode Potentials at 25 °C

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 133CWP: Consider a galvanic cell based on the following half-reactions: a. What is the expected cell...

See similar textbooks

Related questions

Q: A galvanic (voltaic) cell consists of an electrode composed of nickel in a 1.0 M1.0 M nickel(II) ion…

Q: A galvanic (voltaic) cell consists of an electrode composed of chromium in a 1.0M chromium(III) ion…

A: To calculate Standard potential , we use formula : E°cell = E°r ( cathode ) - E°r (anode )

Q: Cd\Cď²* (aq) (0.100M) || Ag* (aq)(0.25M)|Ag(s)

A: A numerical problem based on electrochemistry, which is to be accomplished.

Q: If the free energy of an electrochemical process is +12 kJ/mol and n=3, what is the standard cell…

Q: Under standard conditions, the ΔGo of the reactants for a given redox reaction is measured to be…

A: Since the relationship between the Eocell and the ΔGo is given by ΔGocell = -nFEocell where n =…

Q: Consider the following standard electrode potentials: Ag*(aq) + e E→ Ag(s); E° = 0.80 V Mn2*(aq) +…

A: Under standard state condition, E°cell = Ereduction - Eoxidation = 0.80 V…

Q: A galvanic (voltaic) cell consists of an electrode composed of magnesium in a 1.0 M magnesium ion…

Q: A galvanic (voltaic) cell consists of an electrode composed of chromium in a 1.0 Mchromium(III) ion…

A: Here we are required to find the standard cell potential of the given electrochemical reaction

Q: Calculate the cell potential, ε for this galvanic cell and ΔG for the cell reaction these…

A: The cell reaction is Overall reaction is given by,

Q: A galvanic cell consists of a Mg electrode in 1 M Mg(NO3)2 solution and a Ag electrode in 1 M AgNO3…

A: Given- Electrodes Mg in 1 M Mg(NO3)2 solution Ag in 1 M AgNO3 solution Temperature = 25 °C To…

Q: A galvanic (voltaic) cell consists of an electrode composed of zinc in a 1.0 M1.0 M zinc ion…

A: In the given galvanic cell, we have electrodes as 1) electrode composed of zinc in a 1.0 M zinc ion…

Q: A galvanic (voltaic) cell consists of an electrode composed of iron in a 1.0 M iron(II) ion solution…

A: Oxidation is the process that involved the loss of electrons and oxidized to cation. Hence when a…

Q: What does a negative standard cell potential imply about the reaction?

A: The potential difference between the cathode and anode half cell under the standard conditions of…

Q: A galvanic (voltaic) cell consists of an electrode composed of iron in a 1.0 M1.0 M iron(II) ion…

Q: A galvanic cell is set-up in the laboratory with a copper anode and an unidentified cathode. Your…

Q: How are standard electrode potentials measured?

A: Standard electrode potential is referred to Eo of a cell and is in an electrochemical cell at a…

Q: The Nickel-Cadmium battery cell has a standard potential of 1.2 V. What is the standard free energy…

A: The relation between Gibbs free energy change and emf of cell is given by, ∆G = -n F Ecell Ecell is…

Q: what is the standard cell potential (in Volts) for a a galvanic cell that can do 567 kJ of work. The…

A: The solution is as follows :

Q: Write the balanced chemical equation for the spontaneous redox reaction. Include states of matter.…

A: The objective of the question is to-a) Write the balanced chemical equation.b) Determine the…

Q: A galvanic (voltaic) cell consists of an electrode composed of iron in a 1.0 M iron(II) ion solution…

A: Answer: the standard potential for this cell at 25°C is 1.96 V.

Q: At 298 K a cell reaction has a standard cell potential of +0.17 V. The equilibrium constant for the…

A: Given: T = Temperature in K = 298 K E = standard emf = 0.17 V K = equilibrium constant = 5.5 X 105…

Q: A galvanic (voltaic) cell consists of an electrode composed of aluminum in a 1.0 M aluminum ion…

A: Galvanic cell is an electrochemical cell that converts chemical energy via spontaneous redox…

Q: A galvanic cell is set-up in the laboratory with a copper anode and an unidentified cathode. Your…

Q: A galvanic (voltaic) cell consists of an electrode composed of nickel in a 1.0 M nickel(II) ion…

A: Standard potential for this cell, E°cell = E°cathode-E°anode Now, E°(Ag+/Ag) = 0.80 V E°(Ni2+/Ni)…

Q: At 298 K a cell reaction has a standard cell potential of+0.17 V. The equilibrium constant for the…

A: At 298 K a cell reaction has a standard cell potential of +0.17 V. The equilibrium constant for the…

Q: Balance the following reactions. Calculate the cell potential and the Gibbs free energy of these…

A: The oxidation number represents the number of electrons gain or loses by an element to become…

Question

Part A
Calculate the standard cell potential for each of the following
electrochemical cells.
Standard Electrode Potentials at 25 °C
Ca2tag) + Mg(s)→Cd(s) + Mg²taq)
Reduction Half-Reaction
E°(V)
Express your answer using two decimal places and include the appropriate units.
Cd2 (ag) + 2 e- → Cd(s)
-0.40
Mg²(ag) + 2 e- → Mg(s)
-2.37
Templates Symbols uado redo resat keyboard shortcuts help
2 H (ад) + 2 е H2(9)
Zn2tag) + 2 e- → Zn(s)
Eo
Value
Units
-0.76
cell=
РЬ?ад) + 2 е > РЫ()
-0.13
NO3 (aq) + 4 H(aq) + 3 e → NO(g) + 2 H2O(1)
Submit
Request Answer
0.96
Part B
2H (aq) + Zn(s)→H2(g) + Zn²(ag)
Express your answer using two decimal places and include the appropriate units.
Templates Symbols undo redo reset keyboard shortcuts help
Ecell=
Value
Units
Submit
Request Answer

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 3 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
For the standard cell potentials given here, determine the ?G for the cell in k].. (a) 0.000V,n=2 (b) +0.434V,n=2 (c) -2.439 V, n = 1
The standard potential, E, for the reaction of Zn(s) and Cl2(g) is +2.12 V. What is the standard free energy change, rG, for the reaction?
Use the data from the table of standard reduction potentials in Appendix H to calculate the standard potential of the cell based on each of the following reactions. In each case, state whether the reaction proceeds spontaneously as written or spontaneously in the reverse direction under standard-state conditions. (a) H2(g)+Cl2(g)2H+(aq)+2Cl(aq) (b) Al3+(aq)+3Cr2+(aq)Al(s)+3Cr3+(aq) (c) Fe2+(aq)+Ag+(aq)Fe3+(aq)+Ag(s)