Calculate the equilibrium constant at 37oC for the reaction Glucose + 6O2 + 36ADP + 36Phospate → 6CO2+ 42H2O +36ATP ... ... ... Gibbs free energychange of Go= − 423 kcal/mole of Glucose

Q: Construct the expression for Kp for the following reaction. Ti(s) + 2 Cl2(g)= TICI:(1)

A: The expression for Kp for the following reaction has to be constructed

Q: alculate the equilibrium constant of the reaction CO(g) + 2 H2S(g) CS2(g) + H2O(g) + H2(g) from…

A: If a reaction is formed by addition of two reactions at equilibrium, then the equilibrium constant…

Q: For the reaction 2 SO2(8) + O2(g) = 2 SO3(8), which of the following is the correct…

A: For any general reaction, aA + bB ------> cC + dD, the equilibrium constant expression is written…

Q: Calculate the equilibrium constant of the reaction in which glutamine is formed -O2CCH (NH3 +)…

A: When two reaction equations are added to give a third reaction equation, then the equilibrium…

Q: Calculate Kc or Kp: CH4(g)+H2O(g)->CO(g)+3H2(g) Kp=7.7x10^24 (at 298 K)

A:

Q: What is the concentration of SO42-ions in the solution of silver sulphate with a Kçç value of…

A: Given: Mass of silver sulphate = 3 g                                             Kc = 1.1 × 10-5 The…

Q: Calculate the equilibrium constant at 37°C for the reaction Glucose + 60, + 36ADP + 36Phosphaten…

A: ∆G˚ = -423 kcal/mol At equilibrium, ∆G = 0. Conversion of temperature from ˚C to K:

Q: If glucose, phosphate, and glucose-6-phosphate are combined in concentrations of 4.8, 4.8, and 0.25…

A: Equilibrium constant -  For hypothetical reaction, equilibrium constant is equals to ratio of…

Q: Calculate the equilibrium constant for the phosphorylation of glucose to glucose 6-phosphate at 37.0…

A: In the phosphorylation of glucose, glucose in presence of ATP reacts to form glucose 6-phosphate…

Q: Calculate the Gibbs free energy change (AG) for the following chemical reaction: glutamate + NH:…

A: Here we have to calculate change of Gibbs free energy of the following reaction. where given…

Q: onsider the reaction: 2 NH3(g) N₂(g) + 3H₂(g). At T = 740 K, the equilibrium constant Kc for this…

A: Kc is equilibrium constant and it is equal to concentration of product divide by concentration of…

Q: For the triose phosphate catalyzed reaction: dihydroxyacetone phosphate glyceraldehyde-3-phosphate…

A: Given:  ΔGº=7.53 kJ/mol.

Q: The reaction N2O4−⇀↽−2NO2 is allowed to reach equilibrium in a chloroform solution at 25 ∘C . The…

A: The equilibrium constant can be calculated from the given reaction is

Q: he equilibrium constant Kc for the reaction  fructose-1,6-diphosphate ⇋ glyceraldehyde-3-phosphate…

A: Given Reaction:- fructose-1,6-diphosphate⇋glyceraldehyde-3-phosphate + dihydroxyacetone phosphate

Q: The enzyme aldolase catalyzes the conversion of fructose-1,6-diphosphate (FDP) to dihydroxyacetone…

A: Given that, the enzyme aldose catalyzes the conversion of fructose-1,6-diphosphate (FDP) to…

Q: The following equilibria were measured at 823 K:CoO(s) + H2(g) ⇌ Co(s) + H2O(g)  Kc = 67H2(g) +…

A: Since your question has multiple sub-parts, we are solving only first three sub-parts for you. If…

Q: 3) Based on the information below, determine the value of the unknown equilibrium constant, Kc. 4…

A: The given data is as follows: 4CO2(g) + 2H2O(g) → 4O2(g) + 2CH2CO(g)              Kc'=3.7×1017…

Q: Which of the following statements are true and which arefalse? (a) For the reaction 2 A1g2 + B1g2 ∆…

A: From the above reaction, we can predict that

Q: for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius calaculate Kc

A:

Q: 9. Calculate the Kc of the following equilibria: S2(g) + Cs) +→ CS29); Kp= 28.5 at 500K

A: Kc can be calculated as follows

Q: Given K, = 7.2 Kp = 7.1 x 101 C2H6O(g) + 302(g)= 2cO2(g) + 3H20(g) 2C2H,O(g) + 502(g)= 4CO2(g) +…

A:

Q: An 90 kg subject consumed a snack that contained 80 g of carbohydrate.  Before eating the snack the…

A: The extracellular water may be described as the amount of the water available in the outside blood…

Q: Calculate a value for the equilibrium constant for the reaction O2 (9) + O(g) = 03 (g) given hv NO2…

A: Given  NO2(g)   ⇌  NO(g)   +  O(g)                                    K1    =  5.1 × 10-49 O3(g)   +…

Q: Calcium ions bind to a Ca2+-ATPase which has two identical calcium sites, in two stages with…

A:

Q: For the aqueous reaction CH2OH H- он ČH2- dihydroxyacetone phosphate = glyceraldehyde-3-phosphate…

A: Delta g is approximately -1.16 kJ/mol

Q: Write the equilibrium expression for the reaction…

A:

Q: The equilibrium constant Kc for the reaction fructose-1,6-diphosphate = glyceraldehyde-3-phosphate +…

A: We have to find out the standard Gibbs free energy and change in Gibbs free energy for the given…

Q: Consider The Following Reaction: CaCO3(S) + 2HCl(Aq) = CaCl2(Aq) + H2O(L) + CO2(G)  Write down the…

A:

Q: Use the following equilibria 2CH4(g)  C2H6(g) + H2(g) Kc1 = 9.5 × 10-13 CH4(g) + H2O(g)  CH3OH(g) +…

A:

Q: Calculate the equilibrium constant for the phosphorylation of glucose to glucose 6-phosphate at 37.0…

A: In the phosphorylation of glucose, glucose in presence of ATP reacts to form Glucose 6-phosphate…

Q: Consider the following reversible reaction at equilibrium: C6H12O6(aq) + 6 O2(g)      6 CO2(g) + 6…

A: According to the le chatelier's principle, the reaction shifts in the endothermic direction when the…

Q: Glucose-1-phosphate = glucose-6-phosphate AGo = - 7.3 kJ mol-1 Glucose-6-phosphate =…

A: