Calculate the absolute value of the voltage across a biological membrane that has12 mM, all other conditions[Na] outside = 140 mM and [Na+] insidebeing standard.A. 65.6 mVB. 0.00 mVOC. 300 mVD. 63.1 mV=

The absolute value of the voltage across a biological membrane can be calculated using the Nernst…

Calculate the absolute value of the voltage across a biological membrane that has mM and [Na+] inside = 12 mM, all other conditions [Na] outside = 140 mM = 140 being standard. O A. 65.6 mV B. 0.00 mV C. 300 mV D. 63.1 mV

Calculate the absolute value of the voltage across a biological membrane that has mM and [Na+] inside = 12 mM, all other conditions [Na] outside = 140 mM = 140 being standard. O A. 65.6 mV B. 0.00 mV C. 300 mV D. 63.1 mV

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter22: Bulk Electrolysis: Electrogravimetry And Coulometry

Section: Chapter Questions

Problem 22.28QAP

See similar textbooks

Related questions

Q: Consider a single fuel cell operates on pure hydrogen and generates 2A current output. [F=96,485…

Q: A current of 0.500 A flows through a cell containing Cd(II) for 10.0 minutes. Calculate the maximum…

A: Current Strength = 0.500 A time = 10 min = 10 × 60 sec (As, 1…

Q: When the Cut concentration is 8.58 x 10 M, the observed cell potential at 298 K for an…

A: The concentration of [Zn2+] is 1.104 M

Q: Consider the following cell at 25°C: 2+ Pb|Pb²+ (a = 0.1)||Hg₂²+(a = 0.1)|Hg(1)|Pt The data is as…

Q: 2. A lamp draws a current of 2.0 A.Find the charge in coulombs used by the lamp in 30 s.

A: Given - Current = 2A Time = 30 sec To find out - The charge in coulomb used by the lamp in 30 sec.

Q: 2. Consider the reaction MnO2(s) + 4H*(aq) + 2Br(aq) → Mn²*(aq) + Br2() + 2H2O«1) At what pH is the…

A: Given Reaction,MnO2(s) + 4Hag+ + 2 Br(aq)- → Mn(ag)2+ + Br2(l) + 2H2O(l),Write nearest equation for…

Q: A concentration cell is constructed with two Zn1s2-Zn2+1aq2 half-cells. In one half-cell 3Zn2+4 =…

A: Given information: Concentration of Zn2+ = 1.35 M Concentration of Zn2+ in other cell = 3.75×10-4 M

Q: The initial potential you measure is 219.3 mV and the temperature of the solution is 23.8 Celsius.…

Q: c. Calculate the voltage of the cell using the standard values from reference tables. Ni/Ni² with…

A: Since the reference table has not been provided, thus standard values are taken on the own.

Q: d. Calculate the standard cell potential, AE".

A: the cell potential is defined as the difference between the potential of the two half cell in an…

Q: A galvanic (voltaic) cell consists of an electrode composed of magnesium in a 1.0 M magnesium ion…

A: In an electrochemical cell, the chemical energy due to the chemical reactions is converted into…

Q: A nonstandard cell or half-cell potential can be calculated using the Nernst equation: RT InQ nF E=…

A: Ans.

Concept explainers

Potentiometric Titrations

Potentiometric titration is one of the important titration methods and is mainly carried out to characterize acid solutions. It follows a method similar to that of the normal titration technique, but the main difference is that there is no indicator used in the potentiometric titrations. Instead of using an indicator, electrodes are employed for monitoring the whole titration process. A scientist named Robert Behrend did the potentiometric titration for the first time, and it was done using the mercurous solution and potassium chloride.

Question

100%

Calculate the absolute value of the voltage across a biological membrane that has
12 mM, all other conditions
[Na] outside = 140 mM and [Na+] inside
being standard.
A. 65.6 mV
B. 0.00 mV
OC. 300 mV
D. 63.1 mV
=

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

A 0.0712-g sample of a purified organic acid was dissolved in an alcohol-water mixture and titrated with coulometrically generated hydroxide ions. With a current of 0.0392 A, 241 s was required to reach aphenolphthalein end point. Calculate the equivalent mass of the acid.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
A chemical engineering student is studying the effect of pH on the corrosion of iron. Ellie following data are collected: Corrosion Rate (mm/year) ph 0.03 13.00 0.06 12.00 0.16 11.00 0.22 10.00 0.25 9.00 0.25 8.00 0.25 7.00 0.25 6.00 0.25 5.00 0.27 4.00 0.37 3.00 0.38 2.80 0.63 2.80 1.00 2.80 Plot corrosion rate vs. pH. (HINT: Label the x axis with decreasing pH.) (a) How would you describe the dependence of corrosion on pH? (b) When the pH goes below 3, bubbles appear in the solution. What change takes place in the reduction half-reaction at low pH? (c) How do you explain the shape of the curve at the lowest pH? (Based on a graph in the Kirk-Otbmer Encyclopedia of Chemical Technology, 4th ed., vol 7. New York: John Wiley & Sons, p. 559.)
An alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?
The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
28 Calculate standard electrode potential and Gibbs free energy of the cell: Ga | Ga³+ || Ag* | Ag a. b. C. d. 1.23 V; -285 kJ 1.43 V; -365 kJ 1.33 V; -385 kJ 1.53 V; -265 kJ
Chegg.... Grades f... Grades f... 0 O ELECTROCHEMISTRY Using the Nernst equation to calculate nonstandard cell voltage Workshe... A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2+ 2103 (aq) +12H* (aq) + 5Co (s) → 1₂ (s) + 6H₂O (1) + 5 Co²+ (aq) x10 Suppose the cell is prepared with 4.59 MIO3 and 4.70 M H in one half-cell and 7.33 M Co 2+ Calculate the cell voltage under these conditions. Round your answer to 3 significant digits. 0.0 X A ALEKS -... μ 00 www-awy.aleks.com M Sign In I... 5 2. h Hulu | Pr... in the other. Home
Determine the potential of a platinum electrode (vs. SHE) when placed in a mixture of 0.00207 M TICI, and 0.0362 M TICI at 25 °C. T13+ (aq) + 2e- = TIt (aq) E° = 1.25 V EPt = V Determine the potential of a platinum electrode when placed in a mixture of 0.0137 M potassium permanganate (KMNO,) and 0.0667 M manganese chloride (MnCl,) at pH 5.46 and 25 °C. Mno, (aq) + 5e- + 8 H* (aq) = Mn²+ (aq) + 4 H, O(1) E° = 1.51 V Ept = V
Calculate the expected voltage Fe | Fe+3 (0.056 M) || Pd+2 (0.64 M) | Pd