Balance the following equations using whole number coefficients. a)_______Al + Cl2 AIC13 b)___K2CO3 +_______ HCl KCl + _______ H2O + CO2

Q: Given: + _NO +___H₂O ___NH3 + ___O2 -- --> ___NO How many moles of ammonia (NH3) are required to…

A: The moles of ammonia(NH3) required = 2.89 mol

Q: Step by step please,  thanks

A: Question

Q: Determine the mass in grams of 1.6 x 10-3 mol glucose C.H12O.

A: Given, number of moles of glucose =1.6×10-3 moles =0.0016 moleswe are asked to calculate the mass of…

Q: What is a Coefficient used in the formula below? 4Fe, (CO,)5 3.

A: In mathematics co-efficients are usually a number which is used as a multiplying factor and placed…

Q: marble Question 4 1. Write the following equations in words: a) KOH + HCI → KCI + H₂O b) ZnO + H₂SO4…

A: 1. a) When potassium hydroxide (base) reacts with hydrochloric acid (acid) , then potassium chloride…

Q: Consider the following unbalanced chemical equation. CSH12() + O2(g) → CO2(g) + H20(1) If 46.1 grams…

A:

Q: Balance the following equation by filling the gaps with appropriate numbers. Ca + HCI CaCl2 H2

A:

Q: Be sure to answer all parts. Calculate the percentage composition by mass of each of the elements in…

A:

Q: 1 MnO2 + 4 HCI → 1 MnCl2 H2O + 1 Cl2

A: The given Chemical Equation can be balanced as follows:

Q: In the room, the police also found a suspicious amount of CO2 in the air, which is produced when…

A: Combustion reactions of methanol is 2CH4O+3H2O→2CO2+4H2O 2 mole of methanol is producing 2 moles of…

Q: Label the following parts of the chemical equation below: coefficient, subscript, products,…

A: Solution:

Q: What mass of ammonia is formed when 5.36 g of nitrogen gas reacts with excess hydrogen gas? Multiple…

A: Given,  5.36 g nitrogen gas is reacted with excess hydrogen.  Thus, N2 is limiting reagent.

Q: 1. ВН3-THF 2. H202, NaOH e) MgBr 1. 2. Hао*

A: In the reaction between alkene and BH3, THF; H2O2, OH-, the addition of H and OH takes place on the…

Q: MOLE RATIOS IN CHEMICAL EQUATIONS LEARNING OBJECTIVES This laboratory exercise and its accompanying…

A: Given,

Q: Beryllium #3 #3 #3 Add Here! Aluminum #3 #3 #3 #3 Add Here! Phosphorous #3 #3 #3 #3 Add Here! Oxygen…

A: Electron dot structures are diagrams that show how the valence electrons of atoms in a molecule are…

Q: QUESTION 2. In their proper order from left to right and using the smallest set of whole numbers,…

A: According to the law of conservation of mass, the quantity of each element does not change in a…

Q: CH3CH₂CH(CH2CH3)CH₂CH₂CH3 Draw the molecule on the canvas by choosing buttons from the Tools (for…

A: Given -> 1-> CH3CH2CH(CH2CH3)CH2CH2CH3 2-> CH3CH(CH3)CH2CH2OH

Q: IV. Determine the percentage of CaCO3 in an antacid tablet. HCI (aq) + NaOH (aq) → NaCl (aq) + H2O…

A: Given :Reaction : Objective :Determine the percentage of CaCo3 in the antacid tablet

Q: eq Interpret the following equation for a chemical reaction using the coefficients given: I2(g) +…

A:

Q: 1. Determine the percent composition by mass of all elements in Mn₂05. 2. Determine the percent by…

A: We have to calculate the percent composition of the given compounds

Q: 3. Why must the filter paper be dried before obtaining the final mass?

A: Answer-3 Filter paper is a type of semipermeable paper that has many tiny pores that allow only…

Q: This is a not graded pre test, I just need the blanks in the BCA table based off the balanced…

A: The balanced chemical equation for combustion of propane  C3H8(g) + 5O2(g)  --------> 3CO2(g) +…

Q: Insert the missing coefficients to completely balance each chemical equation S + 6HNO_{3} ->…

A: Given,S + 6HNO₃ ⟶ H₂SO₄ +  6NO₂ + 2H₂O3Cu+8HNO3 ⟶ Cu(NO3)2 + NO + H₂O

Q: 12) Which set of coefficients correctly balances this chemical equation? _P + _02→ _P,0,

A:

Q: what is the right order of coefficient  Choose the right order of coefficients to balance the…

A: The right order of coefficient needs to be written to balance the following unbalanced equation:…

Q: 1. What coefficients would balance the following equation? Al +_02 → _Al203 O A. 2AI + 302→ 1A1203…

A: The answer to following question-

Q: 2 H2 (9) + O2 (9) 2 H20 (g) Hydrogen gas and oxygen gas react to form water vapor as shown in the…

A: The balanced reaction given is, =>

Q: Write the net ionic equation, including phases, that corresponds to the reaction Zn(NO3)₂(aq) +…

A:

Q: When the following equation is balanced using the smallest possible integers, what is the number in…

A: The number in front of Iron is 9.

Q: #1 #2 #3 Mass of flask + oxalic acid 64. 987 68.455 64.074 Mass of flask 64.681 68.152 63. Fole Mass…

A: The number of moles of solute to the volume of solution in liter is known as molarity.

Q: Gaseous methane (CH,) will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (CO,)…

A: Given : Mass of CH4 = 0.96 g Mass of O2 = 7.53 g  To calculate :-  Mass of H2O (in grams)

Q: How many grams of sodium chloride could be produced

A: When two reactive compounds are mixed, then they react according to the stoichiometry of the…

Q: 18se0 Chapter 9 Limiting and Excess Reactants Feb 28, 2022 at 10:05 AM Name/Date Lacey Boswell…

A: This question is related to topic "limiting reagent".  Limiting reagent is the reagent that is…

Q: Predict In a reaction, there must be the same number of atoms of each element in the reactants as in…

A:

Q: Oxygen gas is a diatomic molecule. How many mole are contained in 4.23×10exp14 molecules of oxygen…

A: This problem can be solved by knowing that one mole of any substance contains6.022×1023 particles.

Q: Toluene (C7H8), a common organic solvent, combusts with oxygen...

A: According to the Law of Consevation of mass " all atoms of various elements must be equal in both…

Q: How many formula units are present in 5 moles of Al2S3 ? [?] x 10 fun. Al₂S3 Make sure your answer…

A: Formula units are nothing but the number of atoms present in the particular moles of a compound. Use…

Q: Calculate the number of grams of xenon in 3.145 g of the compound xenon tetrafluoride. mass of…

A:

Q: 2/5 Liquid hexane (CH3(CH2)¸CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon…

A:

Q: 2 NazPO4 ( ) + CaCl2 ( ) – NacI ( ) + Ca3(PO4)2 ( ) Fill in the remaining coefficients to properly…

A: sodium phosphate reacts with calcium chloride to form sodium chloride and calcium phosphate…

Q: Talking: Balancing of Chemical Equations 1) Type of chemical reaction Nitrogen (g) + Hydrogen (g) -→…

A:

Q: What is the molality of thium ions in a 0 302 m solution of LiPO. assuming the compound dissociates…

A: We know , # Molality = moles of substance/ mass of Solvent in Kg   The molality of Li3PO4 = 0.302 m…

Q: Nuclear engineers use chlorine trifluoride in the processing of uranium fuel for power plants. This…

A: Given,The unbalanced equation:Cl2 (g) +  F2 (g)   ClF3 (g)mass of Cl2 = 53.3 gmass of F2 = 114.0 g

Q: AtomIs Molar mass Molels Element loaal 23 12.04X 10 29 c3546 63.5462 copper Gold 393.942 Ag Au…

A: From molar mass we can calculate the no of atom present in the molecules .

Q: Glycine is an amino acid with the formula C₂H, NO₂. Determine the number of moles of carbon in 21.67…

A: Mass of glycine = 21.67 gMolar mass of glycine ( C2H5NO2 ) = 75 g/mol

Q: Balance the following equation by writing the coefficient for HF() BF3(g). H20(1) B203( s) + HF() →…

A:

Q: Base on these two tables, answer the following questions  a) How many grams of baking soda will you…

A:

Q: Hydrates have the general formula: CxAy•z H₂O where z designates the number of water molecules in…

A: Hydrates have the general formula:CxAy.zH₂Owhere z designates the number of water molecules in one…

Q: Balance the equation by inserting coefficients as needed. ___C2H6O+____O2⟶___CO2+____H2O

A: Balancing the equation by inserting coefficients

States of Matter

The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates). 

Chemical Reactions and Equations

When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.