**Title: Understanding Chemically Non-equivalent Hydrogens****Introduction:**In organic chemistry, identifying chemically non-equivalent hydrogens in a compound is essential for understanding its chemical behavior and interactions. Non-equivalent hydrogens experience different electronic environments, leading to unique signals in NMR spectroscopy.**Problem Statement:**How many kinds of chemically non-equivalent hydrogens are there in each of the following compounds?**Compound Analysis:****a. Compound Structure:**- Structure: A linear chain with a benzene ring.- Description: The compound features a hydroxy group (OH) attached to a CH2 group, which is linked to a benzene ring.- Task: Determine the number of chemically non-equivalent hydrogens by assessing hydrogen positions and electronic environments.**b. Hydrolysis Product of Solanaceae Alkaloid Atropine:**- Structure: A bicyclic structure with nitrogen and oxygen heteroatoms.- Description: The compound displays a nitrogen atom bonded to a methyl group (CH3) and features a hydroxyl group (OH).- Task: Identify the number of chemically non-equivalent hydrogens considering the complex ring structure and heteroatom effects.**Explanation:**In each compound, different hydrogen atoms may reside in distinct chemical environments due to various factors such as proximity to functional groups, hybridization of the carbon they are attached to, and overall 3D molecular conformation. Identifying these non-equivalent hydrogens is crucial for interpreting chemical reactivity and spectroscopic data.**Educational Objective:**Through the analysis of these compounds, students will enhance their ability to detect and distinguish chemically non-equivalent hydrogens, a fundamental skill in spectral analysis and structural determination in organic chemistry.

Proton-NMR spectroscopy is mainly used for the identification of complete structure of the compound.The number of signals appearing in NMR spectrum corresponds to number of non-equivalent sets of protons present in the compound. The number of non-equivalent sets of protons represents the number of signals appeared in NMR spectrum.The non-equivalent sets of protons of the given compound "a" are labelled as below. The number of chemically non-equivalent hydrogens are 7. The non-equivalent sets of protons of the given compound "b" are labelled as below.Protons labelled as C are two methylene (-CH2-) equivalents.The protons labelled as E are endo protons. The protons labelled as F are exo protons. The number of chemically non-equivalent hydrogens are 7. a The number of chemically non-equivalent hydrogens are 7. bThe number of chemically non-equivalent hydrogens are 7.

Answered: b OH CH-CH₂-CH- & OH Hydrolysis product…

Science

Chemistry

b OH CH-CH₂-CH- & OH Hydrolysis product of the Solanceae alkaloid Atropine The number of chemically non-equivalent hydrogens is The number of chemically non-equivalent hydrogens is

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: 16-49 How many acidic hydrogen the following carboxylic acids? a. Pentanoic acid c. Succinic acid…

A: Note: As per our company guidelines, we are supposed to answer only 1st question at a time. Kindly…

Q: Classify each of the following salts as an amine salt or a quaternary ammonium salt. 17-72 CH3 a.…

Q: Which compound is able to produce a meal product when it reacts with bromine?

Q: are products of the reaction between H3BO3 and NaOH?

A: When acid react with base it forms salt and water , this reaction is known as neutralization…

Q: What are the products of the neutralization of benzoic acid with sodium hydroxide? Select one or…

Q: How many kinds of chemically non-equivalent carbons are there in each of the following compounds? a…

A: The number of signals in the carbon-13 spectrum is equal to the number of different types of carbon…

Q: 1. Name the following compounds using IUPAC nomenclature. a. C-OH CH2CH2CH,CH,CH3 NHCH3 b. CH3CHCCH3…

A: IUPAC nomenclature of carboxylic acid- Carboxylic acid contains a hydroxyl group attached to the…

Q: What is the IUPAC name of the following compound? Ph HO. O 5-methyl-5-phenylhexanoic acid O…

A: Option A. 5-methyl-5-phenyl hexanoic acid

Q: Rank the following compounds in order of increasing water solubility. The first compound in your…

A: The solubility of a compound depends on the nature of the solute and the solvent. If the nature of…

Q: Name the IUPAC of the water formed in the combinations: Cinnamic acid + ethanol -> ? Salicylic acid…

Q: CH,CH,CH,-OH Draw the structure of the product expected when each of the following alcohols is…

A: All the reactions of alcohol given in the question are dehydrogenation reactions.

Q: Give the IUPAC name for the following acid amide: CH3CH2CH(CH3)CH2CH(CH3)CH₂C NH2

A: Structure of acid amide:find out IUPAC name

Q: At the pH of the aqueous environment in the cells, carboxylic acids exist primarily in their lonized…

A: Given

Q: O: CO

A: Hydrolysis is the chemical breakdown of substances by water. It is a structure of succinic…

Q: The substance 2-methylpiperidine is a weak nitrogenous base like ammonia. Complete the following…

A: Given,The reaction:

Q: Give the IUPAC and common name of this carboxylic acid

A: The longest Chain is selected as the parent Carbon chain with the maximum number of substituents.…

Q: 1. 4 HCl

A: two moles of each cyclopropane N ethyl chloride will react each other to give desired product and…

Q: What type of reaction is occurring in the following? 0 H HIC-OH HO-C-H HIC OH H-C - OH CH₂OH -> Ni…

A: Various reactions takes place

Q: Draw the structural formulas for the carboxylic acid chloride molecule used to make each of the…

Q: Draw the condensed structural formula for all products obtained from the following Hydrolysis…

A: The triglyceride react with KOH to undergo hydrolysis and produce one mole of glycerol and 3 moles…

Q: What is the IUPAC name for the following compound? CI 4-ethyl-3,5-dimethylhexanoyl chloride O…

A: First identify functional group. Choose longest carbon chain. Numbering of molecule. Position of…

Q: Draw the structures of the products from the hydrolysis of each of the following with NaOHNaOH.

Q: Sodium hexanoate acid

A: We have to draw the structural formula for the following compound

Q: What are the products of the following hydrolysis? a primary amine and an aldehyde O a primary amine…

A: The objective of the question is to identify the products of hydrolysis when different types of…

Q: COOH Br 5. C2H5CH(C3H7)(CH₂)2COOH 4. CH3

A: Rules for IUPAC naming: Select the longest chain which contains carbon-carbon single bonds. Given…

Q: /hich of the following is the strongest carboxylic acid? ) 2-chloropropanoic acid ) 2-bromopropanoic…

Q: A C O A B.

A: Which one of the following is correct answer

Q: aqueous sodium bromide yo form a pracepitate? Pb(C2H3O2) aq LiNO3 aq KCl aq NH4 aq

Q: Draw structural formulas for the major organic product reaction

Q: 11. Write the chemical reaction for the acid hydrolysis of each amide sample. Include the condensed…

A: Acid hydrolysis of amide gives carboxylic acid and salt of ammonia .

Question

**Title: Understanding Chemically Non-equivalent Hydrogens**

**Introduction:**
In organic chemistry, identifying chemically non-equivalent hydrogens in a compound is essential for understanding its chemical behavior and interactions. Non-equivalent hydrogens experience different electronic environments, leading to unique signals in NMR spectroscopy.

**Problem Statement:**
How many kinds of chemically non-equivalent hydrogens are there in each of the following compounds?

**Compound Analysis:**

**a. Compound Structure:**
- Structure: A linear chain with a benzene ring.
- Description: The compound features a hydroxy group (OH) attached to a CH2 group, which is linked to a benzene ring.
- Task: Determine the number of chemically non-equivalent hydrogens by assessing hydrogen positions and electronic environments.

**b. Hydrolysis Product of Solanaceae Alkaloid Atropine:**
- Structure: A bicyclic structure with nitrogen and oxygen heteroatoms.
- Description: The compound displays a nitrogen atom bonded to a methyl group (CH3) and features a hydroxyl group (OH).
- Task: Identify the number of chemically non-equivalent hydrogens considering the complex ring structure and heteroatom effects.

**Explanation:**
In each compound, different hydrogen atoms may reside in distinct chemical environments due to various factors such as proximity to functional groups, hybridization of the carbon they are attached to, and overall 3D molecular conformation. Identifying these non-equivalent hydrogens is crucial for interpreting chemical reactivity and spectroscopic data.

**Educational Objective:**
Through the analysis of these compounds, students will enhance their ability to detect and distinguish chemically non-equivalent hydrogens, a fundamental skill in spectral analysis and structural determination in organic chemistry.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Proton-NMR spectroscopy

VIEW

Step 2: a) Number of non-equivalent sets of hydrogens

VIEW

Step 3: b) Number of non-equivalent sets of hydrogens

VIEW

Solution

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Draw the major organic product for the acid hydrolysis of cyclohexanimine. "NH Hgo+ HO
Complete the equation for each hydrolysis reaction. Draw all reactants and products. - benzoic acid + NaOH - CH3C=OOCH2CH2OC=OCH3+ 2NaOH
What reagent serves as the source of H₂S? Oxalic Acid Ammonium Hydroxide Sulfur Acetate Thioacetamide
Identify the most acidic carboxylic acid. O ICH2COOH BrCH2COOH O FCH2COOH O CICH2COOH
Draw the reactants and products formed in the following acid-base neutralization reaction (carboylic acid salt formation): Butanoic acid + Potassium hydroxide ––>
The other group are the alkaloids. Regardless of structure, alkaloids have a number of characteristics in common. What are TWO?
are products of the reaction between H3BO3 and NaOH?
What is the name of the product formed by the titration of butylamine? Group of answer choices butyl ammonium ion butonium ion butanamide butylamide hydrogen butylamine butane amine ion
What is the IUPAC name of the following compound? NO2 Br COH O 2-nitro-6-carboxybromobenzene O 2-bromo-1-nitro-4-benzoic acid O 2-bromo-4-carboxynitrobenzene O 3-bromo-4-nitrobenzoic acid
Which of the following compounds is known as acetic acid? O O O O CH₂-C-H CH₂-CH₂OH OH CH₂-C-OH H O CH₂-C-OH
Name the following carboxylic acid by the IUPAC system of nomenclature: OH
Please answer question 18 Part A, B, and C