An initial state before reaction of CH4 and Cl2 is shown in the figure. Based on the balanced equation and the figure, what is the limiting reactant? CH4(g) + 4CI2(g) – CCI4(g) + 4HC((g) O A. CCI4 O B. Cl2 O C. HCI O D. CH4 8) 8

An initial state before reaction of CH4 and Cl2 is shown in the figure. Based on the balanced equation and the figure, what is the limiting reactant? CH4(g) + 4CI2(g) – CCI4(g) + 4HC((g) O A. CCI4 O B. Cl2 O C. HCI O D. CH4 8) 8

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: Iron reacts with chlorine to form iron(III) chloride according to the following reaction. 2Fe(s)…

Q: What amount (in mol) and what mass (in g) of water can be produced when 82.1 ug of ethane reacts…

A: The reaction considered is, C2H6 (g) + O2(g)→H2O(l)+CO2(g) The balanced equation of this reaction…

Q: Initial state before reaction of CH4 and CL2 is shown in the figure based on the balanced equation…

Q: The combustion of ammonia in the presence of excess oxygen yields NO2 and H2O:…

Q: 100. Is it possible for a reaction to occur with a yield that is greater than 100%? Why or why not?

Q: ZA + 3B → C 4.0 mol A is mixed with 4.0 mol B and a reaction takes place. Which reactant is…

Q: a. For the following unbalanced equation, calculate how many moles of the second reactant would be…

A: The balanced chemical reaction of cobalt and fluorine is as follows: 2Cos + 3F2g → 2CoF3g The…

Q: 8. The white circles represent H, and the black circles represent N. Reactonts Products 3 H2 + 1 N2…

A: In any reaction some moles of reactants react with each other to produce some moles of products. The…

Q: Consider the following unbalanced equation: ___ Al4C3 + ___ H2O…

A: The balanced equation is Al4C3 + 12 H2O ------> 4 Al(OH)3 + 3 CH4 From the balanced equation…

Q: Consider the following reaction: 24+B-3C+D 3.0 mol A and 2.0 mol B react. What is the limiting…

A: The limiting reagent for a reaction is the reagent that is totally consumed in it. The limiting…

Q: ChatGPT ChatGPT To determine the amount of Al2O3Al2O3 produced from the reaction of 0.30…

A: The objective of the question is to determine the amount of Al2O3 produced from the reaction of 0.30…

Q: Carbon dioxide can be created by burning carbon in oxygen: C + O2 → CO₂2 Approximately how many…

A: Given reaction, C + O2 → CO2

Q: MISSED THIS? Watch KCV. Limiting Reactant. Theoretical Yield and Percent Yield .WE Limiting Reactant…

A: The chemical reaction given is:.From the diagram,There are 6 CH3OH and 11 O2.

Q: A sample of 8.5 g NH3 on oxidation produces 4.5 g of NO. Calculate the percent yield. Reaction: 15%…

A: Amount of reacted = 8.5 gAmount of NO product formed (experimental yield or actual yield) = 4.5…

Q: Find the limiting reactant for each initial amount of reactants. 4 Al(s) + 3 0,(g) → 2 Al,O;(s) a. 1…

A: A reactant that is consumed totally in a chemical reaction is considered to be the limiting…

Q: In the reaction 2KCIO, - 2KCI + 30, potassium chlorate is heated to produce potassium chioride and…

A: Option; C) 2.4 moles is correct. Given reaction; 2KClO3 -----> 2KCl + 3O2 Given moles of…

Q: Consider the reaction between ammonium and oxygen: 4 NH3 (e) + 5 O2 (2) --> 4 NO () + 6 H20 () A…

A: The theoretical yield can be calculated by knowing the limiting reagent and then applying the…

Q: Using the balanced equation for the combustion of acetylene, answer the following questions.…

Q: Expired. The timer will continu Remaining Time: 49 minutes, 02 seconds. * Question Completion…

A: We have to find coefficient of Al2S3 in given equation

Q: In the balanced reaction, CH4 + 2 O2 CO2 + 2 H20, how many moles of CO2 will be produced when 0.50…

Q: A reaction mixture initially contains 0.25 moles of ZnS and 0.25 moles of O2. After the reaction is…

Q: 1. For the reaction shown, find the limiting reactant for each: 4 Al (s) + 3 O2 (g) → 2 Al203 (s) a.…

A: The specie which is present in less amount is the limiting reagent.

Q: In the reaction A+B--> C, the following information applies. At the beginning of the reaction there…

Q: Consider the following reaction Ca(s) + 2HCI(aq) --> CaCl,(aq) + H2(8) How many moles of HCl are…

A: Calcium metal reacts with hydrogen chloride to form calcium chloride and hydrogen gas. The equation…

Q: An initial state before the reaction of CH4 and Cl2 is shown in the figure. Based on the balanced…

A: We know that, Limiting reagent means number of moles is less. So,.

Q: 2AI + ? H₂SO4 Al₂(SO4)3 + 3H₂ 36. Balance the chemical equation above. Which coefficient must be…

Q: Balance the following reaction. Use the lowest possible numbers. Be sure to put a number in every…

Q: 3. If 50.0 g of O2 are mixed with 50.0 g of H₂ according to the balanced reaction below, what mass…

A: A question based on mole concept. A balanced equation for the formation of water from H2 gas and O2…

Q: Consider the following balanced reaction: Pb(s) + 2 Cl;(g) → P6CI,(s) Starting with 30.0g of Cl2 and…

A: Consider the following balanced reaction: Pb(s) + 2Cl2(g) → PbCl4(s) The mass of Cl2 given = 30.0 g…

Q: In the reaction of 28 g NO2and 18 g H20 by the chemical equation: NO2 (g) + H2O (1)→HNO; (1) +NO (g)…

A: a) A balance chemical equation for this reaction is given as follow 3NO2 (g) +…

Q: Combining 0.315 mol Fe,0, with excess carbon produced 18.0 g Fe. Fe,0, + 3C - 2 Fe + 3 CO What is…

Q: What mass in grams of Na solid is required to completely react with 19.2 L of Ch gas at STP…

A: Given, Reaction : 2Na(s) +Cl2(g) →2 NaCl(s) Volume of CI2 = 19.2 L

Q: In the reaction between FeCl, and NaOH, the spectator ions are A) Fe3 and Ch B) Fe3 and OH- C) Na*…

A: Given: Reaction between ferric chloride and sodium hydroxide To find: spectator ions Solution:…

Q: e limiting reagent?

Q: Use the reaction equation to answer the question. C (s) + H20 (g) CO (g) + H2 (g) The water-gas…

A: a balanced equation is an equation for a chemical reaction in which the number of atoms for each…

Q: Consider the reaction between ammonium and oxygen: 4 NH3 ) + 5 02 (e) --> 4 NO () + 6 H20 ) A…

A: In this question answer does not matched any of the above option.The answer of this question should…

Q: Part B What to do: Read and analyze the given chemical equation of the reaction. The combustion of…

Q: a. For the following unbalanced equation, calculate how many moles of the second reactant would be…

A: The balanced chemical reaction between cobalt and fluoride is as follows: 2Cos + 3F2g → 2CoF3s The…

Q: If you have 10 moles for each reactant which will be limiting reactant ? theck if its balance not…

Q: nitrogen

A: We will use stoichiometry of the reaction to get the answer

Q: For the following reaction: C3H8(g) + O2(g) ------> CO2(g) + H2O(g) d.…

A: Consider mass of propane and oxygen as 20g Balanced reaction is: Molar mass of C3H8 is 44 g/mol…

Q: According to the balanced reaction below calculate the moles of NH3 that form when 4.2 mol of N2H4…

Q: Balance each of the following reaction ___ C4H8 (g) + ___ O2 (g) à ___ CO2 (g)…

A: In Balanced reaction number of each atom on reactant side should be equal to number of each atom on…

Q: The theoretical yield of Mg(OH)2 when the reaction below was performed in the laboratory, was 3.45…

Q: In the reaction of Fe 3 O 4 with carbon to form carbon dioxide and iron, the number of moles of carb…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

An initial state before reaction of CH4 and Cl2 is shown in the figure. Based on the balanced equation and the figure, what is the limiting reactant?
CH4(g) + 4CI2(g) → CCI4(g) + 4HCI(g)
O A. CCI4
O B. Cl2
O C. HCI
O D. CH4

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the following reaction, 3.37 grams of hydrogen gas are mixed with excess ethylene (C₂H4). The reaction yields 44.1 grams of ethane (C₂H6). hydrogen (g) + ethylene (C₂H4) (g). →→→→ethane (C₂H6) (g) What is the theoretical yield of ethane (C₂H6) ? What is the percent yield for this reaction ? Submit Answer % grams Retry Entire Group 2 more group attempts remaining
The image represents the reaction between a certain number of molecules of H2 and O2.If the maximum amount of H2O is formed during the reaction, what is the leftover reactant?
Stoichiometry
10. Balance the equation for the combustion of butane, C,H,. C.H10 + O, > со, + H2O a. If 31.4 grams of butane burn according to this reaction, how many grams of oxygen would you need to ensure all the butane burned? (112 g O,)
session.masteringchemistry.com MyLab and Mastering Course Home MasteringChemistry: Chapter 8 I Review | Constants | Periodic Table Iron(III) oxide reacts with carbon monoxide to produce iron and carbon dioxide. Fez 03 (s) + 3CO(g)→2Fe(s) + 3CO2 (g) Part A Part B What is the percent yield of carbon dioxide if the reaction of 75.7 g of carbon monoxide produces 88.3 g of carbon dioxide? Express your answer with the appropriate units. HẢ ? The percent yield of CO, = Value Units Submit Request Answer Provide Feedback Next >
Consider the reaction between ammonium and oxygen: 4 NH3 () + 5 02 ()> 4 NO ) + 6 H20 (m A chemist allows 6.20 g of NH3 and 16.6 g of O2 to react. Determine the theoretical yield of NO for the reaction. 12.5 9.83 10.9 O 11.2
Consider the generic chemical equation: 2 A + 4 B = 3 C What is the limiting reactant when each of the initial quantities of A and B are allowed to react? 1.) 2 mol A; 5 mol B 2.) 3 mol A; 4 mol B
What are the coefficients in front of each species when this reaction is balanced? ___C(s) + ___CaO(s) → ___CO2(g) + ___CaC2(s) List them in order, separated by commas. Include a "1" if necessary. Example: 2, 1, 3, 2
Given the combustion of gasoline: 2C8H18 + 25 O2 →16CO2 +18H2O How many moles of O2 is required to react with 4.00 moles of C8H18? Select one: a. 2.00 b. 50.0 c. 25.0 d. 12.5
How many grams of N2 are needed to completely (stoichiometrically) react with 222 g of Br2 ? N2 + 3 Br2 2 NB13 + 44.0 kJ The molar mass of Br2 is g and the molar mass of N2 is mol Br2 (2.22 x 102 g Br2)(- mol Br2 g Br2 mol N2 mol Br2 (-- -) = mol N2 mol Br2 g N2 mol N2 (-- -) = |v g N2 mol N2 а. 1 b. 2 С. 3 d. 4 е. 5 f. 253.719 g. 3.38 х 100 h. 3.26 x 103 i. 44.0 j. 1.33 x 102 k. 9.77 x 103 I. 4.44 x 102 m. 6.66 x 10² n. 500.0 o. 556 р. 90.0 q. 3.2852 r. 159.81 s. 28.013 t. 1.750 u. 0.8750 v. 13.0 w. 0.46306 х. 1.3892 у. 24.5 z. 38.5 аа. 2.190 bb. evolved Cc. absorbed dd. exothermic ee. endothermic
8. The combustion of glucose is represented by the following balanced equation: C H12O +6 0 6 H0+ 6 CO2. The reaction uses 1 gram of both CgH12Og and O2. What is the percent yield if 0.45 g of H,0 is produced? O a. 0.31% b. 0.558% c. 100% O d. 80% AM9 Lit
Iron oxide reacts with carbon to produce elemental iron and carbon monoxide according the the equation shown below. Consider the reaction of 51.4 grams of Fe2O3 with 24.98 grams of C to produce 19.20 grams of Fe. Fe2O3(s)+3c(s)-------2Fe(s)+3CO(g) a. actual yield b. theoretical yield c. percent yield