An acid, which is responsible for the foul odor of dirty socks, is composed of C, H and O atoms. Combusting a 0.225 g sample of the compound in air produces 0.512 g CO2 and 0.209 g H,O. The MM of the acid = 116 g/mol. What is the molecular formula of the acid? A) C3H,0 B) CH1202 C) C,H,O2 D) CH,0 E) CH1,06

An acid, which is responsible for the foul odor of dirty socks, is composed of C, H and O atoms. Combusting a 0.225 g sample of the compound in air produces 0.512 g CO2 and 0.209 g H,O. The MM of the acid = 116 g/mol. What is the molecular formula of the acid? A) C3H,0 B) CH1202 C) C,H,O2 D) CH,0 E) CH1,06

Chemistry by OpenStax (2015-05-04)

1st Edition

ISBN:9781938168390

Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Publisher:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser

Chapter4: Stoichiometry Of Chemical Reactions

Section: Chapter Questions

Problem 84E: The principal component of mothballs is naphthalene, a compound with a molecular mass of about 130...

See similar textbooks

Similar questions

You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
What is the molarity of each ion present in aqueous solutions of the following compounds prepared by dissolving 28.0 g of each compound in water to make 785 mL of solution? (a) potassium oxide (b) sodium hydrogen carbonate (c) scandium(III) iodite (d) magnesium phosphate
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
The reaction of methane and water is one way to prepare hydrogen for use as a fuel: CH4(g) + H2O(g) CO(g) + 3 H2(g) If this reaction has a 37% yield under certain conditions, what mass of CH4 is required to produce 15 g of H2?
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
3.93 Adipic acid is used in the production of nylon, so it is manufactured in large quantities. The most common method for the preparation of adipic acid is the reaction of cyclohexane with oxygen. Balance the skeleton equation shown be1ow.
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
The principal component of mothballs is naphthalene, a compound with a molecular mass of about 130 amu, containing only carbon and hydrogen. A 3.000-mg sample of naphthalene burns to give 10.3 mg of CO2. Determine its empirical and molecular formulas.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)