Amines with more than 6 carbons are soluble in: a)) aqueous HCI b) aqueous NaHCO3 d) water c) aqueous NaOH Which of the following would give a positive iodoform test? b) acetone d) cyclopentanone a) benzophenone c) 3-pentanone "Saponification" as the term is used in organic chemistry means: a) acidic hydrolysis of an ester basic hydrolysis of an ester c) acidic hydrolysis of an amide d) basic hydrolysis of an amide ( ) Propylamine can be synthesized by the LiAIH4 reduction of: a) CH3CH2CECH c) CH3CH2NO2 met b) CH3CH=NH (d) CH3CH2CEN

Amines with more than 6 carbons are soluble in: a)) aqueous HCI b) aqueous NaHCO3 d) water c) aqueous NaOH Which of the following would give a positive iodoform test? b) acetone d) cyclopentanone a) benzophenone c) 3-pentanone "Saponification" as the term is used in organic chemistry means: a) acidic hydrolysis of an ester basic hydrolysis of an ester c) acidic hydrolysis of an amide d) basic hydrolysis of an amide ( ) Propylamine can be synthesized by the LiAIH4 reduction of: a) CH3CH2CECH c) CH3CH2NO2 met b) CH3CH=NH (d) CH3CH2CEN

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Related questions

Q: < 12:58 Question 15.a of 25 Classify the following amine. A) primary amine B) secondary amine C)…

Q: A: aromatic compound B: A C:

A: In the given question we have to discuss the functional group or types of molecules present in the…

Q: chyl-4-dimethylamine chyl-N,N-dimethylpentyl-2-amine chyl-N,N-dimethylpentyl-2-amine…

Q: Erythronolide B is Erythronolide B do H₂C H₂G H₂CH₂C O a. Amide OH CH₂ Erythronolide B b. Ketone C.…

A: We have given an organic compound and we have to identify functional group in the given organic…

Q: Amides can undergo a two-step hydrolysis process. H 1. NaOH 2. HCI, H₂O

A: Answer:Amide is a derivative carboxylic acid and its hydrolysis in basic medium is performed and we…

Q: Why is aspirin a carboxylic acid?

A: Why is aspirin a carboxylic acid?

Q: Write the systematic (IUPAC) names for the amines. The names should have the format alkanamine.…

A: RULES for IUPAC nomenclature; In first step, we identify functional groups present. We make longest…

Q: Give the IUPAC name for the following acid amide: CH3CH2CH(CH3)CH2CH(CH3)CH₂C NH2

A: Structure of acid amide:find out IUPAC name

Q: The substance 2-methylpiperidine is a weak nitrogenous base like ammonia. Complete the following…

A: Given,The reaction:

Q: Draw a structural formula for each carboxylic acid. (a) 4-Nitrophenylacetic acid…

A: Carboxylic acid has functionalgroup is -COOH. The numbering of the carbon starts from the acid…

Q: Sketch the product, Then writeh the IUPAC NAME OF THE AMINE PRODUCT and the dominant Intermolecular…

Q: What are examples of amine compounds that are commonly found in nature and discuss their functions…

Q: A) Name the structure B) Can this amine form an amide? If yes, show below the structure of the…

A: Interpretation- To write the name of the structure . To tell about which amine can this amine form…

Q: Sodium borohydride used in the organic lab is a(n) O amine O carboxylic acid O oxidizing agent…

A: Sodium borohydride used in the organic lab is a(n) Given option :1.amine 2.carboxylic acid…

Q: for the following structures a.) please write the chemical formula for each b.) label which class…

A: The chemical formula is a way of giving information about the proportions of the elements present in…

Q: What acids can be used to protonate an amine?

Q: Account for the fact that most low-molecular-weight amines are very soluble in water, whereas low-…

A: Solubility: The solubility of a chemical substance in water depends on the polar nature of the…

Q: Write an equation for the formation of the free amine from butylammonium chloride by reaction with…

A: The general formula of primary amine is R-NH2. Formation of amine can be done by many methods such…

Q: Which of the following functional groups can be found in trans-Cinnamic acid? Group of answer…

A: The compound considered is trans-Cinnamic acid.

Question

Amines with more than 6 carbons are soluble in:
a) aqueous HCI
b) aqueous NaHCO3
d) water
c) aqueous NaOH
Which of the following would give a positive iodoform test?
acetone
a) benzophenone
c) 3-pentanone
d) cyclopentanone
meth
"Saponification" as the term is used in organic chemistry means:
a) acidic hydrolysis of an ester
b) basic hydrolysis of an ester
c) acidic hydrolysis of an amide
d) basic hydrolysis of an amide
3. (
Propylamine can be synthesized by the LiAlH4 reduction of:
a) CH3CH2CECH
b) CH3CH=NH
d)) CH3CH2CEN
c) CH3CH2NO2

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

< app.101edu.co Classify and describe the properties of the following nitrogen containing compound. O CI O + Question 13.a of 25 CH3 N Classify the following amine. H CH3 A) primary amine B) secondary amine C) tertiary amine @=J D) tertiary amine salt E) quaternary ammonium salt
2. Draw the structural formulas for the reactants and products for the following reactions. Name the organic product that forms D and E
11. Write the chemical reaction for the acid hydrolysis of each amide sample. Include the 유 condensed structural formulas of the reactants and products. 11 CH3-C-NH₂ +H20+HCI CH3-C-OH + NH4+ CI- ACETAMIDE SO -NH2 +H20 T → 0 COOH + NH 3 11
What is the IUPAC name of the following compound? a) 2-methyl-3-amino-1-cyclopentanone b) 3-amine-2-methyl-1-cyclopentanone c) 2-methyl-3-aminocyclopentanone d) 3-amino-2-methylcyclopentanone
What is the difference between alkyl dimethyl benzyl ammonium chloride and hydrogen peroxide used in disinfectant production?
Complete this table for different amine compounds. Chemical propylamine quaternary ammonium ion methylphenylamine Molecular formula C3H9N C₂H7N C5H13N C4H10N Structural formula (CH3)3N (CH3)2NH CH 3 I (CH₂) 11 | H3C(CH2) 11 -N-(CH₂)11CH3 NHCH3 (CH₂)11 CH3 CH3CH2CH2-NH-CH3 + Classification Tertiary Quaternary Tertiary Secondary
Why are ethers used as inhalation in general anesthetics? Describe why we do no use diethyl ether as a general inhalation anesthetics anymore? What are we using today as general inhalation anesthetics? Are there draw backs to modern day inhalation as the anesthetics?
What is the product when Methyl phenylacetate reacts with NH3 and ether in order to form amide?
4. Which acid and alcohol must be reacted to generate the indicated esters? (a) (b) (c) ов ↑ (d) OH
Which compound can react with ammonia to produce an amide? A) CHCH-CH-ОН B) C) D) CH,CH,CH,CH,-Ĉ-OH
What are the products of the reaction between acetyl chloride and diethylamine? HCl and N,N-diethylacetamide Оа. o b. HCl and diethylamine chloride ос. HCl and N-ethylacetamide d. Diethylacetamide and acid
write a series of equations to illustrate the reaction