Aluminum reacts with elemental chlorine to form the sole product of aluminum chloride in a combination reaction. If 48 grams of aluminum and 100 g of chlorine are reacted the chemist actually recovered 42.9 grams of product. What is the percent yield of the reaction?

Aluminum reacts with elemental chlorine to form the sole product of aluminum chloride in a combination reaction. If 48 grams of aluminum and 100 g of chlorine are reacted the chemist actually recovered 42.9 grams of product. What is the percent yield of the reaction?

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.60E

See similar textbooks

Similar questions

Urea is used as a fertilizer because it can react with water to release ammonia, which provides nitrogen to plants. (NH2)2CO(s) + H2O() 2 NH3(aq) + CO2(g) (a) When 300. g urea and 100. g water are combined, calculate the mass of ammonia and the mass of carbon dioxide that form. (b) Calculate the mass of the excess reactant that remains after reaction.
Methane (CH4) is the main component of marsh gas. Heating methane in the presence of sulfur produces carbon disulfide and hydrogen sulfide as the only products. a. Write the balanced chemical equation for the reaction of methane and sulfur. b. Calculate the theoretical yield of carbon disulfide when 120. g of methane is reacted with an equal mass of sulfur.
Quicklime, CaO, is formed when calcium hydroxide is heated. Ca(OH)2(s) → CaO(s) + H2O(ℓ) The theoretical yield is 65.5 g but only 36.7 g quicklime I is produced. Calculate the percent yield.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
Ammonia can be formed by a direct reaction of nitrogen and hydrogen. N2(g) + 3 H2(g) 2 NH3(g) A tiny portion of the starting mixture is represented by the diagram, where the blue circles represent N and the white circles represent H. Which of these represents the product mixture? For the reaction of the given sample, which of these statements is true? (a) N2 is the limiting reactant. (b) H2 is the limiting reactant. (c) NH, is the limiting reactant. (d) No reactant is limiting: they are present in the correct stoichiometric ratio.
A potential fuel for rockets is a combination of B5H9 and 0 2. The two react according to the following balanced equation: 2B5H9(l)+12O2(g)5B2O3(s)+9H2O(g) If one tank in a rocket holds 126 g B5H9 and another tank holds 192 g O2, what mass of water can be produced when the entire contents of each tank react together?
The following quantities are placed in a container: 1.51024 atoms of hydrogen, 1.0 mol of sulfur, and 88.0 g of diatomic oxygen. What is the total mass in grams for the collection of all three elements? What is the total number of moles of atoms for the three elements? If the mixture of the three elements formed a compound with molecules that contain two hydrogen atoms, one sulfur atom, and four oxygen atoms, which substance is consumed first? How many atoms of each remaining element would remain unreacted in the change described in (c)?
Calcium carbonate forms carbon dioxide and calcium oxide when it is heated above 900 °C in a limekiln. When heated to 1000 °C in a laboratory, 4.31 g calcium carbonate produces 2.40 g calcium oxide and 1.90 g carbon dioxide. Outline a method similar to combustion analysis by which you could determine the empirical formula for calcium carbonate from these data. Carry out the determination.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Consider the following balanced chemical equation: A+5B3C+4D a. Equal masses of A and B are reacted. Complete each of the following with either A is the limiting reactant because ; B is the limiting reactant because ____ ; or we cannot determine the limiting reactant because _____ i. If the molar mass of A is greater than the molar mass of B, then ii. If the molar mass of B is greater than the molar mass of A, then b. The products of the reaction are carbon dioxide (C) and water (D). Compound A has a similar molar mass to carbon dioxide. Compound B is a diatomic molecule. Identify compound B, and support your answer. c. Compound A is a hydrocarbon that is 81.7 1% carbon by mass. Determine its empirical and molecular formulas.