Activity 5: Write the IUPAC and common names for each of the following CH3CH2CH2─CO─OCH2CH3 CH3─CO─OCH2CH2CH2CH3

Q: Which of these is a phosphorylid (phosphorus ylid)?

A:

Q: What is the IUPAC name of the product for the following reaction? CH₂CH₂CH₂Br, FeBr; ?

A: This is an example of Friedel-Crafts alkylation

Q: What is the structure of N,2-dimethylpropanamide ? NH ft C

A: Here, we have to identify the molecular structure from the given name.The IUPAC name is given as…

Q: What will be the products between ch3 nh2 and ch3ch2br

A: Answer: Here asked what will be the products formed, between the reaction of Methylamine(CH3NH2) and…

Q: which one of the following is least soluble in water?

A:

Q: Draw Intermediate

A: Product of following reaction can be made by applying appropriate reaction mechanism.

Q: Give IUPAC names for the following compounds. a) b) CH₂CH₂CH3 CH3CHCH₂CCH₂CH3 CH3 CH3 CH₂CH3 CH3…

A: IUPAC name consists of-Prefix + Root Word + SuffixPrefix comprises branches attached to the single…

Q: Provide the IUPAC name for the following compound: CH3CH2CH2CH2CH(CH3)CH2CH2CH(CH2CH3)2

A: Step 1:Long chain has 10 carbons So called dec   Step 2: Step 3: Step 4:

Q: What is the IUPAC name of the following substance? CH3CH2

A: The continuous chain is number in a way that the functional group (here double bond) gets the lowest…

Q: Either the reactant (X) or the major organic product is missing from the equation below. Draw the…

A: Organic reactions can be defined as the reactions in which organic reactants react with each other…

Q: what are the names of the these compounds and which one is a stronger acid CH3OCH2CH2OH or…

A:

Q: What is the IUPAC name of the following? 0 (CH3)3CCOCH2CH3

A:

Q: What is the product of the following reaction? CH3CH₂CH₂CH₂OH aldehyde ketone carboxylic acid ester…

A: The given reaction is a simple esterification reaction on reaction between alcohol and acid…

Q: CH3 CH3 TH 3LOCOCOCCH3 H3NCCOCH2 PH Et, N

A: Protection of amine group:

Q: 20. Which of the following could be used as a solvent for the above reaction? a) CH3CH2OH b)…

A: Solvent used in any reaction that solubilize that reactants . As alkyne is non-polar molecule,  thus…

Q: Please explain how you can find the iupac names of the following  CH3CH2NH2 CH3OCH3 CH3CH2CH3

A: We know  Priority order : Functional group > multiple bond > substituent

Q: What is the IUPAC name of the following compound? CH₂CH3 CH₂CH₂CHCH₂OH

A:

Q: Complete the equations

A: Carbenes Carbenes are the electron deficient reaction intermediates in which both lone pair of…

Q: What's the best protecting group for NH2 and how to remove the protecting group? r…

A:

Q: Name the alkene

A:

Q: What is the IUPAC name of the following substance? CH3 CH3CH₂CH₂C=CCCH3 CH3

A: We need to write the IUPAC name of the given compound. The given substance contains a triple bond…

Q: What is the IUPAC name of each of the the following? CH₂CH₂CHCNH₂ CH₂CH₂ CH₂CH₂CHCNHCH₂- CH₂CH₂

A: Naming of M-substituted Amide: The prefix N- is used to name the alkyl group attached to the N-atom.…

Q: Draw the product of the reaction CH3CH2CH2CH2C=CCH3 + 2Br2→?

A:

Q: b) CICH2CH2CH2CH2CI + Nażs C4H3S ↑

A:

Q: Br CH3CHCH₂CH3

A:

Q: What is the line form of (CH3)3CCO2CH(CH2CH3)2

A: The covalent bonds in a molecule can be represented by line formula. The intersection of two lines…

Q: What is the IUPAC name for this compound? CH3 CH3CH2CHCHCH2CH3 CI

A: Answer: IUPAC name of the compound is 3-chloro-4-methylhexaneExplanation:Step 1:

Q: -COCH3 CH3OCCH,CH2COCH3

A:

Q: What is the common name of the following compound? CH3 CH3CHCH20CH3

A: The functional group in the given compound is ether having general formula - R-O-R or R-O-R'  where…

Q: Give IUPAC names for the following compounds. a) CH3CH2C(CH3)2CH3 CH3 CH2CH3 b) CH3CH2CH2CHCH2ĊCH3…

A: We have to name the IUPAC for the given following two compounds as follows in step 2:

Q: True or false, explain your answer.

A: The compound contains a stereocenter, specifically the carbon atom bonded to the oxygen atom (C∗).…

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.